{{Short description|Chemical compound}} {{cs1 config|name-list-style=vanc}} {{Drugbox | IUPAC_name = [1-(3-oxo-3-phenylpropyl)-4-phenylpiperidin-4-yl] propanoate | image = OPPPP Structure.svg | image_class = skin-invert-image <!--Clinical data--> | tradename = | legal_US = | legal_status =
<!--Pharmacokinetic data--> | bioavailability = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number = 802832-29-7 | CAS_supplemental = <br>{{CAS|4472-57-5}} (HCl) | PubChem = 424788 | ChemSpiderID = 375886
<!--Chemical data--> | C=23 | H=27 | N=1 | O=3 | SMILES = CCC(=O)OC1(CCN(CC1)CCC(=O)C2=CC=CC=C2)C3=CC=CC=C3 | StdInChI=1S/C23H27NO3/c1-2-22(26)27-23(20-11-7-4-8-12-20)14-17-24(18-15-23)16-13-21(25)19-9-5-3-6-10-19/h3-12H,2,13-18H2,1H3 | StdInChIKey = GCFJWMMGLWBENW-UHFFFAOYSA-N }}
'''OPPPP''' ('''1-(3-Oxo-3-phenylpropyl)-4-phenyl-4-piperidinyl propionate''', '''EA-2221''') is one of several compounds derived from MPPP, the reversed ester of the opioid analgesic pethidine, which were sold as designer drugs in the 1980s, but have been rarely encountered by law enforcement since the passage of the Federal Analogue Act in 1986.<ref>{{cite book | vauthors = Valter K, Arrizabalaga P | title = Designer Drugs Directory | date = 1998 | pages = 147–148, 156 | publisher = Elsevier | isbn = 0-444-20525-X }}</ref> In animal studies it was found to be around 1000× the potency of pethidine,<ref name="pmid14056434">{{cite journal | vauthors = Carabateas PM, Grumbach L | title = Strong analgesics. Some 1-substituted 4-phenyl-4-propionoxypiperidines | journal = Journal of Medicinal and Pharmaceutical Chemistry | volume = 91 | issue = 5| pages = 913–9 | date = September 1962 | pmid = 14056434 | doi = 10.1021/jm01240a003 }}</ref> making it several times the potency of fentanyl and with similar hazards of respiratory depression and overdose. It is closely related to numerous compounds made by Janssen et al. for which the structure-activity relationship is well established.<ref name="pmid14406754">{{cite journal | vauthors = Janssen PA, Eddy NB | title = Compounds related to pethidine-IV. New general chemical methods of increasing the analgesic activity of pethidine | journal = Journal of Medicinal and Pharmaceutical Chemistry | volume = 2 | issue = | pages = 31–45 | date = February 1960 | pmid = 14406754 | doi = 10.1021/jm50008a003 }}</ref>
==See also== * List of fentanyl analogues * PEPAP * LY-88329
== References ==
{{Reflist}}
Category:4-Phenylpiperidines Category:Mu-opioid receptor agonists Category:Synthetic opioids
{{nervous-system-drug-stub}}