{{Short description|Mixture of two compounds}} {{Drugbox | Verifiedfields = | Watchedfields = | verifiedrevid = | IUPAC_name = 2-Fluoro-4-[3-(3-fluoro-4-hydroxyphenyl)pentan-2-yl]phenol | image = Bifluranol.svg | image_class = skin-invert-image | width = 250px
<!--Clinical data--> | tradename = Prostarex | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration = | class = Nonsteroidal estrogen
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | CAS_number_Ref = | CAS_number = 34633-34-6 | CAS_supplemental = | ATC_prefix = | ATC_suffix = | PubChem = 71713 | DrugBank_Ref = | DrugBank = | ChEBI = 135219 | ChemSpiderID_Ref = | ChemSpiderID = 64763 | ChEMBL = 2105524 | UNII = 47602X79JF | synonyms = BX-341
<!--Chemical data--> | C=17 | H=18 | F=2 | O=2 | SMILES = CCC(C1=CC(=C(C=C1)O)F)C(C)C2=CC(=C(C=C2)O)F | StdInChI_Ref = | StdInChI = 1S/C17H18F2O2/c1-3-13(12-5-7-17(21)15(19)9-12)10(2)11-4-6-16(20)14(18)8-11/h4-10,13,20-21H,3H2,1-2H3 | StdInChIKey_Ref = | StdInChIKey = RDVXUHOSYIBGBT-UHFFFAOYSA-N }}
'''Bifluranol''' ({{abbrlink|INN|International Nonproprietary Name}}, {{abbrlink|BAN|British Approved Name}}; brand name '''Prostarex'''; former developmental code name '''BX-341''') is a synthetic nonsteroidal estrogen of the stilbestrol group related to diethylstilbestrol that has been used as an antiandrogen in the United Kingdom in the treatment of benign prostatic hyperplasia.<ref name="Elks2014">{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=RA1-PA364|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|pages=152}}</ref><ref name="IndexNominum2000">{{cite book|title=Index Nominum 2000: International Drug Directory|url=https://books.google.com/books?id=5GpcTQD_L2oC&pg=PA124|date=January 2000|publisher=Taylor & Francis|isbn=978-3-88763-075-1|pages=124–}}</ref><ref name="Dekanski1980">{{cite journal | vauthors = Dekanski JB | title = Anti-prostatic activity of bifluranol, a fluorinated bibenzyl | journal = British Journal of Pharmacology | volume = 71 | issue = 1 | pages = 11–16 | year = 1980 | pmid = 6258683 | pmc = 2044395 | doi = 10.1111/j.1476-5381.1980.tb10903.x }}</ref><ref name="PopeGilbert1981">{{cite journal | vauthors = Pope DJ, Gilbert AP, Easter DJ, Chan RP, Turner JC, Gottfried S, Parke DV | title = Bifluranol, a novel fluorinated bibenzyl anti-androgen, its chemistry and disposition in different animal species | journal = The Journal of Pharmacy and Pharmacology | volume = 33 | issue = 5 | pages = 297–301 | date = May 1981 | pmid = 6116777 | doi = 10.1111/j.2042-7158.1981.tb13784.x | s2cid = 40258860 }}</ref><ref name="BeacockBuck1985">{{cite journal| vauthors = Beacock CJ, Buck AC, Roberts EE |title=Bifluranol in the treatment of benign prostatic hyperplasia (BPH)|journal=The Prostate|volume=7|issue=4|year=1985|pages=357–361|issn=0270-4137|doi=10.1002/pros.2990070403|s2cid=71645575}}</ref><ref name="KeaneTimoney1988">{{cite journal | vauthors = Keane PF, Timoney AG, Kiely E, Williams G, Stamp G | title = Response of the benign hypertrophied prostate to treatment with an LHRH analogue | journal = British Journal of Urology | volume = 62 | issue = 2 | pages = 163–165 | date = August 1988 | pmid = 2457404 | doi = 10.1111/j.1464-410X.1988.tb04299.x }}</ref><ref name="AgriculturaMejora1978">{{cite book|author1=Spain. Ministerio de Agricultura|author2=Universidad Complutense de Madrid. Departamento de Genetico y Mejora|title=3rd World Congress of Animal Feeding|url=https://books.google.com/books?id=ZgYFAQAAIAAJ|year=1978|publisher=Industrias Gráficas España|isbn=978-84-7391-022-4|page=532}}</ref><ref name="AcademicPress1986">{{cite book|title=Annual Reports in Medicinal Chemistry|url=https://books.google.com/books?id=qsFCGskRHZQC&pg=PA182|date=16 September 1986|publisher=Academic Press|isbn=978-0-08-058365-5|pages=182–}}</ref> The drug is described as a weak estrogen, and possesses about one-eighth the potency of diethylstilbestrol.