{{Short description|Group of isomers}} {{Chembox | Verifiedfields = changed | verifiedrevid = 443878506 | Name = Ionones | ImageFileL1 = alpha-ionone-label.png | ImageNameL1 = | ImageSizeL1 =
| ImageFileR1 = Alpha-Ionone 3D ball.png | ImageSizeR1 = | ImageAltR1 = Ball-and-stick model of the alpha-ionone molecule | ImageCaptionLR1 = alpha-ionone
| ImageFileL2 = beta-ionone-label.png | ImageCaptionLR2 = beta-ionone | ImageSizeL2 =
| ImageFileR2 = Beta-Ionone 3D ball.png | ImageSizeR2 = | ImageAltR2 = | ImageNameR2 = Ball-and-stick model of the beta-ionone molecule
| ImageFileL3 = gamma-ionone-label.png | ImageNameL3 = | ImageSizeL3 =
| ImageFileR3 = Gamma-Ionone 3D ball.png | ImageSizeR3 = | ImageCaptionLR3 = gamma-ionone | ImageAltR3 = Ball-and-stick model of the gamma-ionone molecule | IUPACName = α: (3''E'')-4-(2,6,6-Trimethylcyclohex-2-en-1-yl)but-3-en-2-one<br />β: (3''E'')-4-(2,6,6-Trimethylcyclohex-1-en-1-yl)but-3-en-2-one<br />γ: (3''E'')-4-(2,2-Dimethyl-6-methylenecyclohexyl)but-3-en-2-one | OtherNames = Cyclocitrylideneacetone, irisone, jonon | Section1 = {{Chembox Identifiers | CASNo_Ref = {{cascite|changed|??}} | CASNo = 127-41-3 | CASNo_Comment = α | CASNo2_Ref = {{cascite|changed|??}} | CASNo2 = 79-77-6 | CASNo2_Comment = β | CASNo3_Ref = {{cascite|changed|??}} | CASNo3 = 79-76-5 | CASNo3_Comment = γ | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C13H20O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h7-8,12H,1,5-6,9H2,2-4H3/b8-7+ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = SFEOKXHPFMOVRM-BQYQJAHWSA-N | InChIKey = SFEOKXHPFMOVRM-BQYQJAHWBW | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 4516050 | PubChem = 5363741 | InChI = 1/C13H20O/c1-10-6-5-9-13(3,4)12(10)8-7-11(2)14/h7-8,12H,1,5-6,9H2,2-4H3/b8-7+ | UNII_Ref = {{fdacite|correct|FDA}} | UNII = QP734LIN1K | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = 49250 | SMILES = O=C(\C=C\C1\C(=C)CCCC1(C)C)C }} | Section2 = {{Chembox Properties | Formula = C<sub>13</sub>H<sub>20</sub>O | MolarMass = 192.30 g/mol | Density = α: 0.933 g/cm<sup>3</sup><br />β: 0.945 g/cm<sup>3</sup> | MeltingPt = β: | MeltingPtC = −49 | BoilingPt = β: | BoilingPtC = 126 to 128 | BoilingPt_notes = at 12 mmHg }} }} The '''ionones''', from greek ἴον ion "violet",<ref>{{Cite book |last=Genaust |first=Helmut |date=1976 |title=Etymologisches Wörterbuch der botanischen Pflanzennamen |url=http://dx.doi.org/10.1007/978-3-0348-7650-6 |doi=10.1007/978-3-0348-7650-6|isbn=978-3-0348-7651-3 }}</ref> are a series of closely related chemical substances that are part of a group of compounds known as rose ketones, which also includes damascones and damascenones. Ionones are aroma compounds found in a variety of essential oils, including rose oil. β-Ionone is a significant contributor to the aroma of roses, despite its relatively low concentration, and is an important fragrance chemical used in perfumery.<ref name="Leff2005"> {{cite web |url=http://www.leffingwell.com/rose.htm|title=Rose (Rosa damascena)|last=Leffingwell|first=JC|date=3 February 2005|website=Aroma from Carotenoids - Rose|publisher=Leffingwell & Associates|access-date=14 January 2014}}</ref> The ionones are derived from the degradation of carotenoids.
The combination of α-ionone and β-ionone is characteristic of the scent of violets and used with other components in perfumery and flavouring to recreate their scent.<ref>{{cite book |last1=Curtis |first1=T |last2=Williams |first2=DG |title=Introduction to Perfumery|edition=2nd|location=Fort Washington, New York|publisher=Micelle Press|year=2001|isbn=9781870228244}}</ref><ref name="Jens2010">{{cite web |url=http://www.bojensen.net/EssentialOilsEng/EssentialOils31/EssentialOils31.htm#Violet |title=Violet |last=Jensen |first=B |date=6 February 2010 |website=Essential Oils |access-date=14 January 2014}}</ref>
The carotenes α-carotene, β-carotene, γ-carotene, and the xanthophyll β-cryptoxanthin, can all be metabolized to β-ionone, and thus have vitamin A activity because they can be converted by plant-eating animals to retinol and retinal. Carotenoids that do not contain the β-ionone moiety cannot be converted to retinol, and thus have no vitamin A activity.
