{{Short description|Chemical compound}} {{Use dmy dates|date=September 2024}} {{cs1 config |name-list-style=vanc |display-authors=6}} {{Infobox drug | Verifiedfields = changed | verifiedrevid = 470630841 | image = viomycin.svg | image_class = skin-invert-image | width = | alt = | caption =
<!-- Clinical data --> | pronounce = | tradename = | Drugs.com = | MedlinePlus = | DailyMedID = <!-- DailyMed may use generic or brand name (generic name preferred) --> | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_AU_comment = | pregnancy_category = | routes_of_administration = Intramuscular injection | class = Aminoglycoside | ATC_prefix = None | ATC_suffix = | ATC_supplemental =
<!-- Legal status --> | legal_AU = <!-- S2, S3, S4, S5, S6, S7, S8, S9 or Unscheduled --> | legal_AU_comment = | legal_BR = <!-- OTC, A1, A2, A3, B1, B2, C1, C2, C3, C4, C5, D1, D2, E, F --> | legal_BR_comment = | legal_CA = <!-- OTC, Rx-only, Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_CA_comment = | legal_DE = <!-- Anlage I, II, III or Unscheduled --> | legal_DE_comment = | legal_NZ = <!-- Class A, B, C --> | legal_NZ_comment = | legal_UK = <!-- GSL, P, POM, CD, CD Lic, CD POM, CD No Reg POM, CD (Benz) POM, CD (Anab) POM or CD Inv POM / Class A, B, C --> | legal_UK_comment = | legal_US = Rx-only | legal_US_comment = | legal_EU = | legal_EU_comment = | legal_UN = <!-- N I, II, III, IV / P I, II, III, IV --> | legal_UN_comment = | legal_status = <!-- For countries not listed above -->
<!-- Pharmacokinetic data --> | bioavailability = | protein_bound = | metabolism = | metabolites = | onset = | elimination_half-life = | duration_of_action = | excretion =
<!-- Identifiers --> | CAS_number_Ref = {{cascite|changed|??}} | CAS_number = 32988-50-4 | CAS_number2 = 37883-00-4 | PubChem = 3037981 | IUPHAR_ligand = | DrugBank = DB06827 | DrugBank2 = DBSALT000952 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 2301596 | ChemSpiderID2 = 4445631 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = YVU35998K5 | UNII2 = LKO141R05V | KEGG = | KEGG2 = D02270 | ChEBI_Ref = {{ebicite|correct|EBI}} | ChEBI = 15782 | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 1201221 | ChEMBL2 = 3989823 | NIAID_ChemDB = | PDB_ligand = | synonyms =
<!-- Chemical and physical data --> | IUPAC_name = (''S'')-3,6-Diamino-''N''-((3''S'',9''S'',12''S'',15''S'',''Z'')-((2''R'',4''S'')-6-amino-4-hydroxy-1,2,3,4-tetrahydropyridin-2-yl)-9,12-bis(hydroxymethyl)2,5,8,11,14-pentaoxo-6-(ureidomethylene)-1,4,7,10,13-pentaazacyclohexadecan-15-yl)hexanamide | C=25 | H=43 | N=13 | O=10 | SMILES = C1[C@@H](NC(=N[C@H]1O)N)[C@H]2C(=O)NC[C@@H](C(=O)N[C@H](C(=O)N[C@H](C(=O)N/C(=C\NC(=O)N)/C(=O)N2)CO)CO)NC(=O)C[C@H](CCCN)N | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C25H43N13O10/c26-3-1-2-10(27)4-16(41)32-12-6-30-23(47)18(11-5-17(42)37-24(28)36-11)38-20(44)13(7-31-25(29)48)33-21(45)14(8-39)35-22(46)15(9-40)34-19(12)43/h7,10-12,14-15,17-18,39-40,42H,1-6,8-9,26-27H2,(H,30,47)(H,32,41)(H,33,45)(H,34,43)(H,35,46)(H,38,44)(H3,28,36,37)(H3,29,31,48)/b13-7-/t10-,11+,12-,14-,15-,17-,18-/m0/s1 | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = GXFAIFRPOKBQRV-GHXCTMGLSA-N | StdInChIKey2 = AQONYROJHRNYQQ-QMAPKBLTSA-N | density = | density_notes = | melting_point = | melting_high = | melting_notes = | boiling_point = | boiling_notes = | solubility = | sol_units = | specific_rotation = }}
