{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 436273880 | Name = Geranyl acetate | ImageFile = Geranyl acetate skeletal.svg | ImageClass = skin-invert | ImageSize = 200px | ImageName = Skeletal formula | ImageFile1 = Geranyl-acetate-3D-balls.png | ImageClass1 = bg-transparent | ImageSize1 = 200px | ImageName1 = Ball-and-stick model | PIN = (2''E'')-3,7-Dimethylocta-2,6-dien-1-yl acetate | OtherNames = Geraniol acetate; Geranyl ethanoate |Section1={{Chembox Identifiers | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 1266019 | PubChem = 1549026 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 5331 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 3W81YG7P9R | InChI = 1/C12H20O2/c1-10(2)6-5-7-11(3)8-9-14-12(4)13/h6,8H,5,7,9H2,1-4H3/b11-8+ | InChIKey = HIGQPQRQIQDZMP-DHZHZOJOBM | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C12H20O2/c1-10(2)6-5-7-11(3)8-9-14-12(4)13/h6,8H,5,7,9H2,1-4H3/b11-8+ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = HIGQPQRQIQDZMP-DHZHZOJOSA-N | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 105-87-3 | SMILES = O=C(OC/C=C(/CC/C=C(\C)C)C)C }} |Section2={{Chembox Properties | C=12|H=20|O=2 | Density = 0.916 g/cm<sup>3</sup> at 15 °C | MeltingPt =< | MeltingPtC =25 | BoilingPtC = 240 to 245 | BoilingPt_ref = <ref name=ScentsandFlavors>[https://scentsandflavors.com/database/9dbb5112-feb4-40d3-adc6-908475f042c3 Geranyl acetate], Scents and Flavors</ref> }} }}
'''Geranyl acetate''' is a terpenoid. It is a colorless liquid with a pleasant floral or fruity rose aroma. It is a colorless liquid but commercial samples can appear yellowish. Geranyl acetate is insoluble in water but soluble in organic solvents. Several hundred tons are produced annually.<ref>{{cite book |doi=10.1002/0471238961.2005181602120504.a01.pub2|chapter=Terpenoids |title=Kirk-Othmer Encyclopedia of Chemical Technology |year=2006 |last1=Sell |first1=Charles S. |isbn=0471238961 }}</ref>
==Occurrence and production== Geranyl acetate is a constituent of many essential oils, including Ceylon citronella, palmarosa, lemon grass, petit grain, neroli, geranium, coriander, carrot, Camden woollybutt, and sassafras. It can be obtained by fractional distillation of the essential oils obtained from these sources, but more commonly it is prepared by the esterification of geraniol with acetic acid.
==Uses== Geranyl acetate is used primarily as a component of perfumes for creams and soaps and as a flavoring ingredient. It is used particularly in rose, lavender and geranium formulations where a sweet fruity or citrus aroma is desired. Its aroma is described as floral, rose, lavender, green, waxy, and herbal.<ref>{{cite web |title=geranyl acetate|url=https://scentsandflavors.com/database/9dbb5112-feb4-40d3-adc6-908475f042c3 |website=Scents and Flavors |publisher=Scents and Flavors |access-date=26 March 2026}}</ref> It is designated by the U.S. Food and Drug Administration as generally recognized as safe (GRAS).
==See also== * Neryl acetate
==References== {{reflist}}
==External links== *[https://ntp.niehs.nih.gov/publications/reports/tr/tr252 Carcinogenesis Studies of Food Grade Geranyl Acetate] *{{cite journal | doi = 10.1016/0015-6264(74)90167-9 | title = Fragrance raw materials monographs Geranyl acetate | year = 1974 | journal = Food and Cosmetics Toxicology | volume = 12 | issue = 7–8 | pages = 885}}
{{DEFAULTSORT:Geranyl Acetate}} Category:Perfume ingredients Category:Flavors Category:Monoterpenes Category:Acetate esters