{{cs1 config|name-list-style=vanc|display-authors=6}} {{Infobox drug | image = Cortagen_structure.png | image_class = skin-invert-image | width = 260 <!-- Clinical data --> | tradename = | pregnancy_category = | routes_of_administration = | class = | ATC_prefix = | ATC_suffix = | ATC_supplemental = <!-- Legal status --> | legal_status = <!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = | excretion = <!-- Identifiers --> | CAS_number = | PubChem = 18439621 | IUPHAR_ligand = | DrugBank = | ChemSpiderID = 16364972 | UNII = | KEGG = | ChEBI = | ChEMBL = | NIAID_ChemDB = | PDB_ligand = <!-- Chemical and physical data --> | IUPAC_name = <nowiki>(2S)-1-[(2S)-2-[[(2S)-2-[[(2S)-2-aminopropanoyl]amino]-4-carboxybutanoyl]amino]-3-carboxypropanoyl]pyrrolidine-2-carboxylic acid</nowiki> | C = 17 | H = 26 | N = 4 | O = 9 | StdInChI = 1S/C17H26N4O9/c1-8(18)14(26)19-9(4-5-12(22)23)15(27)20-10(7-13(24)25)16(28)21-6-2-3-11(21)17(29)30/h8-11H,2-7,18H2,1H3,(H,19,26)(H,20,27)(H,22,23)(H,24,25)(H,29,30)/t8-,9-,10-,11-/m0/s1 | StdInChIKey = PLTRIMAUDDQYRV-NAKRPEOUSA-N | SMILES = C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)N1CCC[C@H]1C(=O)O)N }}

'''Cortagen''' is a tetrapeptide with the sequence '''AEDP''' or Ala-Glu-Asp-Pro. It was originally identified as a primary active component of Cortexin, a mixture of peptides derived from cow brain cortex tissue. It is claimed to stimulate nerve growth and enhance repair of damaged nerves.<ref>{{cite journal | vauthors = Turchaninova LN, Kolosova LI, Malinin VV, Moiseeva AB, Nozdrachev AD, Khavinson VK | title = Effect of tetrapeptide cortagen on regeneration of sciatic nerve | journal = Bulletin of Experimental Biology and Medicine | volume = 130 | issue = 12 | pages = 1172–1174 | date = December 2000 | doi = 10.1023/A:1017532001908 | pmid = 11276314 }}</ref><ref>{{cite journal | vauthors = Anisimov SV, Khavinson VK, Anisimov VN | title = Elucidation of the effect of brain cortex tetrapeptide Cortagen on gene expression in mouse heart by microarray | journal = Neuro Endocrinology Letters | date = 2004 | volume = 25 | issue = 1–2 | pages = 87–93 | pmid = 15159690 }}</ref><ref>{{cite journal | vauthors = Zarubina IV, Shabanov PD | title = [Cortexin and cortagen as correcting agents in functional and metabolic disorders in the brain in chronic ischemia] | journal = Eksperimental'naia i Klinicheskaia Farmakologiia | date = 2011 | volume = 74 | issue = 2 | pages = 8–15 | pmid = 21476278 }}</ref><ref>{{cite journal | vauthors = Zarubina IV, Shabanov PD | title = Neuroprotective Effects of Peptides during Ischemic Preconditioning | journal = Bulletin of Experimental Biology and Medicine | volume = 160 | issue = 4 | pages = 448–451 | date = February 2016 | pmid = 26902350 | doi = 10.1007/s10517-016-3193-9 }}</ref>

== See also == * Epitalon * GHK-Cu * GPE * KPV tripeptide * Livagen * Pinealon * Vladimir Khavinson

== References == {{Reflist}}

Category:Tricarboxylic acids Category:Tetrapeptides