{{cs1 config|name-list-style=vanc|display-authors=6}} {{Infobox drug | image = UM171_structure.png | image_class = skin-invert-image | width =

<!-- Clinical data --> | tradename = | pregnancy_category = d | routes_of_administration = | class = | ATC_prefix = | ATC_suffix = | ATC_supplemental =

<!-- Legal status --> | legal_status =

<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = | excretion =

<!-- Identifiers --> | CAS_number = 1448724-09-1 | CAS_supplemental = | PubChem = 71714981 | IUPHAR_ligand = | DrugBank = | ChemSpiderID = | UNII = | ChEMBL = | synonyms =

<!-- Chemical and physical data --> | IUPAC_name = ''trans''-4-N-[2-benzyl-7-(2-methyltetrazol-5-yl)-9H-pyrimido[4,5-b]indol-4-yl]cyclohexane-1,4-diamine | C = 25 | H = 27 | N = 9 | SMILES = CN1N=C(N=N1)C2=CC3=C(C=C2)C4=C(N3)N=C(N=C4NC5CCC(CC5)N)CC6=CC=CC=C6 | StdInChI = 1S/C25H27N9/c1-34-32-23(31-33-34)16-7-12-19-20(14-16)28-25-22(19)24(27-18-10-8-17(26)9-11-18)29-21(30-25)13-15-5-3-2-4-6-15/h2-7,12,14,17-18H,8-11,13,26H2,1H3,(H2,27,28,29,30) | StdInChIKey = AZXXGVPWWKWGAE-UHFFFAOYSA-N }}

'''UM171''' is a small molecule that was initially developed to facilitate the ex vivo expansion of hematopoietic stem and progenitor cells (HSPCs), but is now also being evaluated for potential anti-cancer activity.

UM171 was first identified in 2014 during a chemical screening campaign aimed at finding compounds that promote the ''ex vivo'' expansion of HSPCs.<ref>{{Cite journal|url = http://www.bloodjournal.org/content/124/21/650.abstract?sso-checked=true|title = Pyrimido-Indole Derivatives Are Novel Agonists of Human Cord Blood Hematopoietic Stem Cell Self-Renewal| vauthors = Fares I, Chagaroui J, Gareau Y, Gingras S, Mayotte N, Csaszar E, Kiem HP, Iscove NN, Humphries RK, Eaves CJ, Cohen S |date = December 6, 2014|journal = Blood|volume = 124|issue = 21|page = 650|doi = 10.1182/blood.V124.21.650.650|url-access = subscription}}</ref> It was shown to markedly increase the number of transplantable stem cells derived from cord blood, which led to rapid preclinical and clinical testing in the context of hematopoietic stem cell transplantation.<ref>{{cite journal | vauthors = Xuan J, Liu Y, Liu J, Zeng X, Wang H | title = New Insights into Hematopoietic Stem Cell Expansion to Stimulate Repopulation of the Adult Blood System for Transplantation | journal = Life | volume = 12 | issue = 5 | date = May 2022 | page = 716 | doi = 10.3390/life12050716 | doi-access = free | pmid = 35629383 | pmc = 9146250 | bibcode = 2022Life...12..716X }}</ref><ref>{{cite journal | vauthors = Huang X, Guo B | title = Update on preclinical and clinical efforts on ex-vivo expansion of hematopoietic stem and progenitor cells | journal = Current Opinion in Hematology | volume = 29 | issue = 4 | pages = 167–173 | date = July 2022 | doi = 10.1097/MOH.0000000000000714 | pmid = 35220322 }}</ref><ref>{{cite journal | vauthors = Cohen S, Bambace N, Ahmad I, Roy J, Tang X, Zhang MJ, Burns L, Barabé F, Bernard L, Delisle JS, Kiss T, Lachance S, Roy DC, Veilleux O, Sauvageau G | title = Improved outcomes of UM171-expanded cord blood transplantation compared with other graft sources: real-world evidence | journal = Blood Advances | volume = 7 | issue = 19 | pages = 5717–5726 | date = October 2023 | doi = 10.1182/bloodadvances.2023010599 | pmid = 37467030 | pmc = 10539875 }}</ref><ref>{{cite journal | vauthors = Liu B, Klatt D, Zhou Y, Manis JP, Sauvageau G, Pellin D, Brendel C, Williams DA | title = UM171 enhances fitness and engraftment of gene-modified hematopoietic stem cells from patients with sickle cell disease | journal = Blood Advances | volume = 8 | issue = 22 | pages = 5885–5895 | date = November 2024 | doi = 10.1182/bloodadvances.2024013932 | pmid = 39293082 | pmc = 11612367 }}</ref><ref>{{cite journal | vauthors = Cui Y, Ren Y, Ren F, Zhang Y, Wang H | title = Synergistic effect and molecular mechanism of nicotinamide and UM171 in ''ex vivo'' expansion of long-term hematopoietic stem cells | journal = Regenerative Therapy | volume = 27 | pages = 191–199 | date = December 2024 | doi = 10.1016/j.reth.2024.03.011 | pmid = 38840730 | pmc = 11150914 }}</ref>

