Color Developing Agent 4

{{Chembox |ImageFile=Image:CD-4.svg |IUPACName = 2-(4-amino-N-ethyl-3-methylanilino)ethanol;sulfuric acid |Section1={{Chembox Identifiers | PubChem = 91579 | CASNo = 25646-77-9 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = BS668SJ6PT | EC_number = 247-162-0 | ChemSpiderID = 82690 | StdInChI=1S/C11H18N2O.H2O4S/c1-3-13(6-7-14)10-4-5-11(12)9(2)8-10;1-5(2,3)4/h4-5,8,14H,3,6-7,12H2,1-2H3;(H2,1,2,3,4) | StdInChIKey = GVEYRUKUJCHJSR-UHFFFAOYSA-N | SMILES = CCN(CCO)C1=CC(=C(C=C1)N)C.OS(=O)(=O)O }} |Section2={{Chembox Properties |C=11|H=20|N=2|O=5|S=1 }} |Section7={{Chembox Hazards | GHSPictograms = {{GHS06}}{{GHS07}}{{GHS08}}{{GHS09}} | GHSSignalWord = Danger | HPhrases = {{H-phrases|301|317|373|410}} | PPhrases = {{P-phrases|260|261|264|270|272|273|280|301+310|302+352|314|321|330|333+313|363|391|405|501}} }} |Section8={{Chembox Related |OtherCompounds=Color Developing Agent 1; Color Developing Agent 2; Color Developing Agent 3 }} }} The fourth in the series of color developing agents used in developing color films, commonly known as CD-4, is chemically known as 4-(N-Ethyl-N-2-hydroxyethyl)-2-methylphenylenediamine sulfate.<ref name="CD4"/> In color development, after reducing a silver atom in a silver halide crystal, the oxidized developing agent combines with a color coupler to form a color dye molecule.

==References== <references>

<ref name="CD4">{{cite web | title = Ethanol, 2-((4-amino-3-methylphenyl)ethylamino)-, sulfate (1:1) (salt) | url = https://pubchem.ncbi.nlm.nih.gov/compound/25646-77-9 | website = U.S. National Center for Biotechnology Information | accessdate = 7 April 2019}}</ref>

</references>

Category:Photographic chemicals Category:Anilines