{{Short description|Chemical compound}} {{Drugbox | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 0135188AB | CAS_supplemental = <br />10286-45-0 ((−)-form (HCl)) | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 25Z262VU9E | IUPAC_name = <small>1,2,3,4,5,6-hexahydro-6,11-diethyl-3-methyl-2,6-methano-3-benzazocin-8-ol</small><br />or<br /><small>5,7-diethyl-2-hydroxy-2-methyl-6,7-benzomorphan</small> | image = etazocine structure.svg | image_class = skin-invert-image | image2 = Etazocine-3D-balls-by-AHRLS-2012.png | image_class2 = bg-transparent | ATC_prefix = None | ATC_suffix = | PubChem = 187767 | ChemSpiderID = 163214 | C = 17 | H = 25 | N = 1 | O = 1 | smiles = Oc1ccc3c(c1)[C@@]2([C@H]([C@@H](N(CC2)C)C3)CC)CC | synonyms = NIH-7856 ((±)-form);<br />GPA-208 ((−)-form);<br />GPA-2087 ((−)-form);<br />NIH-8178 ((−)-form);<br />FDA-0487 ((−)-form) | StdInChI = 1S/C17H25NO/c1-4-14-16-10-12-6-7-13(19)11-15(12)17(14,5-2)8-9-18(16)3/h6-7,11,14,16,19H,4-5,8-10H2,1-3H3/t14-,16-,17-/m0/s1 | StdInChIKey = JYRBQCWXZNDERM-XIRDDKMYSA-N | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_category = | legal_status = Non-regulated | routes_of_administration = }}
'''Etazocine''' ('''NIH-7856''') is an opioid analgesic of the benzomorphan family which was never marketed.<ref name="DependenceDependence1969">{{cite book |title = Bulletin, problems of drug dependence: Report of the Thirty-first Meeting, 24, 25, and 26 February, 1969, Palo Alto, California | url = https://books.google.com/books?id=BUcrAAAAYAAJ&pg=PA5820 | accessdate = 22 April 2012 | date = 1969 | publisher =The National Academies Press | pages = 5820–5821 | id=NAP:10503}}</ref><ref name="pmid5156297">{{cite journal |vauthors=Smethurst PW, Forrest WH, Hayden J | title = The respiratory effects of a potent analgesic (GPA 2087) in man | journal = British Journal of Anaesthesia | volume = 43 | issue = 12 | pages = 1129–35 |date=December 1971 | pmid = 5156297 | doi = 10.1093/bja/43.12.1129| doi-access = free }}</ref> It acts as a partial agonist of the opioid receptors, with mixed agonist and antagonist effects.<ref name="DependenceDependence1969" /> In animal studies, it was shown to induce analgesia, dependency, and respiratory depression, with overall effects similar to those of morphine, but with substantially reduced potency in comparison.<ref name="DependenceDependence1969" /><ref name="pmid5156297" /><ref name="Dependence1970">{{cite book | author = National Research Council (U.S.). Committee on Problems of Drug Dependence | title = Report of the annual scientific meeting | url = https://books.google.com/books?id=uN9rAAAAMAAJ | accessdate = 22 April 2012 | year = 1970 | publisher = National Research Council}}</ref>
== See also == * Benzomorphan
== References == {{Reflist}}
{{Analgesics}} {{Opioidergics}}
Category:Hydroxyarenes Category:Benzomorphans Category:Opioids