{{Short description|Opioid designer drug}} {{drugbox | drug_name = Homofentanyl | image = Homofentanyl.svg | image_class = skin-invert-image | image2 = Homofentanyl 3D BS.png | image_class2 = bg-transparent | legal_UK = | legal_DE = | C = 23 | H = 30 | N = 2 | O = 1 | IUPAC_name = N-phenyl-N-[1-(3-phenylpropyl)piperidin-4-yl]propanamide | CAS_number = 59708-54-2 | CAS_supplemental = <BR> 117332-88-4 (HCl) | ChemSpiderID = 537642 | PubChem = 618626 | UNII = GBD33DI2IP | smiles = CCC(=O)N(C1CCN(CC1)CCCC2=CC=CC=C2)C3=CC=CC=C3 | StdInChI = 1S/C23H30N2O/c1-2-23(26)25(21-13-7-4-8-14-21)22-15-18-24(19-16-22)17-9-12-20-10-5-3-6-11-20/h3-8,10-11,13-14,22H,2,9,12,15-19H2,1H3 | StdInChIKey = CKBFKWWOUYBCRH-UHFFFAOYSA-N }}
'''Homofentanyl''' ('''''N''-phenylpropylnorfentanyl''', '''fentanyl propyl analogue''') is an opioid derivative which has been sold as a designer drug. It is a homologue of fentanyl, with similar analgesic and sedative effects but lower potency,<ref name="pmid3711827">{{cite journal | vauthors = Cooper D, Jacob M, Allen A | title = Identification of fentanyl derivatives | journal = Journal of Forensic Sciences | volume = 31 | issue = 2 | pages = 511–28 | date = April 1986 | pmid = 3711827 | doi = 10.1520/JFS12283J }}</ref><ref>{{cite web | url = https://www.incb.org/documents/Global_Projects_OPIOIDS/INCB.GRIDS.OPIOIDS.Fentanyl-Rel_Subs_list.pdf | title = Fentanyl-Related Substances with no Currently Known Legitimate Uses. | work = International Narcotics Control Board (INCB) | date = 15 September 2020 }}</ref> around 14 times stronger than pethidine.<ref>{{cite book | vauthors = Casy AF, Parfitt RY | title = Opioid analgesics, chemistry and receptors | date = 1986 | publisher = Plenum Press | location = New York | pages = 289 | isbn = 978-0-306-42130-3 }}</ref>
== See also == * Acetylfentanyl * Benzylfentanyl * Butyrylfentanyl * Fentanyl azepane * Isofentanyl * Secofentanyl * OPPPP
== References == {{reflist}}
{{Opioids}}
Category:Designer drugs Category:Opioids Category:Anilides Category:Piperidines
{{analgesic-stub}}