{{Chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 486431465 | ImageFile = Guaiol.svg | IUPACName = Guai-1(5)-en-11-ol | SystematicName = 2-[(3''S'',5''R'',8''S'')-3,8-Dimethyl-1,2,3,4,5,6,7,8-octahydroazulen-5-yl]propan-2-ol | OtherNames = Champacol,<BR>5-Azulenemethanol |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 489-86-1 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = I7WP008A91 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 226915 | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = 5552 | PubChem = 227829 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 198233 | SMILES = OC([C@H]1C\C2=C(/[C@H](CC1)C)CC[C@@H]2C)(C)C | InChI = 1/C15H26O/c1-10-5-7-12(15(3,4)16)9-14-11(2)6-8-13(10)14/h10-12,16H,5-9H2,1-4H3/t10-,11-,12+/m0/s1 | InChIKey = TWVJWDMOZJXUID-SDDRHHMPBW | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C15H26O/c1-10-5-7-12(15(3,4)16)9-14-11(2)6-8-13(10)14/h10-12,16H,5-9H2,1-4H3/t10-,11-,12+/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = TWVJWDMOZJXUID-SDDRHHMPSA-N }} |Section2={{Chembox Properties | C=15|H=26|O=1 | Appearance = | Density = 0.961 g/mL | MeltingPtC = 92 | BoilingPtC = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Guaiol''' or '''champacol''' is an organic compound, a sesquiterpenoid alcohol found in several plants, especially in the oil of guaiacum and cypress pine.<ref name=webster>The Merriam-Webster Dictionary.</ref> It is a crystalline solid that melts at 92 °C.<ref name=alpha>Wolfram Alpha ''Guaiol''</ref> Guaiol is one of many terpenes found in ''Cannabis'' flowers and it has been associated with a decrease in anxiolytic activity.<ref>{{Cite journal|last=Hillig|first=Karl W|date=2004-10-01|title=A chemotaxonomic analysis of terpenoid variation in Cannabis|journal=Biochemical Systematics and Ecology|volume=32|issue=10|pages=875–891|doi=10.1016/j.bse.2004.04.004|bibcode=2004BioSE..32..875H }}</ref><ref>{{Cite journal | doi=10.3389/fnins.2018.00730| title=Cannabis and the Anxiety of Fragmentation—A Systems Approach for Finding an Anxiolytic Cannabis Chemotype| journal=Frontiers in Neuroscience| volume=12| year=2018| last1=Kamal| first1=Brishna S.| last2=Kamal| first2=Fatima| last3=Lantela| first3=Daniel E.| article-number=730| pmid=30405331| pmc=6204402| doi-access=free}}</ref>
==Reactions==
Guaiol yields a deep purple color when treated with electrophilic bromine reagents.<ref name=waddell>{{cite journal | pmid = 12391567 | year = 2002 | last1 = Waddell | first1 = TG | last2 = Arp | first2 = NW | last3 = Bodine | first3 = KD | last4 = Pagni | first4 = RM | title = The guaiol color reaction | volume = 68 | issue = 10 | pages = 949–50 | doi = 10.1055/s-2002-34931 | journal = Planta Medica| bibcode = 2002PlMed..68..949W }}</ref>
==See also== * Guaiene * Guaiazulene
==References== {{reflist}}
Category:Tertiary alcohols Category:Sesquiterpenes
{{alcohol-stub}}