{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = | Watchedfields = | verifiedrevid = | IUPAC_name = 2-Fluoro-4-[5,5,5-trifluoro-3-(3-fluoro-4-hydroxyphenyl)pentan-2-yl]phenol | image = Pentafluranol.svg | image_class = skin-invert-image | width =
<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = | legal_UK = | legal_US = | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =
<!-- Identifiers --> | CAS_number_Ref = | CAS_number = 65634-39-1 | CAS_supplemental = | ATC_prefix = None | ATC_suffix = | ATC_supplemental = | PubChem = 3047826 | IUPHAR_ligand = | DrugBank_Ref = | DrugBank = | ChemSpiderID_Ref = | ChemSpiderID = 16737041 | UNII = 95RFZ48151 | KEGG = | ChEBI = | ChEMBL = 2105409
<!--Chemical data--> | C=17 | H=15 | F=5 | O=2 | smiles = CC(C1=CC(=C(C=C1)O)F)C(CC(F)(F)F)C2=CC(=C(C=C2)O)F | StdInChI_Ref = | StdInChI = 1S/C17H15F5O2/c1-9(10-2-4-15(23)13(18)6-10)12(8-17(20,21)22)11-3-5-16(24)14(19)7-11/h2-7,9,12,23-24H,8H2,1H3 | StdInChIKey_Ref = | StdInChIKey = PRRSFMGODMUPJN-UHFFFAOYSA-N | synonyms = }}
'''Pentafluranol''' (INN, BAN; developmental code '''BX-430''') is a synthetic, nonsteroidal estrogen of the stilbestrol group related to diethylstilbestrol that was developed for the treatment of benign prostatic hyperplasia never marketed.<ref name="Elks2014">{{cite book| vauthors = Elks J |title=The Dictionary of Drugs: Chemical Data: Chemical Data, Structures and Bibliographies|url=https://books.google.com/books?id=0vXTBwAAQBAJ&pg=PP1|date=14 November 2014|publisher=Springer|isbn=978-1-4757-2085-3|page=1161}}</ref><ref name="Polonii1984">{{cite book|author=Polska Akademia Nauk. Komitet Badania Polonii|title=II Kongres Uczonych Polskiego Pochodzenia: zbiór materiałów|url=https://books.google.com/books?id=_-VjAAAAIAAJ|year=1984|publisher=Zakład Narodowy im. Ossolińskich|isbn=978-83-04-01670-5|page=451}}</ref> It was described in the medical literature in 1974.<ref name="Elks2014" />
==See also== * Acefluranol * Bifluranol * Terfluranol
==References== {{Reflist|2}}
{{Estrogen receptor modulators}}
Category:Organofluorides Category:Phenols Category:Synthetic estrogens Category:Fluoroarenes Category:Trifluoromethyl compounds
{{genito-urinary-drug-stub}}