{{Short description|Chemical compound}} {{Drugbox | IUPAC_name = 10-(3-butyn-1-yl)-13,13-dimethyl-10-azatricyclo[7.3.1.0<sup>2,7</sup>]trideca-2,4,6-triene-1,4-diol | image = Butinazocine structure.svg | image_class = skin-invert-image | CAS_number = 93821-75-1 | CAS_supplemental = <br />79810-24-5 (hydrochloride) | UNII_Ref = {{fdacite|correct|FDA}} | UNII = W11ET455ZI | ATC_prefix = None | ATC_suffix = | PubChem = 189903 | ChEMBL = 2106183 | ChemSpiderID = 164930 | C = 18 | H = 23 | N = 1 | O = 2 | smiles = OC1=CC=C2C([C@]3(C(C)(C)[C@@H](C2)N(CC3)CCC#C)O)=C1 | StdInChI = 1S/C18H23NO2/c1-4-5-9-19-10-8-18(21)15-12-14(20)7-6-13(15)11-16(19)17(18,2)3/h1,6-7,12,16,20-21H,5,8-11H2,2-3H3 | StdInChIKey = YEFFVIUQXXNVGG-UHFFFAOYSA-N | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion = | pregnancy_category = | legal_status = | routes_of_administration = }}
'''Butinazocine''' (INN) is an opioid analgesic of the benzomorphan family which was never marketed.<ref name="Macdonald1997">{{cite book | vauthors = Macdonald F | title = Dictionary of Pharmacological Agents | url = https://books.google.com/books?id=DeX7jgInYFMC&pg=PA340 | accessdate = 22 April 2012 | year = 1997 | publisher = CRC Press | isbn = 978-0-412-46630-4 | pages = 340–341}}</ref>
== See also == * Benzomorphan
== References == {{Reflist}}
{{Analgesics}} {{Opioidergics}}
Category:Benzomorphans Category:Opioids