{{Short description|Chemical compound}} {{Drugbox | verifiedrevid = 448239290 | IUPAC_name = 2-(9-ethyl-1-methyl-3,4-dihydrothiopyrano[3,4-b]indol-1-yl)-''N'',''N''-dimethylethanamine | image = Tandamine.svg | image_class = skin-invert-image
<!--Clinical data--> | tradename = | pregnancy_category = | legal_status = | routes_of_administration =
<!--Pharmacokinetic data--> | bioavailability = | metabolism = | elimination_half-life = | excretion =
<!--Identifiers--> | index2_label = HCl | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 42408-80-0 | CAS_number2_Ref = {{cascite|correct|CAS}} | CAS_number2 = 58167-78-5 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 6L5FH5A43E | UNII2_Ref = {{fdacite|correct|FDA}} | UNII2 = 7516K9UGUG | ATC_prefix = none | ATC_suffix = | PubChem = 39187 | ChemSpiderID = 35851
<!--Chemical data--> | C=18 | H=26 | N=2 | S=1 | smiles = CCn3c1ccccc1c2CCSC(C)(CCN(C)C)c23 | StdInChI = 1S/C18H26N2S/c1-5-20-16-9-7-6-8-14(16)15-10-13-21-18(2,17(15)20)11-12-19(3)4/h6-9H,5,10-13H2,1-4H3 | StdInChIKey = BRPOADLGOFPKKJ-UHFFFAOYSA-N }}
'''Tandamine''' is a selective norepinephrine reuptake inhibitor with a tricyclic structure.<ref name="pmid1084746">{{cite journal | vauthors = Lippmann W, Pugsley TA | title = The effects of tandamine, a new potential antidepressant agent, on biogenic amine uptake mechanisms and related activities | journal = Biochemical Pharmacology | volume = 25 | issue = 10 | pages = 1179–1186 | date = May 1976 | pmid = 1084746 | doi = 10.1016/0006-2952(76)90366-X }}</ref><ref name="pmid403562">{{cite journal | vauthors = Ehsanullah RS, Ghose K, Kirby MJ, Turner P, Witts D | title = Clinical pharmacological studies of tandamine, a potential antidepressive drug | journal = Psychopharmacology | volume = 52 | issue = 1 | pages = 73–77 | date = March 1977 | pmid = 403562 | doi = 10.1007/BF00426603 | s2cid = 23960347 }}</ref><ref name="pmid503251">{{cite journal | vauthors = Pugsley TA, Lippmann W | title = Effect of acute and chronic treatment of tandamine, a new heterocyclic antidepressant, on biogenic amine metabolism and related activities | journal = Naunyn-Schmiedeberg's Archives of Pharmacology | volume = 308 | issue = 3 | pages = 239–247 | date = September 1979 | pmid = 503251 | doi = 10.1007/BF00501388 | s2cid = 23533861 }}</ref> It was developed in the 1970s as an antidepressant but was never commercialized.<ref name="pmid1084746" /><ref name="pmid403562" /><ref name="pmid503251" /> Tandamine is analogous to pirandamine, which, instead, acts as a selective serotonin reuptake inhibitor (SSRI).<ref name="pmid1085452">{{cite journal | vauthors = Pugsley T, Lippmann W | title = Effects of tandamine and pirandamine, new potential antidepressants, on the brain uptake of norepinephrine and 5-hydroxytryptamine and related activities | journal = Psychopharmacology | volume = 47 | issue = 1 | pages = 33–41 | date = May 1976 | pmid = 1085452 | doi = 10.1007/BF00428698 | s2cid = 8354739 }}</ref><ref name="pmid853871">{{cite journal | vauthors = Lippmann W, Seethaler K | title = Effects of tandamine and pirandamine, selective blockers of biogenic amine uptake mechanisms, on gastric acid secretion and ulcer formation in the rat | journal = Life Sciences | volume = 20 | issue = 8 | pages = 1393–1400 | date = April 1977 | pmid = 853871 | doi = 10.1016/0024-3205(77)90367-8 }}</ref>
The exact identical same structure, although this time changing the thioether to a methylene group revealed a strongest compound of the series called '''AY 24614'''.<ref name="AsselinHumber2002">{{cite journal | vauthors = Asselin AA, Humber LG, Komlossy J | title = Cycloalkanoindoles. 2. 1-Alkyl-1,2,3,4-tetrahydrocarbazole-1-ethanamines and related compounds. Potential antidepressants | journal = Journal of Medicinal Chemistry | volume = 19 | issue = 6 | pages = 792–797 | date = June 1976 | pmid = 950648 | doi = 10.1021/jm00228a011 }}</ref> == See also == * Pirandamine
== References == {{Reflist|2}}
{{Stimulants}} {{Antidepressants}} {{Monoamine reuptake inhibitors}} {{Tricyclics}}
Category:Norepinephrine reuptake inhibitors
{{nervous-system-drug-stub}}