{{Chembox | ImageFile = Nerylacetat.svg | ImageSize = 140 | ImageAlt = Skeletal formula of neryl acetate | ImageFile1 = Neryl-acetate-3D-balls.png | ImageSize1 = 220 | ImageAlt1 = Ball-and-stick model of the neryl acetate molecule | PIN = (2''Z'')-3,7-Dimethylocta-2,6-dien-1-yl acetate | OtherNames = Nerol acetate; Acetic acid neryl ester; ''cis''-Geranyl acetate |Section1={{Chembox Identifiers | CASNo = 141-12-8 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = OF82IJU18H | PubChem = 1549025 | ChemSpiderID = 1266018 | ChEBI = 141210 | SMILES = O=C(OC\C=C(/CC/C=C(\C)C)C)C | InChI = 1/C12H20O2/c1-10(2)6-5-7-11(3)8-9-14-12(4)13/h6,8H,5,7,9H2,1-4H3/b11-8- | InChIKey = HIGQPQRQIQDZMP-FLIBITNWBJ | StdInChI = 1S/C12H20O2/c1-10(2)6-5-7-11(3)8-9-14-12(4)13/h6,8H,5,7,9H2,1-4H3/b11-8- | StdInChIKey = HIGQPQRQIQDZMP-FLIBITNWSA-N }} |Section2={{Chembox Properties | C=12 | H=20 | O=2 | Appearance = colorless liquid | Density = 0.91 g/cm<sup>3</sup> | MeltingPtC= | BoilingPtC = 231 | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = {{convert|99|C|F}}<ref>[http://www.sigmaaldrich.com/catalog/product/aldrich/w277304?lang=en®ion=US Neryl acetate], Sigma-Aldrich</ref> | AutoignitionPt = }} }} '''Neryl acetate''' is a terpenoid found in citrus oils. It is the acetate ester of nerol, a diastereomer (or geometric isomer) of the more common fragrance geranyl acetate.<ref>{{cite book |doi=10.1002/0471238961.2005181602120504.a01.pub2|chapter=Terpenoids |title=Kirk-Othmer Encyclopedia of Chemical Technology |year=2006 |last1=Sell |first1=Charles S. |isbn=0471238961 }}</ref> Its aroma is described as floral, rose, soapy, citrus, dewy, pear, sweet, grapefruit, fruity, and tropical.<ref>{{cite web |title=neryl acetate|url=https://scentsandflavors.com/database/9dbb5136-7e15-47ee-b4b2-9b5569f0b23a |website=Scents and Flavors |publisher=Scents and Flavors |access-date=26 March 2026}}</ref> In flavors and perfumery it is used to impart floral and fruity aromas.<ref>[https://www.takasago.com/cgi-bin/detail.cgi?key=C119393 Neryl acetate] {{Webarchive|url=https://web.archive.org/web/20160304063337/http://www.takasago.com/cgi-bin/detail.cgi?key=C119393|date=2016-03-04}}, takasago.com</ref>
==See also== * Geranyl acetate
==References== {{reflist}}
{{ester-stub}}
Category:Acetate esters