{{Chembox | ImageFile = Xylindein.svg | ImageSize = | ImageAlt = | ImageCaption = | ImageFile1 = Xylindein-3D.png | ImageSize1 = | ImageAlt1 = | ImageCaption1 = | PIN = (3''S'',11''S'')-8,16-Dihydroxy-3,11-dipropyl-3,4,11,12-tetrahydro-1''H'',7''H''-pyrano[4,3-''h'']pyrano[4′,3′:5,6]xantheno[2,1,9,8-''klmna'']xanthene-1,7,9,15-tetrone | OtherNames = Xylindene<br>(3''S'',11''S'')-3,4,11,12-Tetrahydro-8,16-dihydroxy-3,11-dipropyl-1''H'',7''H''-dipyrano[4,3-a:4',3'-j]-peri-xanthenoxanthene-1,7,9,15-tetrone<br><br>peri-xanthenoxanthene-2,8-dicarboxy-lic acid 4,10-dihydro-3,9-dihydroxy-1,7-bis(2 ''S''-hydroxy-pentyl)-4,10-dioxo-di δ-lactone |Section1={{Chembox Identifiers | InChI = 1S/C32H24O10/c1-3-5-11-7-13-19(31(37)39-11)27(35)21-15(33)10-18-23-24-17(41-29(13)25(21)23)9-16(34)22-26(24)30(42-18)14-8-12(6-4-2)40-32(38)20(14)28(22)36/h9-12,35-36H,3-8H2,1-2H3/t11-,12-/m0/s1 | SMILES = CCC[C@@H](C0)OC(=O)c(c1O)c0c2Oc3cC(=O)c4c5c3c6c2c1C(=O)cc6Oc5c7c(c4O)C(=O)O[C@H](C7)CCC | InChIKey = BZFKYROURDRMSO-RYUDHWBXSA-N | PubChem = 101293600 | ChemSpiderID = 23078574 | CASNo = 3779-11-1 }} |Section2={{Chembox Properties | C=32 | H=24 | O=10 | Appearance = | Density = | MeltingPt = | BoilingPtK = | LogP = | HenryConstant = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Xylindein''' is a quinone pigment, a dimeric naphthoquinone derivative. It is produced by fungi in the genus ''Chlorociboria''. This pigment causes green staining of wood infected by the fungi.

==Etymology==

This pigment was first extracted in 1868 by Paul Thénard from wood. It resembled indigo, so he called it {{lang|fr|xylindéine}}, from the combination of ''xyl-'' (wood) and ''indé'' (indigo) + ''-ine''.<ref>[http://www.merriam-webster.com/dictionary/xylindein Xylindein at Merriam-Webster dictionary]</ref><ref>{{cite journal|last=Thenard|first=Paul|author2=Alphonse Rommier |title=Sur un nouvelle matière colorante appelée xylindeine et extraite de certains bois morts|journal=Comptes rendus hebdomadaires des séances de l'Académie des Sciences|year=1868|volume=66|pages=108–109|place=Paris|issn=0001-4036|language=french|url=http://gallica.bnf.fr/ark:/12148/bpt6k30232/f110.image}}</ref>

== References == <references/> *{{Cite journal | last1 = Saikawa | first1 = Yoko | last2 = Watanabe | first2 = Takashi | last3 = Hashimoto | first3 = Kimiko | last4 = Nakata | first4 = Masaya | date=October 2000 | title = Absolute configuration and tautomeric structure of xylindein, a blue-green pigment of Chlorociboria species | publisher = Elsevier | journal = Phytochemistry | pages = 237–240 | volume = 55 | doi = 10.1016/S0031-9422(00)00282-X | pmid = 11142849 | issue = 3 | bibcode = 2000PChem..55..237S }} *{{Cite journal | last1 = Donner | first1 = Christopher | last2 = Cuzzupe | first2 = Anthony | last3 = Falzon | first3 = Cheryl | last4 = Gill | first4 = Melvyn | date=April 2012 | title = Investigations towards the synthesis of xylindein, a blue-green pigment from the fungus Chlorociboria aeruginosa | publisher = Elsevier | pages = 2799–2805 | journal = Tetrahedron | volume = 68 | doi= 10.1016/j.tet.2012.02.009 | issue = 13 }} *{{Cite journal | last1 = Robinson | first1 = Sara | last2 = Tudor | first2 = Daniela | last3 = Snider | first3 = Hilary | last4 = Cooper | first4 = Paul | date=March 2012 | title = Stimulating growth and xylindein production of Chlorociboria aeruginascens in agar-based systems | journal = AMB Express | publisher = Springer | volume = 2 | doi= 10.1186/2191-0855-2-15 | pmid = 22409931 | pmc = 3350399 | pages = 15 | doi-access = free }} *{{Cite journal|last1=Ostroverkhova|first1=Oksana|last2=Robinson|first2=Sara|last3=Gutierrez|first3=Sarath Vega|last4=Schenck|first4=Jonathan Van|last5=Giesbers|first5=Gregory|date=2018|title=Fungi-Derived Pigments for Sustainable Organic (Opto)Electronics|journal=MRS Advances|language=en|volume=3|issue=59|pages=3459–3464|doi=10.1557/adv.2018.446|s2cid=53646580 |issn=2059-8521}}

== External links == * {{Commonscat-inline|Xylindein}}

Category:Fungal pigments Category:Heterocyclic compounds with 7 or more rings Category:Natural phenol dimers Category:Dihydroisocoumarins Category:Pyrans Category:Hydroxyarenes Category:3-Hydroxypropenals within hydroxyquinones Category:Polyenes Category:Naphthoquinones