{{cs1 config|name-list-style=vanc|display-authors=6}} {{Infobox drug | image = Vesugen_structure.png | image_class = skin-invert-image | width = 220 <!-- Clinical data --> | tradename = | pregnancy_category = | routes_of_administration = | class = | ATC_prefix = | ATC_suffix = | ATC_supplemental = <!-- Legal status --> | legal_status = <!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = | excretion = <!-- Identifiers --> | CAS_number = 204271-66-9 | PubChem = 87571363 | IUPHAR_ligand = | DrugBank = | ChemSpiderID = 16572739 | UNII = | KEGG = | ChEBI = 159909 | ChEMBL = | NIAID_ChemDB = | PDB_ligand = <!-- Chemical and physical data --> | IUPAC_name = (2''S'')-2-<nowiki>[[</nowiki>(2''S'')-4-carboxy-2-<nowiki>[[</nowiki>(2''S'')-2,6-diaminohexanoyl]amino]butanoyl]amino]butanedioic acid | C = 15 | H = 26 | N = 4 | O = 8 | StdInChI = 1S/C15H26N4O8/c16-6-2-1-3-8(17)13(24)18-9(4-5-11(20)21)14(25)19-10(15(26)27)7-12(22)23/h8-10H,1-7,16-17H2,(H,18,24)(H,19,25)(H,20,21)(H,22,23)(H,26,27)/t8-,9-,10-/m0/s1 | StdInChIKey = LLSUNJYOSCOOEB-GUBZILKMSA-N | SMILES = C(CCN)C[C@@H](C(=O)N[C@@H](CCC(=O)O)C(=O)N[C@@H](CC(=O)O)C(=O)O)N }}

'''Vesugen''' ('''T-38''') is a tripeptide with the sequence '''KED''' or Lys-Glu-Asp. It is one of a number of small peptides developed in Russia in the late 1990s and early 2000s<ref>{{cite patent | inventor = Khavinson VK, Grigor'ev EI, Malinin VV, Ryzhak GA | title = Peptide enhancing resistance of capillaries, pharmaceutical composition based on thereof and method for its use | country = RU | number = 2295970 | url = https://patents.google.com/patent/RU2295970C1/en?oq=RU2295970C1 | assign = SIA Peptaids | gdate = 27 March 2007 }}</ref> which are purported to have anti-aging effects.<ref>{{cite journal | vauthors = Khavinson VK, Linkova NS, Polyakova VO, Kheifets OV, Tarnovskaya SI, Kvetnoy IM | title = Peptides tissue-specifically stimulate cell differentiation during their aging | journal = Bulletin of Experimental Biology and Medicine | volume = 153 | issue = 1 | pages = 148–151 | date = May 2012 | pmid = 22808515 | doi = 10.1007/s10517-012-1664-1 }}</ref><ref>{{cite journal | vauthors = Ashapkin V, Khavinson V, Shilovsky G, Linkova N, Vanuyshin B | title = Gene expression in human mesenchymal stem cell aging cultures: modulation by short peptides | journal = Molecular Biology Reports | volume = 47 | issue = 6 | pages = 4323–4329 | date = June 2020 | pmid = 32399807 | doi = 10.1007/s11033-020-05506-3 }}</ref> Vesugen is claimed to stimulate proliferation and protein synthesis in fibroblast cells in the skin and to improve the appearance of skin,<ref>{{cite journal | vauthors = Voicekhovskaya MA, Chalisova NI, Kontsevaya EA, Ryzhak GA | title = Effect of bioregulatory tripeptides on the culture of skin cells from young and old rats | journal = Bulletin of Experimental Biology and Medicine | volume = 152 | issue = 3 | pages = 357–359 | date = January 2012 | pmid = 22803085 | doi = 10.1007/s10517-012-1527-9 }}</ref><ref>{{cite journal | vauthors = Lin'kova NS, Drobintseva AO, Orlova OA, Kuznetsova EP, Polyakova VO, Kvetnoy IM, Khavinson VK | title = Peptide Regulation of Skin Fibroblast Functions during Their Aging In Vitro | journal = Bulletin of Experimental Biology and Medicine | volume = 161 | issue = 1 | pages = 175–178 | date = May 2016 | pmid = 27259496 | doi = 10.1007/s10517-016-3370-x }}</ref> as well as promoting neurotropic effects in brain tissue,<ref>{{cite journal | vauthors = Caputi S, Trubiani O, Sinjari B, Trofimova S, Diomede F, Linkova N, Diatlova A, Khavinson V | title = Effect of short peptides on neuronal differentiation of stem cells | journal = International Journal of Immunopathology and Pharmacology | volume = 33 | date = 2019 | pmid = 30791821 | pmc = 6376556 | doi = 10.1177/2058738419828613 | article-number = 2058738419828613 }}</ref><ref>{{cite journal | vauthors = Khavinson VK, Lin'kova NS, Umnov RS | title = Peptide KED: Molecular-Genetic Aspects of Neurogenesis Regulation in Alzheimer's Disease | journal = Bulletin of Experimental Biology and Medicine | volume = 171 | issue = 2 | pages = 190–193 | date = May 2021 | pmid = 34173097 | doi = 10.1007/s10517-021-05192-6 }}</ref><ref>{{cite journal | vauthors = Kraskovskaya N, Linkova N, Sakhenberg E, Krieger D, Polyakova V, Medvedev D, Krasichkov A, Khotin M, Ryzhak G | title = Short Peptides Protect Fibroblast-Derived Induced Neurons from Age-Related Changes | journal = International Journal of Molecular Sciences | volume = 25 | issue = 21 | article-number = 11363 | date = October 2024 | pmid = 39518916 | pmc = 11546785 | doi = 10.3390/ijms252111363 | doi-access = free }}</ref> giving it a similar pharmacological profile to those claimed for the matrikine peptides produced by Western cosmetic skincare companies.

== See also == * Cortagen * Epitalon * GHK-Cu * KPV tripeptide * Livagen * Pinealon * Vladimir Khavinson

== References == {{Reflist}}

Category:Tricarboxylic acids Category:Tripeptides