'''Viomycin''' is a member of the tuberactinomycin family,<ref>{{cite journal | vauthors = Bycroft BW | journal = Chem. Commun. | issue = 11 | year = 1972 | pages = 660 | doi = 10.1039/c39720000660 | title=The crystal structure of viomycin, a tuberculostatic antibiotic}}</ref><ref>{{cite journal | vauthors = Noda T, Take T, Nagata A, Wakamiya T, Shiba T | title = Chemical studies on tuberactinomycin. 3. The chemical structure of viomycin (tuberactinomycin B) | journal = The Journal of Antibiotics | volume = 25 | issue = 7 | pages = 427–8 | date = July 1972 | pmid = 4350196 | doi = 10.7164/antibiotics.25.427 | doi-access = free }}</ref><ref>{{cite journal | vauthors = Kitagawa T, Miura T, Fujiwara K, Taniyama H | title = The total structure of viomycin by sequential analysis | journal = Chemical & Pharmaceutical Bulletin | volume = 20 | issue = 10 | pages = 2215–25 | date = October 1972 | pmid = 4346588 | doi = 10.1248/cpb.20.2215 | doi-access = free }}</ref> a group of nonribosomal peptide antibiotics exhibiting anti-tuberculosis activity. The tuberactinomycin family is an essential component in the drug cocktail currently used to fight infections of ''Mycobacterium tuberculosis''. Viomycin was the first member of the tuberactinomycins to be isolated and identified,<ref name=tuberactinomycin>{{cite journal | vauthors = Barkei JJ, Kevany BM, Felnagle EA, Thomas MG | title = Investigations into viomycin biosynthesis by using heterologous production in Streptomyces lividans | journal = ChemBioChem | volume = 10 | issue = 2 | pages = 366–76 | date = January 2009 | pmid = 19105177 | pmc = 2765823 | doi = 10.1002/cbic.200800646 }}</ref> and was used to treat TB until it was replaced by the less toxic, but structurally related compound, capreomycin. The tuberactinomycins target bacterial ribosomes, binding RNA and disrupting bacterial protein synthesis and certain forms of RNA splicing. Viomycin is produced by the actinomycete ''Streptomyces puniceus''.<ref name="pmid31733401">{{cite journal |vauthors= Hutchings MI, Truman AW, Wilkinson B |title= Antibiotics: past, present and future|journal= Current Opinion in Microbiology |volume= 51 |pages= 72–80|date= October 2019 |pmid= 31733401 |doi= 10.1016/j.mib.2019.10.008|doi-access= free }}</ref>
== Biosynthesis== The gene cluster for viomycin has been sequenced from ''Streptomyces sp.'' strain ATCC 11861,<ref name=strep_11861>{{cite journal | vauthors = Thomas MG, Chan YA, Ozanick SG | title = Deciphering tuberactinomycin biosynthesis: isolation, sequencing, and annotation of the viomycin biosynthetic gene cluster | journal = Antimicrobial Agents and Chemotherapy | volume = 47 | issue = 9 | pages = 2823–30 | date = September 2003 | pmid = 12936980 | pmc = 182626 | doi = 10.1128/AAC.47.9.2823-2830.2003 }}</ref> ''Streptomyces vinaceus''<ref name=strep_v>{{cite journal | vauthors = Yin X, O'Hare T, Gould SJ, Zabriskie TM | title = Identification and cloning of genes encoding viomycin biosynthesis from Streptomyces vinaceus and evidence for involvement of a rare oxygenase | journal = Gene | volume = 312 | pages = 215–24 | date = July 2003 | pmid = 12909358 | doi = 10.1016/S0378-1119(03)00617-6 }}</ref> and from ''Streptomyces lividans'' 1326.<ref name="tuberactinomycin"/> It consists of a central cyclic pentapeptide code assembled from nonribosomal peptide synthetase (NRPS). The NRPS contains 4 proteins: VioA, VioF, VioI, and VioG. These proteins condense and cyclize two molecules of <small>L</small>-2,3-diaminopropionate (<small>L</small>-Dap), two molecules of <small>L</small>-serine (<small>L</small>-Ser), and one molecule of (2''S'',3''R'')-capreomycidine (<small>L</small>-Cam). After cyclizing these, VioJ catalyzes the α,β-desaturation of this preliminary structure. It is proposed that the viomycin gene cluster includes 36.3 kb of contiguous DNA that encodes 20 open reading frames (ORFs)<ref name="strep_11861"/> that are involved in the biosynthesis, regulation, and eventual activation viomycin. In addition to these ORFs, the structure contains the resistance gene vph. The following is a summary of the ORFs and their functions.
