{{Short description|Substituted cathinone stimulant drug}} {{Drugbox | IUPAC_name = 1-(3-fluorophenyl)-4-methyl-2-(pyrrolidin-1-yl)pentan-1-one | image = 3F-α-PiHP.svg | image_class = skin-invert-image | width = 220
<!--Clinical data--> | pregnancy_category = | legal_CA =Schedule I | legal_DE = NpSG | legal_UK = Class B | legal_US = Unscheduled | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | metabolism = | excretion =
<!--Identifiers--> | CAS_number = | PubChem = 163192825 | ChemSpiderID = | ChEMBL = | ChEBI = | UNII = XZF8YZF3PN
<!--Chemical data--> | C=16 | H=22 | F=1 | N=1 | O=1 | smiles = O=C(C(CC(C)C)N1CCCC1)C2=CC(F)=CC=C2 | StdInChI = | StdInChIKey = }}
'''3F-PiHP''' ('''3F-α-PiHP''') is a recreational designer drug from the substituted cathinone family, with stimulant effects. It was first identified in both Sweden and Finland in mid-2019,<ref>{{cite report | url = https://www.emcdda.europa.eu/system/files/publications/13464/20205648_TD0320796ENN_PDF_rev.pdf | title = New psychoactive substances: global markets, glocal threats and the COVID-19 pandemic. An update from the EU Early Warning System | author = European Monitoring Center for Drugs and Drug Addiction | location = Luxembourg | publisher = Publications Office of the European Union | date = December 2020 | doi = 10.2810/921262 }}</ref> and was made illegal in Finland in August 2019.<ref>{{cite web | url = https://finlex.fi/fi/lainsaadanto/2014/1130 | title = Valtioneuvoston asetus kuluttajamarkkinoilta kielletyistä psykoaktiivisista aineista | trans-title = Government Decree on Psychoactive Substances Banned from the Consumer Market | language = Finnish | work = Finlex Data Bank }}</ref>
==See also== * 3-Fluoromethcathinone * 3F-NEH * 3F-PVP * 3F-PHP * 4F-PHP * α-PHiP * α-PCyP * Isohexylone
== References == {{Reflist}}
{{Stimulants}}
Category:Pyrrolidinophenones Category:Designer drugs Category:Serotonin-norepinephrine-dopamine releasing agents Category:3-Fluorophenyl compounds
{{psychoactive-stub}}