{{Chembox | ImageFile = Tolamolol.svg | ImageClass = skin-invert-image | ImageSize = 250px | ImageAlt = | PIN = 4-(2-<nowiki/>{[2-Hydroxy-3-(3-methylphenoxy)propyl]amino}ethoxy)benzamide | OtherNames = |Section1={{Chembox Identifiers | CASNo = 38103-61-6 | CASNo_Ref = {{cascite|correct|CAS}} | UNII_Ref = {{fdacite|correct|FDA}} | UNII = F03W3WUW58 | PubChem = 37910 | ChemSpiderID = 34753 | InChI=1S/C19H24N2O4/c1-14-4-2-3-5-18(14)25-13-16(22)12-21-10-11-24-17-8-6-15(7-9-17)19(20)23/h2-9,16,21-22H,10-13H2,1H3,(H2,20,23) | InChIKey= SKQDKFOTIPJUSV-UHFFFAOYSA-N | SMILES = CC1=CC=CC=C1OCC(CNCCOC2=CC=C(C=C2)C(=O)N)O}} |Section2={{Chembox Properties | C=19 | H=24 | N=2 | O=4 | Appearance = | Density = | MeltingPt = | BoilingPt = | Solubility = }} |Section3={{Chembox Hazards | MainHazards = | FlashPt = | AutoignitionPt = }} }}
'''Tolamolol''' is a beta adrenergic receptor antagonist.<ref>{{cite journal|pmid=1974626|year=1990|last1=Curtis-Prior|first1=PB|last2=Gadd|first2=AL|title=Beta-adrenoceptor antagonists and human sperm motility|volume=42|issue=3|pages=220–2|journal=The Journal of Pharmacy and Pharmacology|doi=10.1111/j.2042-7158.1990.tb05395.x|s2cid=85573776}}</ref>
==References== {{Reflist}}
{{Adrenergics}}
Category:Beta blockers Category:Abandoned drugs Category:Benzamides Category:Phenoxypropanolamines
{{cardiovascular-drug-stub}}