{{Short description|Chemical compound}} {{Drugbox | IUPAC_name = 1-(4-Chlorophenyl)-2-(1-pyrrolidinyl)-1-pentanone | image = 4-Chloro-alpha-pyrrolidinovalerophenone.svg | image_class = skin-invert-image | image2 = 4c-pvp3d.png | image_class2 = bg-transparent | drug_name = 4-Chloro-α-pyrrolidinovalerophenone

<!--Clinical data--> | tradename = | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X / N --> | pregnancy_category = | legal_BR = F2 | legal_CA = Schedule I | legal_DE = NpSG | legal_UK = Class B | legal_US = Schedule I | routes_of_administration = Oral, intranasal, intravenous, rectal,

<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

<!--Identifiers--> | CAS_number = 5881-77-6 | CAS_number_Ref = {{cascite|correct|??}} | CAS_supplemental= 5537-17-7 (HCl) | ATC_prefix = | ATC_suffix = | PubChem = 69245309 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 52085629 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = | UNII_Ref = {{fdacite|correct|FDA}} | UNII = DX2R2SJT7G

<!--Chemical data--> | C=15 | H=20 | N=1 | O=1 | Cl=1 | smiles = CCCC(C(=O)c1ccc(cc1)Cl)N2CCCC2 | StdInChI = 1S/C15H20ClNO/c1-2-5-14(17-10-3-4-11-17)15(18)12-6-8-13(16)9-7-12/h6-9,14H,2-5,10-11H2,1H3 | StdInChIKey = NIGBFBTVONRYQN-UHFFFAOYSA-N

}}

'''4-Chloro-α-pyrrolidinovalerophenone''' (also known as '''4-chloro-α-pyrrolidinopentiophenone''', '''4-chloro-α-PVP''', '''4Cl-PVP''', or '''4C-PVP''') is an emerging recreational designer drug of the pyrrolidinophenone class, similar in structure to α-pyrrolidinopentiophenone (α-PVP).<ref name="pmid33511100">{{cite journal | vauthors = Lopes BT, Caldeira MJ, Gaspar H, Antunes AM | title = Metabolic Profile of Four Selected Cathinones in Microsome Incubations: Identification of Phase I and II Metabolites by Liquid Chromatography High Resolution Mass Spectrometry | journal = Frontiers in Chemistry | volume = 8 | issue = | article-number = 609251 | date = 2020 | pmid = 33511100 | pmc = 7835677 | doi = 10.3389/fchem.2020.609251 | doi-access = free }}</ref> The pharmacology and toxicity of this compound is unknown, though it is presumed to be a stimulant drug.

In the United States, 4-chloro-α-PVP is a Schedule I Controlled Substance.<ref>{{cite web | title = Schedules of Controlled Substances: Temporary Placement of N-Ethylhexedrone, α-PHP, 4-MEAP, MPHP, PV8, and 4-Chloro-α-PVP in Schedule I | url = https://www.deadiversion.usdoj.gov/fed_regs/rules/2019/fr0501.htm | publisher = Drug Enforcement Administration | access-date = 2019-07-29 | archive-date = 2021-04-30 | archive-url = https://web.archive.org/web/20210430020931/https://www.deadiversion.usdoj.gov/fed_regs/rules/2019/fr0501.htm | url-status = live }}</ref>

==See also== * 3F-PVP * 4-Chloromethcathinone * 4-Cl-PHP * 4F-PVP * 4-Et-PVP * MFPVP * MOPVP * DMPVP * MDPV * O-2390 * Pyrovalerone * RTI-31

==References== {{Reflist}}

{{Stimulants}} {{Phenethylamines}}

Category:Alpha-Propylphenethylamines Category:Pyrrolidinophenones Category:Designer drugs Category:Serotonin-norepinephrine-dopamine releasing agents Category:Propyl compounds Category:4-Chlorophenyl compounds

{{DEFAULTSORT:Chloro-α-pyrrolidinovalerophenone, 4-}}