{{Short description|Antihistamine medication}} {{cs1 config|name-list-style=vanc}} {{About|the drug|the Roman province|Tripolitania|the city|Tripoli (disambiguation){{!}}Tripoli}} {{drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 470617213 | IUPAC_name = 2-[(''E'')-1-(4-methylphenyl)-3-pyrrolidin-1-yl-<br />prop-1-enyl]pyridine | image = Triprolidine Structural Formula V1.svg | image_class = skin-invert-image | tradename = Flonase Nighttime Allergy Relief, Actidil, others <!--Clinical data-->| Drugs.com = {{drugs.com|monograph|triprolidine-hydrochloride}} | pregnancy_category = C (US) | legal_US = otc | routes_of_administration = By mouth <!--Pharmacokinetic data-->| bioavailability = Oral: 4% | protein_bound = 90% | metabolism = Hepatic (CYP2D6) | elimination_half-life = 4–6 hours | excretion = Renal <!--Identifiers-->| CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 486-12-4 | ATC_prefix = R06 | ATC_suffix = AX07 | PubChem = 5282443 | IUPHAR_ligand = 1228 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = DB00427 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 4445597 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = 2L8T9S52QM | KEGG_Ref = {{keggcite|changed|kegg}} | KEGG = D01782 | ChEBI_Ref = {{ebicite|changed|EBI}} | ChEBI = 84116 | ChEMBL_Ref = {{ebicite|correct|EBI}} | ChEMBL = 855 <!--Chemical data-->| C = 19 | H = 22 | N = 2 | SMILES = n3c(\C(=C\CN1CCCC1)c2ccc(cc2)C)cccc3 | StdInChI_Ref = {{stdinchicite|correct|chemspider}} | StdInChI = 1S/C19H22N2/c1-16-7-9-17(10-8-16)18(19-6-2-3-12-20-19)11-15-21-13-4-5-14-21/h2-3,6-12H,4-5,13-15H2,1H3/b18-11+ | StdInChIKey_Ref = {{stdinchicite|correct|chemspider}} | StdInChIKey = CBEQULMOCCWAQT-WOJGMQOQSA-N | melting_point = 60 | solubility = 500 }} <!-- Definition and medical uses --> '''Triprolidine''' is an over-the-counter first-generation antihistamine with strong anticholinergic properties.<ref name="Goldsmith">{{cite journal | vauthors = Goldsmith P, Dowd PM | title = The new H1 antihistamines. Treatment of urticaria and other clinical problems | journal = Dermatologic Clinics | volume = 11 | issue = 1 | pages = 87–95 | date = January 1993 | doi = 10.1016/S0733-8635(18)30285-7 | pmid = 8094649 }}</ref> It is used to combat the symptoms associated with allergies and is sometimes combined with other medications in preparations designed to provide general relief for flu-like symptoms.<ref>{{cite journal | vauthors = Williams BO, Liao SH, Lai AA, Arnold JD, Perkins JG, Blum MR, Findlay JW | title = Bioavailability of pseudoephedrine and triprolidine from combination and single-ingredient products | journal = Clinical Pharmacy | volume = 3 | issue = 6 | pages = 638–43 | year = 1984 | pmid = 6509877 }}</ref> As with many antihistamines, the most common side effect is drowsiness.<ref name="Goldsmith" />

<!-- Society and culture --> Triprolidine was patented in 1948 and came into medical use in 1953,<ref name=Fis2006>{{cite book | vauthors = Fischer J, Ganellin CR |title= Analogue-based Drug Discovery |date=2006 |publisher=John Wiley & Sons |isbn=9783527607495 |page=546 |url=https://books.google.com/books?id=FjKfqkaKkAAC&pg=PA546 |language=en}}</ref> and has mostly been replaced in popular cold and flu medications by other drugs such as diphenhydramine, promethazine, chlorpheniramine, loratadine and fexofenadine.

== See also == *Benzatropine *Pseudoephedrine

== References == {{Reflist}}

{{Antihistamines}} {{Hallucinogens}} {{Histamine receptor modulators}} {{Muscarinic acetylcholine receptor modulators}}

Category:Alkene derivatives Category:H1 receptor antagonists Category:Muscarinic antagonists Category:2-Pyridyl compounds Category:1-Pyrrolidinyl compounds Category:4-Tolyl compounds Category:Over-the-counter drugs in the United States