{{cs1 config|name-list-style=vanc|display-authors=6}} {{DISPLAYTITLE:1,3-Benzodioxolyl-''N''-methylpentanamine}} {{Infobox drug | drug_name = MBDP | image = MBDP structure.svg | image_class = skin-invert-image | width = 225px | caption =
<!-- Clinical data --> | pronounce = | tradename = | Drugs.com = | MedlinePlus = | licence_CA = | licence_EU = | DailyMedID = | licence_US = | pregnancy_AU = | pregnancy_category = | dependency_liability = | addiction_liability = | routes_of_administration = Oral<ref name="PiHKAL" /> | class = | ATC_prefix = None | ATC_suffix =
<!-- Legal status --> | legal_status =
<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = Unknown<ref name="PiHKAL" /> | excretion =
<!-- Identifiers --> | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 952016-78-3 | CAS_supplemental = | PubChem = 17757316 | PubChemSubstance = | IUPHAR_ligand = | DrugBank = | ChemSpiderID = 21106348 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 4D904VI4GR | KEGG = | ChEBI = | ChEMBL = | NIAID_ChemDB = | PDB_ligand = | synonyms = 1,3-Benzodioxolyl-''N''-methylpentanamine; ''N''-Methyl-1,3-benzodioxolylpentanamine; MBDP; 3,4-Methylenedioxy-α-propyl-''N''-methylphenethylamine; Methyl-K; UWA-091; UWA091
<!-- Chemical data --> | IUPAC_name = 1-(2''H''-1,3-benzodioxol-5-yl)-''N''-methylpentan-2-amine | C=13 | H=19 | N=1 | O=2 | SMILES = C1=C2C(=CC=C1CC(NC)CCC)OCO2 | StdInChI = 1S/C13H19NO2/c1-3-4-11(14-2)7-10-5-6-12-13(8-10)16-9-15-12/h5-6,8,11,14H,3-4,7,9H2,1-2H3 | StdInChIKey = PZVRSDBLMSXDCX-UHFFFAOYSA-N }}
'''MBDP''', also known as '''''N''-methyl-1,3-benzodioxolylpentanamine''', '''3,4-methylenedioxy-α-propyl-''N''-methylphenethylamine''', '''methyl-K''', or '''UWA-091''', is a psychoactive drug of the phenethylamine, phenylisobutylamine, and MDxx families.<ref name="PiHKAL">{{cite web | url = http://www.erowid.org/library/books_online/pihkal/pihkal129.shtml | title = Methyl-K | work = PiHKAL }}</ref><ref name="Shulgin_2011">{{cite book | vauthors = Shulgin A, Manning T, Daley P | title = The Shulgin Index, Volume One: Psychedelic Phenethylamines and Related Compounds | location = Berkeley | volume = 1 | year = 2011 | publisher = Transform Press | isbn = 978-0-9630096-3-0 }}</ref><ref name="Shulgin_2003">{{cite book | vauthors = Shulgin AT | veditors = Laing RR | chapter = Basic Pharmacology and Effects | title = Hallucinogens: A Forensic Drug Handbook | pages = 67–137 | year = 2003 | publisher = Elsevier Science | series = Forensic Drug Handbook Series | isbn = 978-0-12-433951-4 | url = https://books.google.com/books?id=l1DrqgobbcwC | chapter-url = https://bibliography.maps.org/resources/download/12634 | archive-url = https://web.archive.org/web/20250713013624/https://bibliography.maps.org/resources/download/12634 | archive-date = 13 July 2025 }}</ref> It is the ''N''-methyl analogue of BDP (K).<ref name="PiHKAL" />
==Use and effects== In his book ''PiHKAL'' (''Phenethylamines I Have Known and Loved''), Alexander Shulgin lists MBDP's minimum dose as 100{{nbsp}}mg orally and its duration as unknown.<ref name="PiHKAL" /> The drug produced no effects at tested doses.<ref name="PiHKAL" />
==Chemistry== ===Synthesis=== The chemical synthesis of MBDP has been described.<ref name="PiHKAL" />
==Society and culture== ===Legal status=== ====United Kingdom==== This substance is a Class A drug in the Drugs controlled by the UK Misuse of Drugs Act.<ref>{{cite web | title = UK Misuse of Drugs act 2001 Amendment summary | url = http://isomerdesign.com/Cdsa/scheduleUK.php?schedule=1&ion=30&structure=C | access-date = 12 March 2014 | publisher = Isomer Design | archive-date = 22 October 2017 | archive-url = https://web.archive.org/web/20171022085110/http://isomerdesign.com/Cdsa/scheduleUK.php?schedule=1&ion=30&structure=C | url-status = dead }}</ref>
== See also == * Substituted methylenedioxyphenethylamine * Pentylone (bk-MBDP) * Ethylbenzodioxolylpentanamine (EBDP; Ethyl-K) * Methylbenzodioxolylbutanamine (MBDB; Methyl-J) * Methylenedioxyphenylpropylaminopentane (MPAP) * UWA-101 (α-cyclopropyl-MDPEA)
== References == {{Reflist}}
==External links== * [https://isomerdesign.com/pihkal/explore/129 Methyl-K (MBDP) - Isomer Design] * [https://www.erowid.org/library/books_online/pihkal/pihkal129.shtml Methyl-K (MBDP) - Erowid] * [https://isomerdesign.com/pihkal/read/pk/129 Methyl-K (MBDP) - PiHKAL - Isomer Design]
{{Phenethylamines}}
{{DEFAULTSORT:Benzodioxolyl-N-methylpentanamine, 1,3-}}
Category:Alpha-Propylphenethylamines Category:Designer drugs Category:Methylenedioxyamphetamines Category:PiHKAL