{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 413150531 | ImageFile = Tephrosin.png | ImageSize = 200px | IUPACName = 7a-Hydroxy-9,10-dimethoxy-3,3-dimethyl-13,13a-dihydro-3''H'',7a''H''-pyrano[2,3-''c'';6,5-''f''']dichromen-7-one | OtherNames = 12aβ-hydroxydeguelin<ref>{{cite journal| last=Cabizza | first=Maddalena |author2=Alberto Angioni |author3=Marinella Melis |author4=Marco Cabras |author5=Carlo V. Tuberoso |author6=Paolo Cabras | year=2004 | title=Rotenone and rotenoids in cubè resins, formulations, and residues on olives | journal=Journal of Agricultural and Food Chemistry | volume=52 | issue=2 | pages=288–293 | doi=10.1021/jf034987a| pmid=14733510| bibcode=2004JAFC...52..288C }}</ref> |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo = 76-80-2 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 9C081V83CC | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 9442 | PubChem = 114909 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 241806 | SMILES = CC1(C=CC2=C(O1)C=CC3=C2O[C@@H]4COC5=CC(=C(C=C5[C@@]4(C3=O)O)OC)OC)C | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 102858 | InChI = 1/C23H22O7/c1-22(2)8-7-12-15(30-22)6-5-13-20(12)29-19-11-28-16-10-18(27-4)17(26-3)9-14(16)23(19,25)21(13)24/h5-10,19,25H,11H2,1-4H3/t19-,23-/m1/s1 | InChIKey = AQBZCCQCDWNNJQ-AUSIDOKSBD | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C23H22O7/c1-22(2)8-7-12-15(30-22)6-5-13-20(12)29-19-11-28-16-10-18(27-4)17(26-3)9-14(16)23(19,25)21(13)24/h5-10,19,25H,11H2,1-4H3/t19-,23-/m1/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = AQBZCCQCDWNNJQ-AUSIDOKSSA-N | RTECS = | MeSHName = | KEGG_Ref = {{keggcite|changed|kegg}} | KEGG = C10535 }} |Section2={{Chembox Properties | Formula = C<sub>23</sub>H<sub>22</sub>O<sub>7</sub> | MolarMass = 410.41658 g/mol | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} |Section8={{Chembox Related | OtherAnions = | OtherCations = | OtherFunction = | OtherFunction_label = | OtherCompounds = Deguelin, toxicarol}} }}
'''Tephrosin''' is rotenoid. It is a natural fish poison found in the leaves and seeds of ''Tephrosia purpurea''<ref>{{cite journal| last=Ahmad | first=V. U. |author2=Z. Ali |author3=S. R. Hussaini |author4=F. Iqbal |author5=M. Zahid |author6=M. Abbas |author7=N. Saba | date=1999-08-01 | title=Flavonoids of ''Tephrosia purpurea'' | journal=Fitoterapia | volume=70 | issue=4 | pages=443–445 | doi=10.1016/S0367-326X(99)00046-5}}</ref> and ''T. vogelii''.<ref>Production of rotenoids by heterotrophic and photomixotrophic cell cultures of tephrosia vogelii. Nadine Lambert, Marie-France Trouslot, Claudine Nef-Campa and Hervé Chrestin, Phytochemistry, Volume 34, Issue 6, December 1993, Pages 1515-1520, {{doi|10.1016/S0031-9422(00)90838-0}}</ref>
==See also== *Cubé resin
==References== <references/>
{{Rotenoid}}
Category:Pesticides Category:Phenol ethers Category:Acyloins Category:Tertiary alcohols Category:Rotenoids Category:Cyclic ethers Category:Heterocyclic compounds with 5 rings Category:Pyranochromenes Category:Methoxy compounds
{{heterocyclic-stub}}