{{cs1 config|name-list-style=vanc|display-authors=6}} {{Drugbox | IUPAC_name = <nowiki>(3S)-5-methyl-3-[[1-pentan-3-yl-2-(thiophen-2-ylmethyl)benzimidazole-5-carbonyl]amino]hexanoic acid</nowiki> | image = CMF-019_structure.png | image_class = skin-invert-image | width = 240
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = <!-- Schedule I / Schedule II / Schedule III --> | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | excretion =
<!--Identifiers--> | CAS_number = 1586787-08-7 | UNII = | PubChem = 73442763 | IUPHAR_ligand = | DrugBank = | ChemSpiderID = | ChEBI = | ChEMBL = | StdInChI = 1S/C25H33N3O3S/c1-5-19(6-2)28-22-10-9-17(25(31)26-18(12-16(3)4)14-24(29)30)13-21(22)27-23(28)15-20-8-7-11-32-20/h7-11,13,16,18-19H,5-6,12,14-15H2,1-4H3,(H,26,31)(H,29,30)/t18-/m0/s1 | StdInChIKey = VCQKKZXFASLXAH-SFHVURJKSA-N <!--Chemical data--> | C=25 | H=33 | N=3 | O=3 | S=1 | smiles = CCC(CC)N1C2=C(C=C(C=C2)C(=O)N[C@@H](CC(C)C)CC(=O)O)N=C1CC3=CC=CS3 }}
'''CMF-019''' is a drug which is a selective, small-molecule agonist for the apelin receptor. It is used in research into treatment for heart failure.<ref>{{cite journal | vauthors = Read C, Fitzpatrick CM, Yang P, Kuc RE, Maguire JJ, Glen RC, Foster RE, Davenport AP | title = Cardiac action of the first G protein biased small molecule apelin agonist | journal = Biochemical Pharmacology | volume = 116 | pages = 63–72 | date = September 2016 | pmid = 27475715 | doi = 10.1016/j.bcp.2016.07.018 | pmc = 5012889 }}</ref><ref>{{cite journal | vauthors = Trifonov L, Afri M, Palczewski K, Korshin EE, Gruzman A | title = An Expedient Synthesis of CMF-019: <nowiki>(S)-5-Methyl-3-{1-(pentan-3-yl)-2-(thiophen-2-ylmethyl)-1H-benzo[d]imidazole-5-carboxamido}hexanoic Acid</nowiki>, a Potent Apelin Receptor (APJ) Agonist | journal = Medicinal Chemistry | date = 2018 | volume = 14 | issue = 7 | pages = 688–694 | pmid = 29651942 | doi = 10.2174/1573406414666180412154952 | pmc = 6993063 }}</ref><ref>{{cite journal | vauthors = Narayanan S, Vasukuttan V, Rajagopal S, Maitra R, Runyon SP | title = Identification of potent pyrazole based APELIN receptor (APJ) agonists | journal = Bioorganic & Medicinal Chemistry | volume = 28 | issue = 4 | article-number = 115237 | date = February 2020 | pmid = 31948845 | doi = 10.1016/j.bmc.2019.115237 | pmc = 7055011 }}</ref>
== See also == * AM-8123 * Azelaprag * BMS-986224
== References == {{reflist}}
Category:Benzamides Category:Benzimidazoles Category:Carboxylic acids Category:Thiophenes
{{pharm-stub}}