{{Chembox | Name=''N'',''N''-Diethyl-''o''-toluidine | OtherNames= | ImageFile=Image:CD-2.svg | ImageCaption=CD-2 hydrochloride | IUPACName = 4-''N'',4-''N''-diethyl-2-methylbenzene-1,4-diamine |Section1={{Chembox Identifiers | index_label=base | index1_label=hydrochloride | PubChem = 67364 | PubChem1 = 74920 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | CASNo1_Ref = {{cascite|correct|CAS}} | UNII1_Ref = {{fdacite|correct|FDA}} | CASNo = 148-71-0 | CASNo1 = 2051-79-8 | EINECS = 205-722-1 | EC_number1 = 218-130-3 | ChemSpiderID = 60694 | ChemSpiderID1 = 67481 | DTXSID = DTXSID7043879 | ChEMBL = 2094307 | UNII = A640ZQ81DV | UNII1 = 39MIH70E0I | InChI=1S/C11H18N2/c1-4-13(5-2)10-6-7-11(12)9(3)8-10/h6-8H,4-5,12H2,1-3H3 | InChIKey = XBTWVJKPQPQTDW-UHFFFAOYSA-N | SMILES = CCN(CC)C1=CC(=C(C=C1)N)C | InChI1=1S/C11H18N2.ClH/c1-4-13(5-2)10-6-7-11(12)9(3)8-10;/h6-8H,4-5,12H2,1-3H3;1H | InChIKey1 = MPLZNPZPPXERDA-UHFFFAOYSA-N | SMILES1 = CC[NH+](CC)C1=CC(=C(C=C1)N)C.[Cl-] }} |Section2={{Chembox Properties |C=11|H=18|N=2 }} |Section7={{Chembox Hazards | GHSPictograms = {{GHS06}}{{GHS07}} | GHSSignalWord = Danger | HPhrases = {{H-phrases|301|311|312|315|317|319|331|413}} | PPhrases = {{P-phrases|261|264|270|271|272|273|280|301+310|302+352|304+340|311|312|321|322|330|333+313|361|363|403+233|405|501}} }} |Section8={{Chembox Related |OtherCompounds=Color Developing Agent 1; Color Developing Agent 3; Color Developing Agent 4 }} }}

'''Color Developing Agent 2''' is the second in the series of color developing agents used in developing color films. It is commonly known as '''CD-2''' and is chemically known as '''4-diethylamino-''o''-toluidine''', '''1,4-benzenediamine, N4,N4-diethyl-2-methyl-''', '''N1,N1-diethyl-3-methylbenzene-1,4-diamine''', or '''4-(diethylamino)-2-methylaniline'''.<ref name="CD2"/> In color development, after reducing a silver atom in a silver halide crystal, the oxidized developing agent combines with a color coupler to form a color dye molecule.

==See also== * Color Developing Agent 1 * Color Developing Agent 3 * Color Developing Agent 4

==References== <references>

<ref name="CD2">{{cite web | title = 1,4-Benzenediamine, N4,N4-diethyl-2-methyl- | url = https://pubchem.ncbi.nlm.nih.gov/compound/67364 | website = U.S. National Center for Biotechnology Information | access-date =20 January 2020}}</ref>

</references>

Category:Photographic chemicals Category:Anilines

{{organic-compound-stub}}