{{Chembox |ImageFile = Butroxydim Structure.svg |IUPACName = 5-(3-Butanoyl-2,4,6-trimethylphenyl)-2-[1-(ethoxyamino)propylidene]cyclohexane-1,3-dione |Section1 ={{Chembox Identifiers | PubChem = 10905426 | StdInChI=1S/C24H33NO4/c1-7-10-19(26)23-15(5)11-14(4)22(16(23)6)17-12-20(27)24(21(28)13-17)18(8-2)25-29-9-3/h11,17,25H,7-10,12-13H2,1-6H3 | StdInChIKey = LQNKITCRDAZSGT-UHFFFAOYSA-N | SMILES = CCCC(=O)C1=C(C(=C(C=C1C)C)C2CC(=O)C(=C(CC)NOCC)C(=O)C2)C | CASNo = 138164-12-2 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = LN82LZK7KD | EC_number = 414-790-3 | ChEBI = 81901 | ChEMBL = 1210086 | KEGG = C18705 | ChemSpiderID = 10469362 }} |Section2= {{Chembox Properties |C=24|H=33|N=1|O=4 | MolarMass = | Appearance = white solid | Density = | MeltingPtC = 80 | BoilingPt = | Solubility = }}

}} '''Butroxydim''' is a chemical used as a herbicide. It is a group A herbicide used to kill grass weeds in a range of broadacre crops.<ref>{{cite web |title=Butroxydim 250 |url=http://www.herbiguide.com.au/Descriptions/hg_Butroxydim_250.htm |website=www.herbiguide.com.au}}</ref> Structurally related herbicides against grasses are alloxydim, sethoxydim, clethodim, and cycloxydim. <ref>{{cite journal |doi=10.1071/CH10366|title=Cyclohexane-1,3-dione Oxime Ether Grass-Specific Herbicides and the Discovery of Butroxydim|year=2011|last1=Watson|first1=Keith G.|journal=Australian Journal of Chemistry|volume=64|issue=4|page=367}}</ref>

Butroxydim's HRAC classification is Group A (Australia and global), or Group 1 (numeric). Group A herbicides inhibit acetyl CoA carboxylase, (ACCase).<ref>{{cite web |title=Classification of Herbicides According to Site of Action |url=https://www.weedscience.org/Documents/ShowDocuments.aspx?DocumentID=1193 |access-date=19 July 2025}}</ref>

==References== {{Reflist}}

Category:2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxycyclohex-2-en-1-one derivatives Category:Ethoxy compounds Category:Group 1 herbicides

{{Ether-stub}} {{agriculture-stub}}