{{Short description|Substituted cathinone stimulant drug}} {{Drugbox | IUPAC_name = 2-(ethylamino)-1-(3-fluorophenyl)hexan-1-one | image = 3F-NEH.svg | image_class = skin-invert-image | width = 220

<!--Clinical data--> | pregnancy_category = | legal_status = | routes_of_administration =

<!--Pharmacokinetic data--> | bioavailability = | metabolism = | excretion =

<!--Identifiers--> | CAS_number = | PubChem = 163195773 | ChemSpiderID = | ChEMBL = | ChEBI = | UNII = J86LFK6UP6

<!--Chemical data--> | C=14 | H=20 | F=1 | N=1 | O=1 | smiles = O=C(c1cc(F)ccc1)C(CCCC)NCC | StdInChIKey = }}

'''3F-NEH''' ('''3-Fluoro-N-Ethylhexedrone''') is a recreational designer drug from the substituted cathinone family, with stimulant effects. It was first identified in Sweden in October 2020.<ref>{{cite book | url = https://www.emcdda.europa.eu/system/files/publications/13464/20205648_TD0320796ENN_PDF_rev.pdf | title = New psychoactive substances: global markets, glocal threats and the COVID-19 pandemic. An update from the EU Early Warning System | author = European Monitoring Center for Drugs and Drug Addiction | location = Luxembourg | publisher = Publications Office of the European Union | date = December 2020 | doi = 10.2810/921262 | isbn = 9789294975584 }}</ref>

==See also== * 3-Fluoromethamphetamine * 3-Fluoromethcathinone * 3F-NEB * 3F-PiHP * 3F-PVP * 3F-Phenmetrazine * N-Ethylhexedrone * N-Ethylhexylone

== References == {{Reflist}}

{{Stimulants}}

Category:Cathinones Category:Designer drugs Category:Serotonin-norepinephrine-dopamine releasing agents Category:3-Fluorophenyl compounds

{{nervous-system-drug-stub}}