{{Chembox | ImageFile = Vindoline.svg | ImageSize = 200px | ImageAlt = | IUPACName = Methyl 3β,4β-dihydroxy-16-methoxy-1-methyl-6,7-didehydro-2β,5α,12β,19α-aspidospermidine-3α-carboxylate | SystematicName = Methyl (3a''R'',3a<sup>1</sup>''R'',4''R'',5''S'',5a''R'',10b''R'')-4-(acetyloxy)-3a-ethyl-5-hydroxy-8-methoxy-6-methyl-3a,3a<sup>1</sup>,4,5,5a,6,11,12-octahydro-1''H''-indolizino[8,1-''cd'']carbazole-5-carboxylate | OtherNames = |Section1={{Chembox Identifiers | CASNo = 2182-14-1 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 571PJ1LW03 | EINECS = 218-558-0 | PubChem = 260535 | ChemSpiderID = 228680 | SMILES = CC[C@@]12C=CCN3[C@@H]1[C@@]4(CC3)c5ccc(cc5N([C@H]4C([C@@H]2OC(=O)C)(C(=O)OC)O)C)OC | InChI = 1/C25H32N2O6/c1-6-23-10-7-12-27-13-11-24(19(23)27)17-9-8-16(31-4)14-18(17)26(3)20(24)25(30,22(29)32-5)21(23)33-15(2)28/h7-10,14,19-21,30H,6,11-13H2,1-5H3/t19-,20+,21+,23+,24+,25-/m0/s1 | InChIKey = CXBGOBGJHGGWIE-ACSXSLCXBW | StdInChI = 1S/C25H32N2O6/c1-6-23-10-7-12-27-13-11-24(19(23)27)17-9-8-16(31-4)14-18(17)26(3)20(24)25(30,22(29)32-5)21(23)33-15(2)28/h7-10,14,19-21,30H,6,11-13H2,1-5H3/t19-,20+,21+,23+,24+,25-/m0/s1 | StdInChIKey = CXBGOBGJHGGWIE-ACSXSLCXSA-N}} |Section2={{Chembox Properties | C=25 | H=32 | N=2 | O=6 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}

'''Vindoline''' is a chemical precursor to vinblastine.<ref>{{cite journal |pmid= 23864440 |year= 2014 |last1= Liu |first1= J |title= Enhancement of vindoline and vinblastine production in suspension-cultured cells of Catharanthus roseus by artemisinic acid elicitation |journal= World Journal of Microbiology and Biotechnology |volume= 30 |issue= 1 |pages= 175–80 |last2= Zhu |first2= J |last3= Tang |first3= L |last4= Wen |first4= W |last5= Lv |first5= S |last6= Yu |first6= R |doi= 10.1007/s11274-013-1432-z |s2cid= 7350499 }}</ref> Vindoline is formed through biosynthesis from Tabersonine.

==See also== * Lochnericine * Dimerization of catharanthine and vindoline

==References== {{reflist}}

{{Tryptamines}}

Category:Tryptamine alkaloids Category:Indolizidines

{{alkaloid-stub}}