{{cs1 config|name-list-style=vanc|display-authors=6}} {{Infobox drug | IUPAC_name = 3-[5-[(5-chloro-2-pyridinyl)methyl]-1,3,4-oxadiazol-2-yl]-5-(2,6-dimethoxyphenyl)-6-(ethoxymethyl)-4-hydroxy-1H-pyridin-2-one | image = BMS-986224_structure.png | image_class = skin-invert-image | width = 240

<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = <!-- Schedule I / Schedule II / Schedule III --> | legal_status = | routes_of_administration =

<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | excretion =

<!--Identifiers--> | CAS_number = 2055200-88-7 | UNII = | PubChem = 137106310 | IUPHAR_ligand = | DrugBank = | ChemSpiderID = | ChEBI = | ChEMBL = | StdInChI = 1S/C24H23ClN4O6/c1-4-34-12-15-19(20-16(32-2)6-5-7-17(20)33-3)22(30)21(23(31)27-15)24-29-28-18(35-24)10-14-9-8-13(25)11-26-14/h5-9,11H,4,10,12H2,1-3H3,(H2,27,30,31) | StdInChIKey = AGZKELPIAJYRDT-UHFFFAOYSA-N <!--Chemical data--> | C=24 | H=23 | Cl=1 | N=4 | O=6 | smiles = CCOCC1=C(C(=C(C(=O)N1)C2=NN=C(O2)CC3=NC=C(C=C3)Cl)O)C4=C(C=CC=C4OC)OC }}

'''BMS-986224''' is a drug which is a selective, small-molecule agonist for the apelin receptor. It has been researched for the treatment of heart failure.<ref>{{cite journal | vauthors = Tora G, Jiang J, Bostwick JS, Gargalovic PS, Onorato JM, Luk CE, Generaux C, Xu C, Galella MA, Wang T, He Y, Wexler RR, Finlay HJ | title = Identification of 6-hydroxy-5-phenyl sulfonylpyrimidin-4(1H)-one APJ receptor agonists | journal = Bioorganic & Medicinal Chemistry Letters | volume = 50 | article-number = 128325 | date = October 2021 | pmid = 34403724 | doi = 10.1016/j.bmcl.2021.128325 }}</ref><ref>{{cite journal | vauthors = Johnson JA, Kim SH, Jiang J, Phillips M, Schumacher WA, Bostwick JS, Gargalovic PS, Onorato JM, Luk CE, Generaux C, He Y, Chen XQ, Xu C, Galella MA, Wang T, Gordon DA, Wexler RR, Finlay HJ | title = Discovery of a Hydroxypyridinone APJ Receptor Agonist as a Clinical Candidate | journal = Journal of Medicinal Chemistry | volume = 64 | issue = 6 | pages = 3086–3099 | date = March 2021 | pmid = 33689340 | doi = 10.1021/acs.jmedchem.0c01878 }}</ref><ref>{{cite journal | vauthors = Gargalovic P, Wong P, Onorato J, Finlay H, Wang T, Yan M, Crain E, St-Onge S, Héroux M, Bouvier M, Xu C, Chen XQ, Generaux C, Lawrence M, Wexler R, Gordon D | title = In Vitro and In Vivo Evaluation of a Small-Molecule APJ (Apelin Receptor) Agonist, BMS-986224, as a Potential Treatment for Heart Failure | journal = Circulation: Heart Failure | volume = 14 | issue = 3 | article-number = e007351 | date = March 2021 | pmid = 33663236 | doi = 10.1161/CIRCHEARTFAILURE.120.007351 | pmc = 7982131 }}</ref>

== See also == * Azelaprag * AM-8123 * CMF-019

== References == {{reflist}}

Category:Oxadiazoles

{{cardiovascular-drug-stub}}