Clethodim

{{Chembox | ImageFile = Clethodim.svg | ImageSize = | ImageAlt = | IUPACName = 2-[(''E'')-''N''-[(''E'')-3-chloroprop-2-enoxy]-''C''-ethylcarbonimidoyl]-5-(2-ethylsulfanylpropyl)-3-hydroxycyclohex-2-en-1-one | OtherNames = Centurion, Centurion Plus, Chevron RE 45601 |Section1={{Chembox Identifiers | ChEBI = 70721 | ChEMBL = 111058 | CASNo = 99129-21-2 | ChemSpiderID = 11677232 | EC_number = 619-396-7 | KEGG = C18609 | PubChem = 135491728 | UNII = 05SB62IB6F | StdInChI=1S/C17H26ClNO3S/c1-4-14(19-22-8-6-7-18)17-15(20)10-13(11-16(17)21)9-12(3)23-5-2/h6-7,12-13,20H,4-5,8-11H2,1-3H3/b7-6+,19-14+ | StdInChIKey = SILSDTWXNBZOGF-KUZBFYBWSA-N | SMILES = CC/C(=N\OC/C=C/Cl)/C1=C(CC(CC1=O)CC(C)SCC)O }} |Section2={{Chembox Properties | C=17 | H=26 | Cl=1 | N=1 | O=3 | S=1 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | GHSPictograms = {{GHS07}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|302|317|412}} | PPhrases = {{P-phrases|261|264|270|272|273|280|301+312|302+352|321|330|333+313|363|501}} | MainHazards = | FlashPt = | AutoignitionPt = }} }} '''Clethodim''' is an herbicide of the cyclohexanedione family. It is used to control grasses, especially annual ryegrass (''Lolium rigidum'').<ref>{{cite journal |doi=10.1071/CH10366|title=Cyclohexane-1,3-dione Oxime Ether Grass-Specific Herbicides and the Discovery of Butroxydim|year=2011|last1=Watson|first1=Keith G.|journal=Australian Journal of Chemistry|volume=64|issue=4|page=367}}</ref><ref>{{cite journal |doi=10.1104/pp.107.105262|title=Diversity of Acetyl-Coenzyme a Carboxylase Mutations in Resistant Lolium Populations: Evaluation Using Clethodim|year=2007|last1=Yu|first1=Qin|last2=Collavo|first2=Alberto|last3=Zheng|first3=Ming-Qi|last4=Owen|first4=Mechelle|last5=Sattin|first5=Maurizio|last6=Powles|first6=Stephen B.|journal=Plant Physiology|volume=145|issue=2|pages=547–558|pmid=17720757|pmc=2048730|author-link6=Stephen Powles}}</ref> Although impure samples appear yellowish, the compound is colorless.

Clethodim's HRAC classification is Group A (Australia and global) or Group 1 (numeric). Group A herbicides inhibit acetyl-CoA carboxylase (ACCase).<ref>{{cite web |title=Classification of Herbicides According to Site of Action |url=https://www.weedscience.org/Documents/ShowDocuments.aspx?DocumentID=1193 |access-date=19 July 2025}}</ref>

==References== <references />

Category:Group 1 herbicides Category:2-(N-ethoxy-C-ethylcarbonimidoyl)-3-hydroxycyclohex-2-en-1-one derivatives Category:Ethylthio compounds