{{Chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 459443626 | Name = Guaienes | ImageFileL1 = Alpha-guaiene.svg | ImageCaptionL1 = α-Guaiene | ImageFileR1 = Beta-guaiene.svg | ImageCaptionR1 = β-Guaiene | ImageFile2 = Delta-guaiene.svg | ImageSize2 = 100px | ImageCaption2 = δ-Guaiene | IUPACName = α: (1''S'',4''S'',7''R'')-1,4-Dimethyl-7-(prop-1-en-2-yl)-1,2,3,4,5,6,7,8-octahydroazulene<br>β: (1''S'',4''S'')-1,4-Dimethyl-7-(propan-2-ylidene)-1,2,3,4,5,6,7,8-octahydroazulene<br>δ: (3''S'',3a''S'',5''R'')-3,8-Dimethyl-5-(prop-1-en-2-yl)-1,2,3,3a,4,5,6,7-octahydroazulene | OtherNames = Guajene |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|}} | CASNo = 3691-12-1 | CASNo_Comment = (α) | CASNo1_Ref = {{cascite|correct|}} | CASNo1 = 88-84-6 | CASNo1_Comment = (β) | CASNo2_Ref = {{cascite|correct|}} | CASNo2 = 3691-11-0 | CASNo2_Comment = (δ) | UNII_Ref = {{fdacite|changed|FDA}} | UNII = ABQ2CB7VAC | UNII_Comment = (α) | UNII1_Ref = {{fdacite|changed|FDA}} | UNII1 = 1D018Q907T | UNII1_Comment = (β) | UNII2_Ref = {{fdacite|changed|FDA}} | UNII2 = 2U8L6FYE8U | UNII2_Comment = (δ) | PubChem = 5317844 | PubChem_Comment = (α) | PubChem1 = 15560252 | PubChem1_Comment = (β) | PubChem2 = 94275 | PubChem2_Comment = (δ) | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 4476575 | ChemSpiderID_Comment = (α) | ChemSpiderID1_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID1 = 16736689 | ChemSpiderID1_Comment = (β) | ChemSpiderID2_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID2 = 85080 | ChemSpiderID2_Comment = (δ) | SMILES = C[C@H]1CCC2=C1C[C@H](C(C)=C)CC[C@@H]2C | SMILES_Comment = (α) | SMILES1 = C[C@H]1CCC2=C1C/C(CC[C@@H]2C)=C(C)\C | SMILES1_Comment = (β) | SMILES2 = C[C@H]1CCC2=C(C)CC[C@@H](C(C)=C)C[C@]21[H] | SMILES2_Comment = (δ) | InChI = 1S/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h11-13H,1,5-9H2,2-4H3/t11-,12-,13+/m0/s1 | InChI_Comment = (α) | InChIKey = ADIDQIZBYUABQK-RWMBFGLXSA-N | InChI1 = 1S/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h11-12H,5-9H2,1-4H3/t11-,12-/m0/s1 | InChI1_Comment = (β) | InChIKey1 = GIBQERSGRNPMEH-RYUDHWBXSA-N | InChI2 = 1S/C15H24/c1-10(2)13-7-5-11(3)14-8-6-12(4)15(14)9-13/h12-13,15H,1,5-9H2,2-4H3/t12-,13+,15-/m0/s1 | InChI2_Comment = (δ) | InChIKey2 = YHAJBLWYOIUHHM-GUTXKFCHSA-N }} |Section2={{Chembox Properties | C=15 | H=24 | Appearance = | Density = | MeltingPt = | BoilingPt = α: 281-282 °C<ref name=thegoodscentscompany>[http://www.thegoodscentscompany.com/data/rw1054351.html Alpha-guaiene], The Good Scents Company</ref><br>α: 78-79 °C (@ 2.5 Torr)<ref>{{cite journal | author = Takeda, Kenichi | journal = Tetrahedron | year = 1961 | volume = 13 | pages = 308–318 | doi = 10.1016/S0040-4020(01)92224-0 | title = Studies on sesquiterpenoids—III, Some derivatives of guaiol | issue = 4}}</ref><br>β: 281 °C<ref>{{cite journal | author = Won, Mi-Mi | title = Analytica Chimica Acta | year = 2009 | volume = 631 | issue = 1 | pages = 54–61}}</ref> | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Guaienes''' are a series of closely related natural chemical compounds that have been isolated from a variety of plant sources. The guaienes are sesquiterpenes with the molecular formula C<sub>15</sub>H<sub>24</sub>. α-Guaiene is the most common and was first isolated from guaiac wood oil from ''Bulnesia sarmientoi''.<ref>{{cite journal |author1=Bates, R. B. |author2=Slagel, R. C. | title = Terpenoids. VI. β-Bulnesene, α-guaiene, β-patchoulene, and guaioxide in essential oils | journal = Chemistry & Industry | year = 1962 | pages = 1715–1716}}</ref> The guaienes are used in the fragrance and flavoring industries to impart earthy, spicy aromas and tastes.<ref name=thegoodscentscompany/><ref>[http://www.fao.org/ag/agn/agns/jecfa_index_en.asp Guaiene], Joint FAO/WHO Expert Committee on Food Additives</ref>
==See also== * Guaiol
==References== {{reflist}}
Category:Sesquiterpenes