{{Short description|Designer drug}} {{drugbox | drug_name = MFPVP | image = 3-Methyl-4F-PVP.svg | image_class = skin-invert-image | legal_CA = Schedule I | legal_DE = NpSG | legal_UK = Class B | C = 16 | H = 22 | F = 1 | N = 1 | O = 1 | IUPAC_name = 1-(3-methyl-4-fluorophenyl)-2-(pyrrolidin-1-yl)pentan-1-one | CAS_number_Ref = {{cascite|correct|CAS}} | CAS_number = 1283478-02-3 | ChemSpiderID = 107440848 | PubChem = 163195978 | smiles = CCCC(C(=O)c1ccc(F)c(C)c1)N1CCCC1 | StdInChI = 1S/C16H22FNO/c1-3-6-15(18-9-4-5-10-18)16(19)13-7-8-14(17)12(2)11-13/h7-8,11,15H,3-6,9-10H2,1-2H3 | StdInChIKey = LFTWWOQOBQFPAT-UHFFFAOYSA-N }}
'''MFPVP''' ('''3-Methyl-4-fluoro-α-pyrrolidinovalerophenone''') is a psychoactive agent from the substituted cathinone family, with stimulant effects. It was first identified in Sweden in April 2020 and was among the most widely encountered substituted cathinone derivatives in 2021, though it since appears to have declined in prevalence.<ref>{{cite book | url = https://www.emcdda.europa.eu/system/files/publications/13464/20205648_TD0320796ENN_PDF_rev.pdf | title = New psychoactive substances: global markets, glocal threats and the COVID-19 pandemic. An update from the EU Early Warning System | author = European Monitoring Center for Drugs and Drug Addiction | location = Luxembourg | publisher = Publications Office of the European Union | date = December 2020 | doi = 10.2810/921262| isbn = 9789294975584 }}</ref><ref name="pmid35020879">{{cite journal | vauthors = Hobbs JM, DeRienz RT, Baker DD, Shuttleworth MR, Pandey M | title = Fatal Intoxication by the Novel Cathinone 4-Fluoro-3-methyl-α-PVP | journal = Journal of Analytical Toxicology | volume = 46 | issue = 3 | pages = e101–e104 | date = March 2022 | pmid = 35020879 | doi = 10.1093/jat/bkac003 }}</ref><ref name="pmid36124107">{{cite journal | vauthors = Kuropka P, Zawadzki M, Szpot P | title = A review of synthetic cathinones emerging in recent years (2019-2022) | journal = Forensic Toxicology | volume = 41 | issue = 1 | pages = 25–46 | date = 2023 | pmid = 36124107 | pmc = 9476408 | doi = 10.1007/s11419-022-00639-5 }}</ref> It is illegal in Virginia.<ref>[https://law.lis.virginia.gov/vacode/title54.1/chapter34/section54.1-3446/ Code of Virginia 54.1-3446.]</ref>
== See also == * 3F-PVP * 4F-PVP * 4F-PHP * 4Cl-PVP * 4-Cl-3-MMC * MOPVP * DMPVP * MDPV * O-2390 * Pyrovalerone
== References == {{reflist}}
{{Stimulants}} {{Phenethylamines}}
Category:Alpha-Propylphenethylamines Category:Pyrrolidinophenones Category:Designer drugs
{{nervous-system-drug-stub}}