{{Short description|Substituted cathinone stimulant drug}} {{cs1 config|name-list-style=vanc|display-authors=6}} {{Drugbox | IUPAC_name = 2-(ethylamino)-1-(3-fluorophenyl)butan-1-one | image = 3F-NEB_structure.png | image_class = skin-invert-image | width = 200px
<!--Clinical data--> | tradename = | routes_of_administration = | legal_UK = Class B | legal_DE = Anlage II
<!--Identifiers--> | CAS_number =
| UNII_Ref = {{fdacite|changed|FDA}} | UNII =
| PubChem = 164946359 | ChemSpiderID =
<!--Chemical data--> | C=12 | H=16 | F=1 | N=1 | O=1 | StdInChI=1S/C12H16FNO/c1-3-11(14-4-2)12(15)9-6-5-7-10(13)8-9/h5-8,11,14H,3-4H2,1-2H3 | StdInChIKey = FLFAFGGBRUXYBD-UHFFFAOYSA-N | SMILES = CCC(C(=O)C1=CC(=CC=C1)F)NCC }}
'''3-Fluoro-N-ethylbuphedrone''' ('''3F-NEB''') is a substituted cathinone derivative with stimulant effects which has been sold as a designer drug.<ref>{{cite journal | vauthors = Pain S, Nadal-Gratacós N, De Macedo M, Lardeux V, Mata S, Puigseslloses P, Wang FH, Källsten L, Pubill D, Berzosa X, Kehr J, Camarasa J, Escubedo E, López-Arnau R, Thiriet N, Solinas M | date = February 2026 | title = Neurochemical and behavioral evidence of high abuse liability of 3F-NEB, a novel synthetic cathinone | journal = European Journal of Pharmacology | volume = 1015 | article-number = 178570 | doi = 10.1016/j.ejphar.2026.178570 | pmid = 41554370 | hdl = 20.500.14342/5980 | hdl-access = free }}</ref> It was first identified in Sweden in 2021.<ref>{{cite book | date = June 2022 | title = New psychoactive substances: 25 years of early warning and response in Europe. An update from the EU Early Warning System | publisher = European Monitoring Centre for Drugs and Drug Addiction | isbn = 978-92-9497-737-3 | doi = 10.2810/396103 | author1 = European Monitoring Centre for Drugs and Drug Addiction. }}</ref><ref name="pmid36124107">{{cite journal | vauthors = Kuropka P, Zawadzki M, Szpot P | title = A review of synthetic cathinones emerging in recent years (2019-2022) | journal = Forensic Toxicology | volume = 41| issue = 1| pages = 25–46 | date = September 2022 | pmid = 36124107 | pmc = 9476408 | doi = 10.1007/s11419-022-00639-5 }}</ref>
== See also == * 3-Fluoromethcathinone * 3F-NEH * 3F-PVP * 3F-PiHP
== References == {{reflist}}
{{Stimulants}} {{Phenethylamines}}
Category:Cathinones Category:Designer drugs Category:3-Fluorophenyl compounds Category:Norepinephrine-dopamine releasing agents Category:Phenylisobutylamines