{{Chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 450955931 | ImageFileL1 = L-sorbose_Fischer.png | ImageSizeL1 = 75px | ImageFileR1 = sorbose.png | ImageSizeR1 = 150px | IUPACName = <small>L</small>-''xylo''-Hex-2-ulose | OtherNames = Sorbinose<br><small>L</small>-''xylo''-Hexulose | SystematicName = (''3S,4R,5S'')-1,3,4,5,6-Pentahydroxyhexan-2-one | Section1 = {{Chembox Identifiers |CASNo_Ref = {{cascite|correct|CAS}} |CASNo=87-79-6 |UNII_Ref = {{fdacite|correct|FDA}} |UNII = NV2001607Y |PubChem=6904 |ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} |ChemSpiderID = 6638 |InChI = 1/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5+,6+/m0/s1 |InChIKey = BJHIKXHVCXFQLS-OTWZMJIIBK |StdInChI_Ref = {{stdinchicite|changed|chemspider}} |StdInChI = 1S/C6H12O6/c7-1-3(9)5(11)6(12)4(10)2-8/h3,5-9,11-12H,1-2H2/t3-,5+,6+/m0/s1 |StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} |StdInChIKey = BJHIKXHVCXFQLS-OTWZMJIISA-N |SMILES=C([C@@H]([C@H]([C@@H](C(=O)CO)O)O)O)O }} | Section2 = {{Chembox Properties |Properties_ref = <ref name=Merck>''Merck Index'', 12th Edition, '''8874'''</ref> |C=6 | H=12 | O=6 |Appearance=white solid |Density=1.65 g/cm<sup>3</sup> (15 °C) |MeltingPtC=165 |Solubility=Highly Soluble }} }}
'''Sorbose''' is a ketose belonging to the group of sugars known as monosaccharides. It has a sweetness that is equivalent to sucrose (table sugar).<ref name=Merck/> The commercial production of vitamin C (ascorbic acid) often begins with sorbose. <small>L</small>-Sorbose is the configuration of the naturally occurring sugar. It can be prepared from inexpensive O-benzylglucose.
==Synthesis== Under conditions employed for a Meerwein-Ponndorf-Verley reduction, the tetra-O-benzyl aldose converts to tetra-''O''-benzylsorbose. Hydrogenolysis removes the four benzyl groups, leaving sorbose.<ref>{{cite journal |doi=10.1021/acs.chemrev.5b00104 |title=Synthesis of l-Hexoses |year=2015 |last1=Frihed |first1=Tobias Gylling |last2=Bols |first2=Mikael |last3=Pedersen |first3=Christian Marcus |journal=Chemical Reviews |volume=115 |issue=9 |pages=3615–3676 |pmid=25893557 }}</ref>
==References== {{reflist}}
{{Carbohydrates}}
{{ketone-stub}} Category:Ketohexoses