<ref name="Dekanski1980" /><ref name="AgriculturaMejora1978" /><ref name="Agarwal1987">{{cite book| vauthors = Agarwal MK |title=Receptor mediated antisteroid action|url=https://books.google.com/books?id=JfNsAAAAMAAJ|year=1987|publisher=De Gruyter|isbn=978-0-89925-374-9|page=330}}</ref>
In spite of the fact that it is widely referred to as an antiandrogen in the literature, bifluranol is actually a pure estrogen and does not significantly bind to the androgen receptor or directly antagonize the action of androgens.<ref name="Dekanski1980" /> It exerts functional antiandrogen effects by binding to and activating the estrogen receptor in the pituitary gland, consequently suppressing the secretion of luteinizing hormone (and hence acting as an antigonadotropin) and thereby reducing gonadal androgen production and systemic androgen levels.<ref name="Dekanski1980" /> Bifluranol has also been found to act as a 17α-hydroxylase/17,20 lyase inhibitor, though with less potency than ketoconazole, and this action may contribute to its efficacy in benign prostatic hyperplasia by further helping to lower androgen levels.<ref name="BarrieRowlands1989">{{cite journal | vauthors = Barrie SE, Rowlands MG, Foster AB, Jarman M | title = Inhibition of 17 alpha-hydroxylase/C17-C20 lyase by bifluranol and its analogues | journal = Journal of Steroid Biochemistry | volume = 33 | issue = 6 | pages = 1191–1195 | date = December 1989 | pmid = 2559252 | doi = 10.1016/0022-4731(89)90429-9 }}</ref><ref name="JarmanJohn Smith1998">{{cite journal | vauthors = Jarman M, Smith HJ, Nicholls PJ, Simons C | title = Inhibitors of enzymes of androgen biosynthesis: cytochrome P450(17) alpha and 5 alpha-steroid reductase | journal = Natural Product Reports | volume = 15 | issue = 5 | pages = 495–512 | date = October 1998 | pmid = 9807812 | doi = 10.1039/a815495y }}</ref><ref name="BarrieHaynes1997">{{cite journal | vauthors = Barrie SE, Haynes BP, Potter GA, Chan FC, Goddard PM, Dowsett M, Jarman M | title = Biochemistry and pharmacokinetics of potent non-steroidal cytochrome P450(17alpha) inhibitors | journal = The Journal of Steroid Biochemistry and Molecular Biology | volume = 60 | issue = 5–6 | pages = 347–351 | date = March 1997 | pmid = 9219927 | doi = 10.1016/S0960-0760(96)00225-7 | s2cid = 54340023 }}</ref>
Related drugs include pentafluranol (BX-430) and terfluranol (BX-428), which are also estrogens.<ref name="Polonii1984">{{cite book | veditors = Kubiak H, Wróbel J | author = Polska Akademia Nauk. Komitet Badania Polonii|title=II Kongres Uczonych Polskiego Pochodzenia: zbiór materiałów|url=https://books.google.com/books?id=_-VjAAAAIAAJ|year=1984|publisher=Zakład Narodowy im. Ossolińskich|isbn=978-83-04-01670-5|quote=[This explains why the estrogenic activity is minimal in terms of pentafluranol or even bifluranol. Doses which shall apply from 1 to 6 days of pregnancy, are in micrograms per kg of body weight: bifluranol 80, 30 and terfluranol pentafluranol 280 ...]}}</ref>
== See also == * Acefluranol * Paroxypropione * Metallibure
== References == {{Reflist|30em}}
{{Estrogens and antiestrogens}} {{Androgens and antiandrogens}} {{Estrogen receptor modulators}}
Category:Abandoned drugs Category:Antigonadotropins Category:CYP17A1 inhibitors Category:Enzyme inhibitors Category:Fluoroarenes Category:Synthetic estrogens