{{chembox | Watchedfields = changed | verifiedrevid = 441557672 | Name = Vicianin | ImageFile = Vicianin.svg | ImageName = Chemical structure of vicianin | ImageAlt = Chemical structure of vicianin | IUPACName = (''R'')-[α-{{small|L}}-Arabinopyranosyl-(1→6)-β-{{small|D}}-glucopyranosyloxy](phenyl)acetonitrile | SystematicName = (''R'')-Phenyl{[(2''R'',3''R'',4''S'',5''S'',6''R'')-3,4,5-trihydroxy-6-({[(2''S'',3''R'',4''S'',5''S'')-3,4,5-trihydroxyoxan-2-yl]oxy}methyl)oxan-2-yl]oxy}acetonitrile | OtherNames = (''R'')-Vicianin<br>6-''O''-Arabinopyranosylglucopyranoside<br>β-Vicianoside |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|??}} | CASNo = 155-57-7 | ChEBI = 166510 | ChemSpiderID = 570879 | KEGG = C01870 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = CQU61CXY3D | PubChem = 656493 | StdInChI=1S/C19H25NO10/c20-6-11(9-4-2-1-3-5-9)29-19-17(26)15(24)14(23)12(30-19)8-28-18-16(25)13(22)10(21)7-27-18/h1-5,10-19,21-26H,7-8H2/t10-,11-,12+,13-,14+,15-,16+,17+,18-,19-/m0/s1 | StdInChIKey = YYYCJNDALLBNEG-YQCIQBACSA-N | SMILES = C1[C@@H]([C@@H]([C@H]([C@@H](O1)OC[C@@H]2[C@H]([C@@H]([C@H]([C@@H](O2)O[C@@H](C#N)C3=CC=CC=C3)O)O)O)O)O)O }} |Section2={{Chembox Properties | C=19|H=25|N=1|O=10 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section8={{Chembox Related | OtherAnions = | OtherCations = | OtherFunction = | OtherFunction_label = | OtherCompounds = amygdalin }} }} '''Vicianin''' is a cyanogenic disaccharide.
The enzyme vicianin beta-glucosidase uses (''R'')-vicianin and H<sub>2</sub>O to produce mandelonitrile and vicianose. It is found in seeds of ''Vicia angustifolia''.<ref>{{Cite journal | doi =10.1093/pcp/pcm065| pmid =17548373| title =Vicianin hydrolase is a novel cyanogenic beta-glycosidase specific to beta-vicianoside (6-O-alpha-L-arabinopyranosyl-beta-D-glucopyranoside) in seeds of Vicia angustifolia| journal =Plant and Cell Physiology| volume =48| issue =7| pages =938–47| year =2007| last1 =Ahn| first1 =Y. O.| last2 =Saino| first2 =H.| last3 =Mizutani| first3 =M.| last4 =Shimizu| first4 =B.-i.| last5 =Sakata| first5 =K.| doi-access =free}}</ref>
== References == {{reflist}}
Category:Cyanogenic glycosides
{{aromatic-stub}}