{{Chembox | ImageFile = Plicatol C.svg | ImageAlt = Chemical structure of plicatol C | IUPACName = | OtherNames = 2,5,9-Trihydroxy-4-methoxy-9,10-dihydrophenanthrene |Section1={{Chembox Identifiers | CASNo = 278608-08-5 | CASNo_Ref = {{Cascite|correct|CAS}} | ChemSpiderID = 72867480 | PubChem = 53814710 | StdInChI=1S/C15H14O4/c1-19-13-7-9(16)5-8-6-12(18)10-3-2-4-11(17)15(10)14(8)13/h2-5,7,12,16-18H,6H2,1H3 | StdInChIKey = FRNDIOQCIXBSFC-UHFFFAOYSA-N | SMILES = OC3Cc2cc(O)cc(OC)c2-c1c3cccc1O }} |Section2={{Chembox Properties | C=15 | H=14 | O=4 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }} '''Plicatol C''' is one of the three phenanthrenes that can be isolated from the stems of the orchid ''Dendrobium plicatile''.<ref>Phenanthrenes from Dendrobium plicatile. Chie Honda and Masae Yamaki, Phytochemistry, April 2000, Volume 53, Issue 8, Pages 987–990, {{doi|10.1016/S0031-9422(99)00497-5}}</ref>

== See also == * Plicatol A * Plicatol B

== References == {{reflist}}

== External links == * [https://web.archive.org/web/20170116161934/http://kanaya.naist.jp/knapsack_jsp/information.jsp?word=C00034158 Plicatol C at kanaya.naist.jp/knapsack_jsp]

{{Phenanthrenes}}

Category:Phenanthrenoids Category:Dendrobium Category:Triols Category:Methoxy compounds

{{aromatic-stub}}