{{Short description|Chemical compound}} {{Drugbox | IUPAC_name = ''N'',''N''-dimethyl-2-(1-methyl-4,9-dihydro-3''H''-indeno[2,3-c]pyran-1-yl)ethanamine | image = Pirandamine.png | image_class = skin-invert-image

<!--Clinical data--> | tradename = | pregnancy_category = | legal_status = Uncontrolled | routes_of_administration = Oral

<!--Pharmacokinetic data--> | bioavailability = | metabolism = | elimination_half-life = | excretion =

<!--Identifiers--> | CAS_number = 42408-79-7

| CAS_number_Ref = {{cascite|correct|CAS}} | ATC_prefix = none | ATC_suffix = | PubChem = 431429 | ChemSpiderID = 381558 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = WC6V8L1Z13

<!--Chemical data--> | C=17 | H=23 | N=1 | O=1 | smiles = CC1(C2=C(CCO1)C3=CC=CC=C3C2)CCN(C)C | StdInChI = 1S/C17H23NO/c1-17(9-10-18(2)3)16-12-13-6-4-5-7-14(13)15(16)8-11-19-17/h4-7H,8-12H2,1-3H3 | StdInChIKey = AMJPIGOYWBNJLP-UHFFFAOYSA-N }}

'''Pirandamine''' ('''AY-23,713''') is a tricyclic derivative which acts as a selective serotonin reuptake inhibitor (SSRI).<ref name="pmid1085452">{{cite journal | vauthors = Pugsley T, Lippmann W | title = Effects of tandamine and pirandamine, new potential antidepressants, on the brain uptake of norepinephrine and 5-hydroxytryptamine and related activities | journal = Psychopharmacology | volume = 47 | issue = 1 | pages = 33–41 |date=May 1976 | pmid = 1085452 | doi = 10.1007/BF00428698| s2cid = 8354739 }}</ref><ref name="pmid1088377">{{cite journal | vauthors = Lippmann W, Pugsley TA | title = Pirandamine, a relatively selective 5-hydroxytryptamine uptake inhibitor | journal = Pharmacological Research Communications | volume = 8 | issue = 4 | pages = 387–405 |date=August 1976 | pmid = 1088377 | doi = 10.1016/0031-6989(76)90039-4}}</ref><ref name="pmid853871">{{cite journal | vauthors = Lippmann W, Seethaler K | title = Effects of tandamine and pirandamine, selective blockers of biogenic amine uptake mechanisms, on gastric acid secretion and ulcer formation in the rat | journal = Life Sciences | volume = 20 | issue = 8 | pages = 1393–400 |date=April 1977 | pmid = 853871 | doi = 10.1016/0024-3205(77)90367-8}}</ref> It was investigated in the 1970s as a potential antidepressant but clinical development was not commenced and it was never marketed.<ref name="pmid1085452" /> Pirandamine is structurally related to tandamine, which, in contrast, is a selective norepinephrine reuptake inhibitor.<ref name="pmid1085452" /><ref name="pmid853871" />

==Synthesis== Pirandamine can be synthesized starting from 1-indanone.<ref>I. Jirkovsky, L. G. Humber and R. Noureldin,Eur. J. Med. Chem., 11, 571 (1976).</ref> The Reformatsky reaction between 1-indanone ('''1''') and ethyl bromoacetate in the presence of zinc gives ethyl 2-(1-hydroxy-2,3-dihydroinden-1-yl)acetate ('''2'''). The reduction of the ester with ester with lithium aluminum hydride (LiAlH<sub>4</sub>) gives 1-(2-hydroxyethyl)-2,3-dihydroinden-1-ol ('''3'''). Acid-catalyzed dehydration then leads to indene-3-ethanol ('''4'''). Acid-catalyzed condensation with ethyl acetoacetate then gives ('''5'''). The saponification of the ester then gives the corresponding acid. The reaction of this with ethyl chloroformate gives a mixed anhydride, and further reaction of this with dimethylamine then leads to the amide ('''6'''). Reduction with lithium aluminium hydride completes the synthesis of pirandamine ('''7'''). class=skin-invert-image|thumb|center|500px|Pirandamine synthesis

== See also == * Tandamine

== References == {{Reflist|2}}

{{Antidepressants}} {{Anxiolytics}} {{Monoamine reuptake inhibitors}} {{Tricyclics}}

Category:Dihydropyrans