More recently, UM171 has been investigated for its potential in cancer therapy. Since suppression of LSD1 activity has emerged as a promising strategy in oncology, UM171—which promotes the ubiquitin-dependent proteasomal degradation of the LSD1–CoREST complex—has shown anti-cancer effects in preclinical studies.<ref>{{cite journal | vauthors = Hu A, Gao J, Varier KM, Gajendran B, Jiang F, Liu W, Wang C, Xiao X, Li Y, Zacksenhaus E, Ali S, Ben-David Y | title = UM171 cooperates with PIM1 inhibitors to restrict HSC expansion markers and suppress leukemia progression | journal = Cell Death Discovery | volume = 8 | issue = 1 | pages = 448 | date = November 2022 | doi = 10.1038/s41420-022-01244-6 | pmid = 36335089 | pmc = 9637110 }}</ref><ref>{{cite journal | vauthors = Ran X, Hu A, Kuang Y, Wang C, Liu W, Xiao X, Zacksenhaus E, Yu X, Ben-David Y | title = UM171 suppresses breast cancer progression by inducing KLF2 | journal = Breast Cancer Research and Treatment | volume = 207 | issue = 2 | pages = 405–415 | date = September 2024 | doi = 10.1007/s10549-024-07372-0 | pmid = 38874684 | pmc = 11297059 }}</ref><ref>{{cite journal | vauthors = Li M, Dai M, Cheng B, Li S, Guo E, Fu J, Ma T, Yu B | title = Strategies that regulate LSD1 for novel therapeutics | journal = Acta Pharmaceutica Sinica. B | volume = 14 | issue = 4 | pages = 1494–1507 | date = April 2024 | doi = 10.1016/j.apsb.2024.01.005 | doi-access = free| pmid = 38572094 | pmc = 10985039 }}</ref><ref>{{cite journal | vauthors = Song Y, Yu B | title = Leveraging non-enzymatic functions of LSD1 for novel therapeutics | journal = Trends in Pharmacological Sciences | date = February 2025 | doi = 10.1016/j.tips.2025.01.006 | pmid = 39966067 }}</ref><ref>{{cite journal | vauthors = Feng Y, Xie XY, Yang YQ, Sun YT, Ma WH, Zhou PJ, Li ZY, Liu HQ, Wang YF, Huang YS | title = Synthesis and evaluation of pyrimidoindole analogs in umbilical cord blood ex vivo expansion | journal = European Journal of Medicinal Chemistry | volume = 174 | pages = 181–197 | date = July 2019 | doi = 10.1016/j.ejmech.2019.04.042 | pmid = 31035239 }}</ref><ref>{{cite journal | vauthors = Subramaniam A, Žemaitis K, Talkhoncheh MS, Yudovich D, Bäckström A, Debnath S, Chen J, Jain MV, Galeev R, Gaetani M, Zubarev RA, Larsson J | title = Lysine-specific demethylase 1A restricts ex vivo propagation of human HSCs and is a target of UM171 | journal = Blood | volume = 136 | issue = 19 | pages = 2151–2161 | date = November 2020 | doi = 10.1182/blood.2020005827 | pmid = 32582923 | pmc = 7645986 }}</ref><ref name="Coulombe_2025">{{cite journal | vauthors = Coulombe P, Tomellini E, Chagraoui J, Mayotte N, Sauvageau G | title = Deciphering the effect of UM171 on human hematopoietic progenitor cell fate through clonal analysis | journal = Nature Communications | volume = 16 | issue = 1 | pages = 195 | date = January 2025 | pmid = 39747844 | pmc = 11696577 | doi = 10.1038/s41467-024-55225-7 }}</ref>

Mechanistic studies have shown that UM171 targets HDAC1 and HDAC2 within the LSD1/CoREST complex for degradation. Acting as a molecular glue, UM171 promotes the interaction of the CUL3KBTBD4 E3 ligase with HDAC1/2, leading to their ubiquitination and selective degradation. This, in turn, destabilizes HDAC1/2-containing corepressors such as CoREST and MIER1. Although LSD1 and CoREST are also degraded, these effects occur secondarily and more slowly compared to the direct depletion of HDAC1/2.<ref name = "Yeo_2025">{{cite journal | vauthors = Yeo MJ, Zhang O, Xie X, Nam E, Payne NC, Gosavi PM, Kwok HS, Iram I, Lee C, Li J, Chen NJ, Nguyen K, Jiang H, Wang ZA, Lee K, Mao H, Harry SA, Barakat IA, Takahashi M, Waterbury AL, Barone M, Mattevi A, Carr SA, Udeshi ND, Bar-Peled L, Cole PA, Mazitschek R, Liau BB, Zheng N | title = UM171 glues asymmetric CRL3-HDAC1/2 assembly to degrade CoREST corepressors | journal = Nature | date = February 2025 | pmid = 39939761 | doi = 10.1038/s41586-024-08532-4 | doi-access = free | pmc = 11882444 }}</ref>

== References == {{reflist}}

Category:Alkylamines Category:Benzyl compounds Category:Cyclohexanes Category:Indoles Category:Pyrimidines Category:Tetrazoles Category:Molecular glues