{{Short description|Stimulant drug of the substituted cathinone class}} {{Redirect|NRG-3|the protein growth factor|Neuregulin 3}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 451552327 | image = Pentylone structure.svg | image_class = skin-invert-image | width = 225px

<!--Clinical data--> | tradename = | pregnancy_category = | routes_of_administration = | class = | ATC_prefix = None | ATC_suffix =

<!--Legal status--> | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> | legal_BR = F2 | legal_BR_comment = <ref>{{Cite web |author=Anvisa |author-link=Brazilian Health Regulatory Agency |date=2023-07-24 |title=RDC Nº 804 - Listas de Substâncias Entorpecentes, Psicotrópicas, Precursoras e Outras sob Controle Especial |trans-title=Collegiate Board Resolution No. 804 - Lists of Narcotic, Psychotropic, Precursor, and Other Substances under Special Control|url=https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |url-status=live |archive-url=https://web.archive.org/web/20230827163149/https://www.in.gov.br/en/web/dou/-/resolucao-rdc-n-804-de-24-de-julho-de-2023-498447451 |archive-date=2023-08-27 |access-date=2023-08-27 |publisher=Diário Oficial da União |language=pt-BR |publication-date=2023-07-25}}</ref> | legal_DE = Anlage I | legal_UK = Class B | legal_US = Schedule I | legal_status = Illegal in Sweden and Finland

<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 698963-77-8 | CAS_supplemental = <BR>17763-01-8 (hydrochloride) | UNII_Ref = {{fdacite|correct|FDA}} | UNII = IGN39WGH0Q | PubChem = 60208608 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 29786041 | synonyms = β-Keto-Methylbenzodioxolylpentanamine, βk-Methyl-K, βk-MBDP, methylenedioxypentedrone, 1‐(3,4‐methylenedioxyphenyl)‐2‐(methylamino)pentan‐1‐one<ref name="pmid21960541" />

<!--Chemical data--> | IUPAC_name = (±)-1-(1,3-benzodioxol-5-yl)-2-(methylamino)pentan-1-one | C = 13 | H = 17 | N = 1 | O = 3 | SMILES = c2cc1OCOc1cc2C(=O)C(NC)CCC | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C13H17NO3/c1-3-4-10(14-2)13(15)9-5-6-11-12(7-9)17-8-16-11/h5-7,10,14H,3-4,8H2,1-2H3 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = DFMLULIEUUXXSA-UHFFFAOYSA-N }}

'''Pentylone''', also known as '''β-keto''N''-methyl-1,3-benzodioxolylpentanamine''' ('''bk-MBDP'''), is a stimulant developed in the 1960s.<ref>{{cite patent | title = Substituted phenyl-α-amino ketones. | country = GB | number = 1085135 | gdate = 1969 }}</ref> It is a substituted cathinone that has been identified in some samples of powders sold as "NRG-1", along with varying blends of other cathinone derivatives including flephedrone, MDPBP, MDPV, and 4-MePPP. It was also found in combination with 4-MePPP being sold as "NRG-3".<ref name="pmid21960541">{{cite journal | vauthors = Brandt SD, Freeman S, Sumnall HR, Measham F, Cole J | title = Analysis of NRG 'legal highs' in the UK: identification and formation of novel cathinones | journal = Drug Testing and Analysis | volume = 3 | issue = 9 | pages = 569–575 | date = September 2011 | pmid = 21960541 | doi = 10.1002/dta.204 }}</ref> Reports indicate side effects include paranoia, agitation, and insomnia, with effects lasting for several days at high doses.<ref>{{cite journal | vauthors = Bish J |title= Watch Out for Pentylone, the Horrible New MDMA Additive |journal=Vice |date=4 August 2017 |url= https://www.vice.com/en/article/watch-out-for-pentylone-the-horrible-new-mdma-additive/}}</ref>

==Pharmacology== Pentylone acts as a serotonin–norepinephrine–dopamine reuptake inhibitor (SNDRI) and a serotonin releasing agent.<ref>{{cite journal | vauthors = Simmler LD, Rickli A, Hoener MC, Liechti ME | title = Monoamine transporter and receptor interaction profiles of a new series of designer cathinones | journal = Neuropharmacology | volume = 79 | pages = 152–160 | date = April 2014 | pmid = 24275046 | doi = 10.1016/j.neuropharm.2013.11.008 | s2cid = 25259854 }}</ref>

==Legal status== Pentylone is banned in Canada, Germany, Sweden, the United States, and the United Kingdom.<ref>{{cite web | url=http://www.folkhalsomyndigheten.se/nyheter-och-press/nyhetsarkiv/2014/november/cannabinoider-foreslas-bli-klassade-som-halsofarlig-vara/ | title=Cannabinoider föreslås bli klassade som hälsofarlig vara | trans-title = Cannabinoids are proposed to be classified as a health hazard | archive-url = https://web.archive.org/web/20150325081230/http://www.folkhalsomyndigheten.se/nyheter-och-press/nyhetsarkiv/2014/november/cannabinoider-foreslas-bli-klassade-som-halsofarlig-vara/ | archive-date = 25 March 2015 | language=sv | access-date=29 June 2015 | work = Folkhalsomyndigheten | trans-work = Public Health Agency of Sweden }}</ref><ref>{{cite web | url = https://www.federalregister.gov/articles/2014/03/07/2014-04997/schedules-of-controlled-substances-temporary-placement-of-10-synthetic-cathinones-into-schedule-i | title = Schedules of Controlled Substances: Temporary Placement of 10 Synthetic Cathinones Into Schedule I | publisher = U.S. Federal Register | work = Drug Enforcement Administration | date = 7 March 2014 }}</ref>

== See also == * Substituted methylenedioxyphenethylamine * α-PVP * Dipentylone * Methylenedioxypyrovalerone (MDPV) * Methyl-K * N-Ethylpentylone * Pentedrone * Methylenedioxyphenylpropylaminopentane (MPAP)

== References == {{Reflist}}

{{Stimulants}} {{Monoamine releasing agents}} {{Phenethylamines}}

Category:Alpha-Propylphenethylamines Category:Designer drugs Category:Methylenedioxycathinones Category:Partial monoamine releasing agents Category:Serotonin–norepinephrine–dopamine reuptake inhibitors Category:Serotonin releasing agents Category:Stimulants