{{cs1 config|name-list-style=vanc|display-authors=6}} {{Drugbox | IUPAC_name = (1S,2S)-N-[4-(2,6-dimethoxyphenyl)-5-(5-methyl-3-pyridinyl)-1,2,4-triazol-3-yl]-1-(5-methylpyrimidin-2-yl)-1-propan-2-yloxypropane-2-sulfonamide | image = AM8123_structure.png | image_class = skin-invert-image | width = 240

<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = <!-- Schedule I / Schedule II / Schedule III --> | legal_status = | routes_of_administration =

<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | excretion =

<!--Identifiers--> | CAS_number = 2049973-02-4 | UNII = | PubChem = 122702584 | IUPHAR_ligand = | DrugBank = | ChemSpiderID = | ChEBI = | ChEMBL = | StdInChI = 1S/C27H33N7O5S/c1-16(2)39-24(25-29-13-18(4)14-30-25)19(5)40(35,36)33-27-32-31-26(20-11-17(3)12-28-15-20)34(27)23-21(37-6)9-8-10-22(23)38-7/h8-16,19,24H,1-7H3,(H,32,33)/t19-,24+/m0/s1 | StdInChIKey = RKKBDGLXAWMONW-YADARESESA-N <!--Chemical data--> | C=27 | H=33 | N=7 | O=5 | S=1 | smiles = CC1=CC(=CN=C1)C2=NN=C(N2C3=C(C=CC=C3OC)OC)NS(=O)(=O)[C@@H](C)[C@H](C4=NC=C(C=N4)C)OC(C)C }}

'''AM-8123''' is a drug which is a selective, small-molecule agonist for the apelin receptor. It is used in research into treatment for heart failure.<ref>{{cite journal | vauthors = Ason B, Chen Y, Guo Q, Hoagland KM, Chui RW, Fielden M, Sutherland W, Chen R, Zhang Y, Mihardja S, Ma X, Li X, Sun Y, Liu D, Nguyen K, Wang J, Li N, Rajamani S, Qu Y, Gao B, Boden A, Chintalgattu V, Turk JR, Chan J, Hu LA, Dransfield P, Houze J, Wong J, Ma J, Pattaropong V, Véniant MM, Vargas HM, Swaminath G, Khakoo AY | title = Cardiovascular response to small-molecule APJ activation | journal = JCI Insight | volume = 5 | issue = 8 | date = April 2020 | pmid = 32208384 | doi = 10.1172/jci.insight.132898 | pmc = 7205427 }}</ref>

== See also == * Azelaprag * BMS-986224 * CMF-019

== References == {{reflist}}

Category:Benzene derivatives Category:Ethers Category:Methoxy compounds Category:Pyridines Category:Pyrimidines Category:Sulfonamides Category:Triazoles

{{cardiovascular-drug-stub}}