{{Short description|Opioid analgesic designer drug}} {{Drugbox | IUPAC_name = ''N''-(1-Benzyl-3-methylpiperidin-4-yl)-''N''-phenylpropanamide | image = Isofentanyl Structure.svg | image_class = skin-invert-image | image2 = Isofentanyl 3D BS.png | image_class2 = bg-transparent

<!--Clinical data--> | pregnancy_category = | legal_AU = | legal_CA = | legal_UK = | legal_US = Schedule I<ref name=pmid29932611>{{Cite journal| pmid = 29932611| year = 2018| last1 = Drug Enforcement Administration| first1 = Department of Justice| title = Schedules of Controlled Substances:Temporary Placement of Fentanyl-Related Substances in Schedule I. Temporary amendment; temporary scheduling order| journal = Federal Register| volume = 83| issue = 25| pages = 5188–92}}</ref> | legal_status = | routes_of_administration =

<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 79278-40-3 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = BT57ARH9QX | ATC_prefix = | ATC_suffix = | PubChem = 10449690 | DrugBank_Ref = | DrugBank = | ChemSpiderID = 8625107 | ChEBI_Ref = | ChEBI =

<!--Chemical data--> | C=22 | H=28 | N=2 | O=1 | smiles = c2ccccc2N(C(=O)CC)C1CCN(CC1C)Cc3ccccc3 | StdInChI = | StdInChIKey = | synonyms = }}

'''Isofentanyl''' ('''3-methyl-benzylfentanyl''') is an opioid analgesic that is an analog (and structural isomer) of fentanyl first invented in 1973,<ref>{{cite journal | vauthors = Riley TN, Hale DB, Wilson MC | title = 4-Anilidopiperidine analgesics. I. Synthesis and analgesic activity of certain ring-methylated 1-substituted 4-propananilidopiperidines | journal = Journal of Pharmaceutical Sciences | volume = 62 | issue = 6 | pages = 983–6 | date = June 1973 | pmid = 4712637 | doi = 10.1002/jps.2600620627 | bibcode = 1973JPhmS..62..983R }}</ref> and which has been sold as a designer drug.<ref>{{cite journal | vauthors = Meyer MR, Dinger J, Schwaninger AE, Wissenbach DK, Zapp J, Fritschi G, Maurer HH | title = Qualitative studies on the metabolism and the toxicological detection of the fentanyl-derived designer drugs 3-methylfentanyl and isofentanyl in rats using liquid chromatography-linear ion trap-mass spectrometry (LC-MS(n)) | journal = Analytical and Bioanalytical Chemistry | volume = 402 | issue = 3 | pages = 1249–55 | date = January 2012 | pmid = 22065349 | doi = 10.1007/s00216-011-5528-8 | s2cid = 329682 }}</ref>

== Side effects == Side effects of fentanyl analogs are similar to those of fentanyl itself, which include itching, nausea and potentially serious respiratory depression, which can be life-threatening. Fentanyl analogs have killed hundreds of people throughout Europe and the former Soviet republics since the most recent resurgence in use began in Estonia in the early 2000s, and novel derivatives continue to appear.<ref>{{cite journal | vauthors = Mounteney J, Giraudon I, Denissov G, Griffiths P | title = Fentanyls: Are we missing the signs? Highly potent and on the rise in Europe | journal = The International Journal on Drug Policy | volume = 26 | issue = 7 | pages = 626–31 | date = July 2015 | pmid = 25976511 | doi = 10.1016/j.drugpo.2015.04.003 | url = http://www.ijdp.org/article/S0955-3959%2815%2900097-3/abstract | url-access = subscription }}</ref> A new wave of fentanyl analogues and associated deaths began in around 2014 in the US, and have continued to grow in prevalence; especially since 2016 these drugs have been responsible for hundreds of overdose deaths every week.<ref name="pmid29042317">{{cite journal | vauthors = Armenian P, Vo KT, Barr-Walker J, Lynch KL | title = Fentanyl, fentanyl analogs and novel synthetic opioids: A comprehensive review | journal = Neuropharmacology | volume = 134| issue = Pt A| date = October 2017 | pages = 121–132 | pmid = 29042317 | doi = 10.1016/j.neuropharm.2017.10.016 | s2cid = 21404877 | url = https://cloudfront.escholarship.org/dist/prd/content/qt8xh0s7nf/qt8xh0s7nf.pdf }}</ref>

== Legal status == As a structural isomer of fentanyl itself, isofentanyl is banned under drug analogue laws in many jurisdictions around the world. In the United States, fentanyl-related substances are Schedule I controlled substances.<ref name=pmid29932611/>

== See also == * 3-Methylfentanyl * Benzylfentanyl * α-Methylacetylfentanyl * 4-Methylphenethylacetylfentanyl * Homofentanyl * Secofentanyl * List of fentanyl analogues

== References == {{Reflist}}

{{Opioidergics}}

Category:Anilides Category:Designer drugs Category:Mu-opioid receptor agonists Category:Piperidines Category:Synthetic opioids