{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 441026333 | ImageFile1 = EntryWithCollCode6178.png | ImageSize1 = | ImageFile2 = Uhličitan olovnatý.PNG | ImageSize2 = | ImageName = Lead carbonate | IUPACName = Lead(II) carbonate | OtherNames = Cerussite |Section1={{Chembox Identifiers | CASNo = 598-63-0 | CASNo_Ref = {{cascite|correct|CAS}} | ChemSpiderID = 11234 | EC_number = 209-943-4 | PubChem = 11727 | RTECS = OF9275000 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 43M0P24L2B | StdInChI=1S/CH2O3.Pb/c2-1(3)4;/h(H2,2,3,4);/q;+2/p-2 | StdInChIKey = MFEVGQHCNVXMER-UHFFFAOYSA-L | SMILES = C(=O)([O-])[O-].[Pb+2] }} |Section2={{Chembox Properties | Formula = {{chem2|PbCO3}} | MolarMass = 267.21 g/mol | Appearance = White powder | Density = 6.582 g/cm<sup>3</sup> | MeltingPtC = 315 | MeltingPt_notes = (decomposes) | Solubility = 0.00011 g/(100 mL) (20 °C) | SolubilityProduct = 1.46·10<sup>−13</sup> | SolubleOther = insoluble in alcohol, ammonia; <br> soluble in acid, alkali | RefractIndex = 1.804<ref>Pradyot Patnaik. ''Handbook of Inorganic Chemicals''. McGraw-Hill, 2002, {{ISBN|0-07-049439-8}}</ref> | MagSus = −61.2·10<sup>−6</sup> cm<sup>3</sup>/mol }} |Section7={{Chembox Hazards | ExternalSDS = [http://ptcl.chem.ox.ac.uk/MSDS/LE/lead_carbonate.html External MSDS] | GHSPictograms = {{GHS07}}{{GHS08}}{{GHS09}} | GHSSignalWord = Danger | HPhrases = {{H-phrases|302|332|360|373|410}} | PPhrases = {{P-phrases|201|202|260|261|264|270|271|273|281|301+312|304+312|304+340|308+313|312|314|330|391|405|501}} | FlashPt = Non-flammable }} }} '''Lead(II) carbonate''' is the chemical compound with the chemical formula {{chem2|PbCO3}}. It is a white, toxic solid.<ref name=Ullmann/> It occurs naturally as the mineral cerussite.<ref>''Inorganic Chemistry'', Egon Wiberg, Arnold Frederick Holleman Elsevier 2001 {{ISBN|0-12-352651-5}}</ref>
==Structure== Like all metal carbonates, lead(II) carbonate adopts a dense, highly crosslinked structure consisting of intact {{chem2|CO3(2-)}} and metal cation sites. As verified by X-ray crystallography, the Pb(II) centers are seven-coordinate, being surrounded by multiple carbonate ligands. The carbonate centers are bonded bidentate to a single Pb and bridge to five other Pb sites.<ref>{{cite journal|doi=10.1524/zkri.1974.139.3-5.215|title=Verfeinerung der Kristallstruktur von Cerussit, PbCO3|journal=Zeitschrift für Kristallographie|volume=139|issue=3–5|pages=215–222|year=1974|last1=Sahl|first1=Kurt|bibcode=1974ZK....139..215S}}</ref> [[File:EntryWithCollCode6178Hepta.png|thumb|left|Pb site in {{chem2|PbCO3}}, highlighting seven-coordination and the presence of one bidentate carbonate ligand for each Pb center.]]
==Production and use== Lead carbonate is manufactured by passing carbon dioxide into a cold dilute solution of lead(II) acetate, or by shaking a suspension of a lead salt more soluble than the carbonate with ammonium carbonate at a low temperature to avoid formation of basic lead carbonate.<ref name=Ullmann>{{Ullmann|first=Dodd S.|last=Carr|year=2005|title=Lead Compounds|doi=10.1002/14356007.a15_249}}</ref>
:{{chem2 | Pb(CH3COO)2 + [NH4]2CO3 -> PbCO3 + 2 [NH4](CH3COO) }}
Lead carbonate is used as a catalyst to polymerize formaldehyde to poly(oxymethylene). It improves the bonding of chloroprene to wire.<ref name=Ullmann/>
==Regulations== The supply and use of this compound is restricted in Europe.<ref>{{Cite web | url=http://eur-lex.europa.eu/en/index.htm |title = EU law - EUR-Lex}}</ref>
==Other lead carbonates== A number of lead carbonates are known: * White lead, a basic lead carbonate, {{chem2|2PbCO3*Pb(OH)2}} * Shannonite, {{chem2|PbCO3*PbO}} * Plumbonacrite, {{chem2|3PbCO3*Pb(OH)2*PbO}}<ref>{{cite journal |author1=S.V. Krivovichev|author2=P.C. Burns|url=http://www.nd.edu/~pburns/pcb075.pdf |title=Crystal chemistry of basic lead carbonates. II. Crystal structure of synthetic 'plumbonacrite'|journal=Mineralogical Magazine|issue=64(6)|pages=1069-1075|date=December 2000|accessdate=2009-05-21 |archiveurl=https://web.archive.org/web/20090521065308/http://www.nd.edu/~pburns/pcb075.pdf |archivedate=2009-05-21 |url-status=dead}}</ref> * {{chem2|PbCO3*2PbO}} * Abellaite, {{chem2|NaPb2(OH)(CO3)2}} * Leadhillite, {{chem2|2PbCO3*PbSO4*Pb(OH)2}}
==References== {{reflist}}
==External links== *[http://www.inchem.org/documents/icsc/icsc/eics0999.htm International Chemical Safety Card 0999] {{Carbonates}} {{Lead compounds}}
{{DEFAULTSORT:Lead Carbonate}} Category:Lead(II) compounds Category:Carbonates