{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 423602723 | Name = Herbacetin | ImageFile = Herbacetin.svg | ImageAlt = Chemical structure of herbacetin | ImageFile1 = Herbacetin-3D-balls.png | ImageAlt1 = Ball-and-stick model of the herbacetin molecule | IUPACName = 3,4′,5,7,8-Pentahydroxyflavone | SystematicName = 3,5,7,8-Tetrahydroxy-2-(4-hydroxyphenyl)-4''H''-1-benzopyran-4-one | OtherNames = 8-Hydroxykaempferol<!-- <br> --> |Section1={{Chembox Identifiers | CASNo = 527-95-7 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 736854V2KE | CASNoOther = | PubChem = 5280544 | ChEBI = 27673 | SMILES = C1=CC(=CC=C1C2=C(C(=O)C3=C(O2)C(=C(C=C3O)O)O)O)O | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 4444174 | InChI = 1/C15H10O7/c16-7-3-1-6(2-4-7)14-13(21)12(20)10-8(17)5-9(18)11(19)15(10)22-14/h1-5,16-19,21H | InChIKey = ZDOTZEDNGNPOEW-UHFFFAOYAP | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C15H10O7/c16-7-3-1-6(2-4-7)14-13(21)12(20)10-8(17)5-9(18)11(19)15(10)22-14/h1-5,16-19,21H | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = ZDOTZEDNGNPOEW-UHFFFAOYSA-N | MeSHName = }} |Section2={{Chembox Properties | C=15 | H=10 | O=7 | Appearance = | Density = 1.799 g/mL | MeltingPt = | BoilingPt = | Solubility = }} }} '''Herbacetin''' is a flavonol, a type of flavonoid.
== Glycosides == Herbacetin diglucoside can be isolated from flaxseed hulls.<ref>{{Cite journal | last1 = Struijs | first1 = K. | last2 = Vincken | first2 = J. P. | last3 = Verhoef | first3 = R. | last4 = Van Oostveen-Van Casteren | first4 = W. H. M. | last5 = Voragen | first5 = A. G. J. | last6 = Gruppen | first6 = H. | doi = 10.1016/j.phytochem.2006.10.022 | title = The flavonoid herbacetin diglucoside as a constituent of the lignan macromolecule from flaxseed hulls | journal = Phytochemistry | volume = 68 | issue = 8 | pages = 1227–1235 | year = 2007 | pmid = 17141814}}</ref>
Rhodionin is a herbacetin rhamnoside found in ''Rhodiola'' species.<ref>{{Cite journal | last1 = Li | first1 = T. | last2 = Zhang | first2 = H. | doi = 10.1248/cpb.56.807 | title = Identification and Comparative Determination of Rhodionin in Traditional Tibetan Medicinal Plants of Fourteen Rhodiola Species by High-Performance Liquid Chromatography-Photodiode Array Detection and Electrospray Ionization-Mass Spectrometry | journal = Chemical & Pharmaceutical Bulletin | volume = 56 | issue = 6 | pages = 807–14 | year = 2008 | pmid = 18520085| doi-access = free }}</ref>
== Other related compounds == Rhodiolin, a flavonolignan, is the product of the oxidative coupling of coniferyl alcohol with the 7,8-dihydroxy grouping of herbacetin. It can be found in the rhizome of ''Rhodiola rosea''.<ref>{{Cite journal | last1 = Zapesochnaya | first1 = G. G. | last2 = Kurkin | first2 = V. A. | doi = 10.1007/BF00579955 | title = The flavonoids of the rhizomes ofRhodiola rosea. II. A flavonolignan and glycosides of herbacetin | journal = Chemistry of Natural Compounds | volume = 19 | pages = 21–29 | year = 1983 | s2cid = 7656479 }}</ref>
==References== {{Reflist}}
{{flavonol}}
Category:Flavonols Category:Hydroxyquinols Category:Pentols
{{aromatic-stub}}