{{Short description|Stimulant designer drug of the substituted cathinone class}} {{cs1 config|name-list-style=vanc}} {{Drugbox | IUPAC_name = 1-(2-methylphenyl)-2-pyrrolidin-1-ylpentan-1-one | image = 2Me-PVP_structure.png | image_class = skin-invert-image | width = 200px

<!--Clinical data--> | tradename = | routes_of_administration = | legal_UK = Class B | legal_DE = Anlage II

<!--Identifiers--> | CAS_number = 850352-54-4

| UNII_Ref = {{fdacite|changed|FDA}} | UNII = DRY2E23E56

| PubChem = 11311147 | ChemSpiderID = 9486115

<!--Chemical data--> | C=16 | H=23 | N=1 | O=1 | StdInChI=1S/C16H23NO/c1-3-8-15(17-11-6-7-12-17)16(18)14-10-5-4-9-13(14)2/h4-5,9-10,15H,3,6-8,11-12H2,1-2H3 | StdInChIKey = VVIVTDYOMWHKAE-UHFFFAOYSA-N | SMILES = CCCC(C(=O)C1=CC=CC=C1C)N2CCCC2 }}

'''2-Methyl-alpha-PVP''' ('''2-Me-PVP''') is a substituted cathinone derivative with stimulant effects which has been sold as a designer drug. It was first identified in Sweden in 2021.<ref>{{cite book | url = https://www.emcdda.europa.eu/system/files/publications/14637/20222218_PDF_TD0522113ENN_002.pdf | title = New psychoactive substances: 25 years of early warning and response in Europe. An update from the EU Early Warning System | publisher = European Monitoring Centre for Drugs and Drug Addiction | date = June 2022 | isbn = 978-92-9497-737-3 | doi = 10.2810/396103 | author1 =European Monitoring Centre for Drugs and Drug Addiction.}}</ref><ref>{{cite journal | vauthors = Kuropka P, Zawadzki M, Szpot P | title = A review of synthetic cathinones emerging in recent years (2019-2022) | journal = Forensic Toxicology | pages = 25–46 | date = September 2022 | volume = 41 | issue = 1 | doi = 10.1007/s11419-022-00639-5 | pmid = 36124107 | pmc = 9476408 }}</ref>

== See also == * 2-Methylmethcathinone * 3F-PVP * 3-Me-PVP * 4-Cl-PVP * 4-Et-PVP * Ortetamine

== References == {{reflist}}

{{Stimulants}} {{Phenethylamines}}

Category:Alpha-Propylphenethylamines Category:Cathinones Category:Designer drugs Category:Norepinephrine-dopamine releasing agents Category:Pyrrolidinophenones {{psychoactive-stub}}