{{div col|colwidth=22em}} *'''VioA''': NRPS (A-PCP-C-A-PCP-C) *'''VioH''': Type II thioesterase *'''VioO''': NRPS (A-PCP)-β-lysine activation *'''VioB''': 2,3-diaminopropionate synthase *'''VioI''': NRPS (PCP-C) *'''VioP''': Lysine 2,3-aminomutase *'''VioC''': <small>L</small>-Arg hydroxylase *'''VIoJ''': 2,3-diaminopropionyl α,β-desaturase *'''vph''': Viomycin phosphotransferase *'''VioD''': Capreomycidine synthase *'''VioK''': Ornithine cyclodeaminase *'''VioQ''': Capreomycidine hydroxylase *'''VioE''': Permease *'''VioL''': Carbamoyltransferase *'''VioR''': Transcriptional regulator *'''VioF''': NRPS (A-PCP-C) *'''VIoM''': NRPS (C)-β-lysine transferase *'''VIoS''': Viomycin-phosphate phosphatase *'''VioG''': NRPS (A-PCP-C/) *'''VioN''': MbtH homolog *'''VioT''': Transcriptional regulator {{div col end}}
=== Synthesis of the backbone === The following is the proposed biosynthesis of viomycin using NRPS-catalyzed peptide synthesis. There are five modules for cyclic pentapeptide biosynthesis, including one that lacks an adenylation domain (A). It is therefore proposed that one of the other A domains functions twice. Additionally, the NRPS subunits are not suspected to function in the order in which their genes are arranged, a characteristic of viomycin biosynthesis that is unlike typical NRPS-catalyzed peptide synthesis.<ref name="tuberactinomycin"/> The NRPS components function in the order of VioA→VioI→VioF→VioG to account for the incorporation of β-ureidoalanine (β-Uda). The first A domain of VioA creates an L-Dap-PCP intermediate on the first PCP domain. Meanwhile, the second A domain of VioA loads L-Ser onto the second PCP domain, as well as the PCP of VioI. The activation of β-Uda occurs via VioF, and VioG incorporates <small>L</small>-Cam.
thumb|none|800px|'''Figure 1.''' Domain Organization of viomycin.
=== Post-modification === After α,β-desaturation via VioJ, three modifications to the preliminary cyclic structure occur. Hydroxylation of C-6 in the structure occurs by VioQ, ''N''-acylation of α-amino group using β-lysine, VioO, and VioM, and carbamoylation of the β-amino group, producing β-ureidoalanine (β-Uda) by the carbamoyltransferase homologue VioL.
thumb|none|800px|'''Figure 2.''' Post-modification of Viomycin.
== References == {{reflist}}
{{Portal bar | Medicine}} {{Authority control}}
Category:Polypeptide antibiotics Category:Cyclic peptides Category:Pentapeptides Category:Sixteen-membered rings