{{Short description|Organic compound derived from xanthone reduction}} {{chembox | Watchedfields = changed | verifiedrevid = 430036884 | ImageFile = Xanthydrol.svg | ImageAlt = Skeletal formula | ImageFile1 = Xanthydrol-3D-balls.png | ImageAlt1 = Ball-and-stick model | PIN = 9''H''-Xanthen-9-ol | OtherNames = Xanthanol, 9-Hydroxyxanthene, 9-Xanthydrol, Xanthen-9-ol, 9-Xanthenol, Xanthydrol solution |Section1={{Chembox Identifiers | Abbreviations = | CASNo = 90-46-0 | CASNo_Ref = {{cascite|correct|??}} | Beilstein = 10395 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 65693 | EC_number = 201-996-1 | PubChem = 72861 | RTECS = | MeSHName = | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 7131M69IKF | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = JFRMYMMIJXLMBB-UHFFFAOYSA-N | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI=1S/C13H10O2/c14-13-9-5-1-3-7-11(9)15-12-8-4-2-6-10(12)13/h1-8,13-14H | SMILES = O2C1=C(C=CC=C1)C(C3=C2C=CC=C3)O }} |Section2={{Chembox Properties | Formula = | C=13 | H=10 | O=2 | MolarMass = | Appearance = | Density = | MeltingPtC = 124 to 126 | MeltingPt_ref = <ref>{{cite journal | author = Goldberg; Wragg | year = 1957 | journal = Journal of the Chemical Society | pages = 4823–4829 | doi = 10.1039/JR9570004823 | title = 972. Spasmolytics derived from xanthen }} </ref> | BoilingPt = | BoilingPt_notes = | Solubility = | SolubleOther = | Solvent = | pKa = | pKb = }} |Section6={{Chembox Pharmacology | ATCCode_prefix = | ATCCode_suffix = | ATC_Supplemental = }} |Section7={{Chembox Hazards | MainHazards = | NFPA-H = | NFPA-F = | NFPA-R = | NFPA-S = | Hazards_ref=<ref>{{cite web |title=9H-Xanthen-9-ol |url=https://pubchem.ncbi.nlm.nih.gov/compound/72861#section=Safety-and-Hazards |website=pubchem.ncbi.nlm.nih.gov |language=en}}</ref> | GHSPictograms = {{GHS07}}{{GHS09}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|302|315|319|335|411}} | PPhrases = {{P-phrases|261|264|270|271|273|280|301+312|302+352|304+340|305+351+338|312|321|330|332+313|337+313|362|391|403+233|405|501}} | FlashPt = | AutoignitionPt = | ExploLimits = | PEL = }} }}
'''Xanthydrol''' is an organic chemical compound. Its formula is C<sub>13</sub>H<sub>10</sub>O<sub>2</sub>. Its total molecular weight is 198.221 g/mol. Xanthydrol is used to test the levels of urea in the bloodstream.<ref>{{cite journal | doi = 10.1111/j.1748-5827.1962.tb04191.x| title = The Estimation of Blood Urea by the Xanthydrol Reaction| journal = Journal of Small Animal Practice| volume = 3| issue = 4| pages = 217–218| year = 1962| last1 = Bowden| first1 = R. S. T.}}</ref> Xanthidrol/acetonitrile solution is used for the simultaneous extraction and derivatisation of ethyl carbamate.<ref>{{cite journal | doi = 10.1039/C4AY02075H| title = Determination of ethyl carbamate in spirits using salting-out assisted liquid–liquid extraction and high performance liquid chromatography with fluorimetric detection| journal = Analytical Methods| volume = 6| pages = 9136–9141| year = 2014}}</ref>
==Synthesis== Xanthydrol can be produced by the reduction of xanthone.
==See also== *Xanthene *Xanthone
==References== {{reflist}}
Category:Secondary alcohols Category:Xanthenes
{{alcohol-stub}}