{{Short description|Chemical compound}} {{Drugbox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 414208020 | IUPAC_name = Ethyl 3,5,6-tri-''O''-benzyl-<small>D</small>-glucofuranoside (TBGF) | image = Tribenoside.svg | image_class = skin-invert-image

<!--Clinical data--> | tradename = | Drugs.com = {{drugs.com|international|tribenoside}} | pregnancy_AU = <!-- A / B1 / B2 / B3 / C / D / X --> | pregnancy_US = <!-- A / B / C / D / X --> | pregnancy_category = | legal_AU = <!-- Unscheduled / S2 / S3 / S4 / S5 / S6 / S7 / S8 / S9 --> | legal_CA = <!-- / Schedule I, II, III, IV, V, VI, VII, VIII --> | legal_UK = <!-- GSL / P / POM / CD / Class A, B, C --> | legal_US = <!-- OTC / Rx-only / Schedule I, II, III, IV, V --> | legal_status = | routes_of_administration =

<!--Pharmacokinetic data--> | bioavailability = | protein_bound = | metabolism = | elimination_half-life = | excretion =

<!--Identifiers--> | CAS_number_Ref = {{cascite|correct|??}} | CAS_number = 10310-32-4 | ATC_prefix = C05 | ATC_suffix = AX05 | ATC_supplemental = {{ATC|C05|CX01}} | PubChem = 196122 | DrugBank_Ref = {{drugbankcite|correct|drugbank}} | DrugBank = | UNII_Ref = {{fdacite|changed|FDA}} | UNII = Z7N0Y673NU | ChEMBL_Ref = {{ebicite|changed|EBI}} | ChEMBL = 1446743 | ChemSpiderID_Ref = {{chemspidercite|changed|chemspider}} | ChemSpiderID = 169970

<!--Chemical data--> | C=29 | H=34 | O=6 | synonyms = <small>(3''R'',4''R'',5''R'')-4-(Benzyloxy)-5-[1,2-bis(benzyloxy)ethyl]-2-ethoxyoxolan-3-ol</small> | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/C29H34O6/c1-2-32-29-26(30)28(34-20-24-16-10-5-11-17-24)27(35-29)25(33-19-23-14-8-4-9-15-23)21-31-18-22-12-6-3-7-13-22/h3-17,25-30H,2,18-21H2,1H3/t25-,26-,27-,28-,29?/m1/s1 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = ULLNJSBQMBKOJH-VIVFLBMVSA-N | smiles = CCOC1[C@@H]([C@H]([C@H](O1)[C@@H](COCc2ccccc2)OCc3ccccc3)OCc4ccccc4)O }}

'''Tribenoside''' ('''Glyvenol''') is a vasoprotective drug used to treat hemorrhoids.<ref name="pmid27383331">{{cite journal |author=Lorenc Z, Gökçe Ö |title=Tribenoside and lidocaine in the local treatment of hemorrhoids: an overview of clinical evidence. |journal=Eur Rev Med Pharmacol Sci |year=2016 |volume=20 |issue=12 |pages=2742–51 |pmid=27383331 |url=https://www.europeanreview.org/article/11037}}</ref> It has mild anti-inflammatory, analgesic, and wound healing properties.<ref name="pmid578928">{{cite journal |author=Jaques R |title=The pharmacological activity of tribenoside. |journal=Pharmacology |year=1977 |volume=15 |issue=5 |pages=445–60 |pmid=578928 |doi=10.1159/000136721 |url=https://www.karger.com/Article/Abstract/136721|url-access=subscription }}</ref> Tribenoside stimulates laminin α5 production and laminin-332 deposition to help repair the basement membrane during the wound healing process.<ref name="pmid20118558">{{cite journal|author=Kikkawa Y, Takaki S, Matsuda Y, Okabe K, Taniguchi M, Oomachi K, Samejima T, Katagiri F, Hozumi K, Nomizu M |title=The influence of Tribenoside on expression and deposition of epidermal laminins in HaCaT cells. |journal=Biol Pharm Bull |year=2010 |volume=33 |issue=2 |pages=307–10 |pmid=20118558 |doi=10.1248/bpb.33.307 |url=https://www.jstage.jst.go.jp/article/bpb/33/2/33_2_307/_article|doi-access=free }}</ref> It is a mixture of the α- and β-anomers.{{cn|date=January 2020}}

Tribenoside has been shown to induce drug hypersensitivity syndrome in association with CMV reactivation.<ref name="pmid15848991">{{cite journal |vauthors=Hashizume H, Takigawa M |title=Drug-induced hypersensitivity syndrome associated with cytomegalovirus reactivation: immunological characterization of pathogenic T cells |journal=Acta Derm. Venereol. |volume=85 |issue=1 |pages=47–50 |year=2005 |pmid=15848991 |doi=10.1080/00015550410024094 |doi-access=free }}</ref>

==References== {{reflist}}

{{Vasoprotectives}}

Category:Glucosides Category:Ethers

{{cardiovascular-drug-stub}}