{{Chembox <!-- Images -->| ImageFile = Lead picrate.svg | ImageSize = 180px | ImageAlt = <!-- Names --> | IUPACName = Lead(II) 2,4,6-trinitrophenolate | OtherNames = Lead dipicrate | Section1 = {{Chembox Identifiers | CASNo = 25721-38-4 | CASNo1 = 6477-64-1 ChemSpider ID: 2308056 | PubChem = 3045289 | PubChem1 = 162344796 | SMILES = C1=C(C=C(C(=C1[N+](=O)[O-])[O-])[N+](=O)[O-])[N+](=O)[O-].C1=C(C=C(C(=C1[N+](=O)[O-])[O-])[N+](=O)[O-])[N+](=O)[O-].[Pb+2] | InChI=1S/2C6H3N3O7.Pb/c2*10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;/h2*1-2,10H;/q;;+2/p-2 | InChIKey=MHVVRZIRWITSIP-UHFFFAOYSA-L | EINECS =229-335-2 }} | Section2 = {{Chembox Properties | C=12|H=4|N=6|O=14|Pb=1 | Appearance = Orange powder | Solubility = 7.06 g/L <ref name="Yang">{{Cite journal |last1=Yang |first1=Li |last2=Pei |first2=Qin |last3=Zhang |first3=Tonglai |last4=Zhang |first4=Jianguo |last5=Cao |first5=Yunling |date=2007 |title=Solubilities and enthalpies of solution of picric acid and picrates at 298.15K in DMF, EtOH and acetic acid |url=https://linkinghub.elsevier.com/retrieve/pii/S0040603107001621 |journal=Thermochimica Acta |language=en |volume=463 |issue=1–2 |pages=13–14 |doi=10.1016/j.tca.2007.04.013|bibcode=2007TcAc..463...13Y |url-access=subscription }}</ref> | SolubleOther = Soluble in ethanol, acetic acid<ref name="Yang" /><br /> Very soluble in DMF,<ref name="Yang" /> dichloromethane<ref name="Matsukakwa">{{Cite journal |last1=Matsukakwa |first1=Makoto |last2=Matsunaga |first2=Takehiro |last3=Yoshida |first3=Masatake |last4=Fujiwara |first4=Shuzo |date=2004 |title=Synthesis and properties of lead picrates |journal=Science and Technology of Energetic Materials |volume=65 |issue=1 |pages=7–13}}</ref> }} | Section3 = | Section5 = {{Chembox Explosive }} | Section7 = {{Chembox Hazards | GHSPictograms = {{GHS01}} {{GHS07}} {{GHS health hazard}} {{GHS environment}} | GHSSignalWord = Danger | HPhrases = {{H-phrases|201|302|332|360|373|410}} | PPhrases = {{P-phrases|260|261|264|270|271|273|280|304+340|330|391|405|501}} | AutoignitionPt = 270.75-327.15 °C (519.7-621.0 °F; 600.3-543.9 K)<ref name="Matsukakwa" /> }} }}
'''Lead picrate''' is an organic picrate salt.<ref name="Agrawal">{{cite book | title = High Energy Materials: Propellants, Explosives and Pyrotechnics | author = Jai Prakash Agrawal | publisher = John Wiley & Sons | date = 2015}}</ref> It is a sensitive and highly explosive compound that is typically found as a hydrate.<ref name="Matsukakwa" /> Dry lead picrate is extremely dangerous and cannot be handled without explosive decomposition occurring.
== History == Lead picrate was first discovered in the early 1900s. It was investigated by numerous militaries during the First World War as a potential primary explosive, most notably Germany for using it in blasting caps.<ref name="Matsukakwa" />
== Preparation == Numerous lead precursors can be used to create lead picrate. Two of the simplest examples of lead picrate synthesis are the addition of lead(II) oxide or lead carbonate with picric acid.<ref name="Matsukakwa" />
==References== {{reflist}}
Category:Picrates Category:Lead(II) compounds
{{explosive-stub}}