{{Short description|Chemical compound}} {{drugbox | drug_name = Secofentanyl | image = Secofentanyl.svg | image_class = skin-invert-image | legal_UK = | legal_DE = | C = 22 | H = 30 | N = 2 | O = 1 | IUPAC_name = N-[4-[methyl(2-phenylethyl)amino]butan-2-yl]-N-phenylpropanamide | CAS_number = 253342-66-4 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = DGK2A2KAN8 | CAS_supplemental = | ChemSpiderID = | PubChem = 11724725 | smiles = CCC(=O)N(C1=CC=CC=C1)C(C)CCN(C)CCC2=CC=CC=C2 | StdInChI = 1S/C22H30N2O/c1-4-22(25)24(21-13-9-6-10-14-21)19(2)15-17-23(3)18-16-20-11-7-5-8-12-20/h5-14,19H,4,15-18H2,1-3H3 | StdInChIKey = TVSLDWMMAUJGPV-UHFFFAOYSA-N }}
'''Secofentanyl''' is an opioid derivative which is an analogue of fentanyl where the piperidine ring has been cleaved to form an open-chain structure. It is around 40× less potent than fentanyl itself but still 5–6× the potency of morphine in animal tests.<ref>{{cite journal | vauthors = Ivanović MD, Mićović I, Vučković S, Prostran M, Todorović Z, Ivanović E, Kiricojević V, Đorđević JB, Došen-Mićović L | title = The synthesis and pharmacological evaluation of (+/-)-2, 3-seco-fentanyl analogues. | journal = Journal of the Serbian Chemical Society | date = 2004 | volume = 69 | issue = 11 | pages = 955–68 | doi = 10.2298/JSC0411955I | doi-access = free }}</ref><ref name="pmid30791394">{{cite journal | vauthors = Lipiński PF, Kosson P, Matalińska J, Roszkowski P, Czarnocki Z, Jarończyk M, Misicka A, Dobrowolski JC, Sadlej J | title = Fentanyl Family at the Mu-Opioid Receptor: Uniform Assessment of Binding and Computational Analysis | journal = Molecules (Basel, Switzerland) | volume = 24 | issue = 4 | date = February 2019 | page = 740 | pmid = 30791394 | pmc = 6412969 | doi = 10.3390/molecules24040740 | doi-access = free }}</ref>
== See also == * Benzylfentanyl * Homofentanyl * Diampromide * Fentanyl azepane * Isofentanyl * Phenampromide
== References == {{reflist}}
{{Opioids}}
Category:Designer drugs Category:Opioids
{{analgesic-stub}}