{{technical|date=May 2014}} {{Chembox | ImageFile = vicianose.svg | ImageSize = 200px | ImageAlt = | IUPACName = α-{{sm|l}}-Arabinopyranosyl-(1→6)-β-{{sm|d}}-glucopyranose<br>6-''O''-α-{{sm|l}}-Arabinopyranosyl-{{sm|d}}-glucopyranose | OtherNames = 6-''O''-α-<small>L</small>-arabinopyranosyl-<small>D</small>-glucopyranose | Section1 = {{Chembox Identifiers | CASNo = 14116-69-9 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = UC25IYC1RX | PubChem = 439537 | ChemSpiderID = 388630 | ChEBI = 16177 | KEGG = C01625 | InChI=1S/C11H20O10/c12-3-1-19-11(9(17)5(3)13)20-2-4-6(14)7(15)8(16)10(18)21-4/h3-18H,1-2H2/t3-,4+,5-,6+,7-,8+,9+,10?,11-/m0/s1 | InChIKey= QYNRIDLOTGRNML-ULAALWPKSA-N | SMILES = C1[C@@H]([C@@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H](C(O2)O)O)O)O)O)O)O }} | Section2 = {{Chembox Properties | C=11|H=20|O=10 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} | Section3 = {{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Vicianose''' is a disaccharide.
Vicianin is a cyanogenic glycoside containing vicianose. The enzyme vicianin beta-glucosidase uses (''R'')-vicianin and water to produce mandelonitrile and vicianose.
The fruits of ''Viburnum dentatum'' appear blue. One of the major pigments is cyanidin 3-vicianoside, but the total mixture is very complex.<ref>{{Cite journal | title = Food colorants: Anthocyanins | author = F.J. Francis and Pericles C. Markakis | journal = Critical Reviews in Food Science and Nutrition | date = 1989 | volume =28 | issue =4 | pages = 273–314 | doi = 10.1080/10408398909527503 | pmid=2690857}}</ref>
== References == {{reflist}}
Category:Disaccharides
{{Carbohydrate-stub}}