Ionones are classified as apocarotenoids (specifically C₁₃-norisoprenoids), formed by oxidative cleavage of larger carotenoid molecules, which places them within the broader family of terpenoid-derived natural products. This structural origin explains both their occurrence in plants and their characteristic fragrance properties.<ref>{{Cite web |title=Иононы: химическая природа, получение и применение |url=https://iononeinfo.ru/ |access-date=2026-04-16 |website=iononeinfo.ru |language=ru}}</ref>
==Biosynthesis== Carotenoids are the precursors of important fragrance compounds in several flowers. For example, a 2010 study of ionones in ''Osmanthus fragrans'' Lour. var. ''aurantiacus'' determined its essential oil contained the highest diversity of carotenoid-derived volatiles among the flowering plants investigated. A cDNA encoding a carotenoid cleavage enzyme, OfCCD1, was identified from transcripts isolated from flowers of ''O. fragrans'' Lour. The recombinant enzymes cleaved carotenes to produce α-ionone and β-ionone in ''in vitro'' assays.<ref name="Bald2010">{{cite journal |last1=Baldermann |first=S |last2=Kato |first2=M |last3=Kurosawa |first3=M| last4=Kurobayashi |first4=Y |last5=Fujita |first5=A |last6=Fleischmann |first6=P |last7=Watanabe |first7=N| title=Functional characterization of a carotenoid cleavage dioxygenase 1 and its relation to the carotenoid accumulation and volatile emission during the floral development of ''Osmanthus fragrans'' Lour |journal=Journal of Experimental Botany |volume=61 |issue=11 |pages= 2967–2977 |year=2010 |doi=10.1093/jxb/erq123 |pmid=20478967 |doi-access=free |hdl=10297/6189 |hdl-access=free }}</ref>
The same study also discovered that carotenoid content, volatile emissions, and OfCCD1 transcript levels are subject to photorhythmic changes, and principally increased during daylight hours. At the times when OfCCD1 transcript levels reached their maxima, the carotenoid content remained low or slightly decreased. The emission of ionones was also higher during the day; however, emissions decreased at a lower rate than the transcript levels. Moreover, carotenoid content increased from the first to the second day, whereas the volatile release decreased, and the OfCCD1 transcript levels displayed steady-state oscillations, suggesting that the substrate availability in the cellular compartments is changing or other regulatory factors are involved in volatile norisoprenoid formation. The formation of ionones proceeds by a process mediated by the carotenoid dioxygenases.<ref name="Bald2010" />
thumb|center|500px|Biosynthesis of the ionones
==Organic synthesis==
Ionone can be synthesised from citral and acetone with calcium oxide as a basic heterogeneous catalyst and serves as an example of an aldol condensation followed by a rearrangement reaction.<ref>{{cite journal | last1=Noda | first1=C | last2=Alt | first2=GP | last3=Werneck | first3=RM | last4=Henriques | first4=C. A. |last5=Monteiro |first5=JLF |title=Aldol condensation of citral with acetone on basic solid catalysts |journal=Brazilian Journal Chemical Engineering |year=1998 |volume=15 |issue=2 | pages=120–125 |doi=10.1590/S0104-66321998000200004| doi-access=free }}</ref><ref>{{cite journal| title= Pseudoionone |last1=Russell | first1=A |last2=Kenyon |first2=RL |journal=Organic Syntheses |volume=23 |pages=78 |url=http://www.orgsyn.org/demo.aspx?prep=cv3p0747|doi=10.15227/orgsyn.023.0078 |year=1943 |url-access=subscription }}</ref>
The nucleophilic addition of the carbanion '''3''' of acetone '''1''' to the carbonyl group on citral '''4''' is base catalysed. The aldol condensation product '''5''' eliminates water through the enolate ion '''6''' to form pseudoionone '''7'''.
:Image:ionone3.svg
The reaction proceeds by acid catalysis where the double bond in '''7''' opens to form the carbocation '''8'''. A rearrangement reaction of the carbocation follows with ring closure to '''9'''. Finally a hydrogen atom can be abstracted from '''9''' by an acceptor molecule ('''Y''') to form either '''10''' (extended conjugated system) or '''11'''.
:Image:ionone4.svg
==Genetic differences in odor perception== A single-nucleotide polymorphism in the OR5A1 receptor (rs6591536<ref>{{cite web|url=https://www.snpedia.com/index.php/Rs6591536|title=rs6591536|website=SNPedia}}</ref>) causes very significant differences in the odor perception of beta-ionone, both in sensitivity and also in subjective quality. Individuals who contain at least one G allele are sensitive to beta-ionone and perceive a pleasant floral scent, while individuals who are homozygous AA are ~100 times less sensitive and at higher concentrations perceive a pungent sour/vinegar odor instead.<ref name="McRae2013">{{cite journal |vauthors=Jaeger SR, McRae JF, Bava CM, Beresford MK, Hunter D, Jia Y, Chheang SL, Jin D, Peng M, Gamble JC, Atkinson KR, Axten LG, Paisley AG, Tooman L, Pineau B, Rouse SA, Newcomb RD | title = A Mendelian Trait for Olfactory Sensitivity Affects Odor Experience and Food Selection | journal = Current Biology | volume = 23 | issue = 16 | pages = 1601–1605 | year = 2013 | pmid = 23910657 | doi = 10.1016/j.cub.2013.07.030 | doi-access = free }}</ref>
==See also== * Irones, a group of related chemical compounds * α-Isomethyl ionone, a type of ionone
==References== {{reflist}}
Category:Perfume ingredients Category:Flavors Category:Enones Category:Sesquiterpenes Category:Apocarotenoids Category:Cyclohexenes