{{Chembox | ImageFile = Plicatol B.svg | ImageAlt = Chemical structure of plicatol B | PIN = 4-Methoxyphenanthrene-2,5-diol | OtherNames = Moscatin<br>2,5-Dihydroxy-4-methoxyphenanthrene |Section1={{Chembox Identifiers | CASNo = 108335-06-4 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = FUC1N75GST | PubChem = 194774 | ChemSpiderID = 168975 | InChI = 1/C15H12O3/c1-18-13-8-11(16)7-10-6-5-9-3-2-4-12(17)14(9)15(10)13/h2-8,16-17H,1H3 | InChIKey = LVOCAIKGDCMNNK-UHFFFAOYAI | StdInChI = 1S/C15H12O3/c1-18-13-8-11(16)7-10-6-5-9-3-2-4-12(17)14(9)15(10)13/h2-8,16-17H,1H3 | StdInChIKey = LVOCAIKGDCMNNK-UHFFFAOYSA-N | SMILES = c2ccc(O)c1c2ccc3c1c(OC)cc(O)c3 }} |Section2={{Chembox Properties | C=15 | H=12 | O=3 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Plicatol B''' is one of the three phenanthrenes that can be isolated from the stems of the orchid ''Flickingeria fimbriata''.<ref>{{cite journal | doi = 10.1016/S0031-9422(99)00497-5 | volume=53 | title=Phenanthrenes from Dendrobium plicatile | year=2000 | journal=Phytochemistry | pages=987–990 | last1 = Honda | first1 = Chie}}</ref> It can also be isolated from ''Dendrobium densiflorum'', ''D. loddigesii'', ''D. moschatum'', ''D. rotundatum''<ref>{{Cite web |url=http://kanaya.naist.jp/knapsack_jsp/information.jsp?word=C00015897 |title=Plicatol B at kanaya.naist.jp/knapsack_jsp |access-date=2014-06-22 |archive-url=https://web.archive.org/web/20170116161935/http://kanaya.naist.jp/knapsack_jsp/information.jsp?word=C00015897 |archive-date=2017-01-16 |url-status=dead }}</ref> and ''Bulbophyllum kwangtungense''<ref>{{cite journal | pmid = 16981129 | doi=10.1055/s-2006-947200 | volume=72 | title=New dihydrodibenzoxepins from Bulbophyllum kwangtungense | year=2006 | journal=Planta Med | pages=1244–7 | last1 = Wu | first1 = B | last2 = He | first2 = S | last3 = Pan | first3 = YJ}}</ref>

== See also == * Plicatol A * Plicatol C

== References == {{reflist}}

{{Phenanthrenes}}

Category:Phenanthrenoids Category:Orchids

{{aromatic-stub}}