{{chembox | Verifiedfields = changed | Watchedfields = changed | verifiedrevid = 439751940 | ImageFile = Cp2TiCl2.png | ImageSize = 150px | ImageName = Titanocene dichloride | ImageFile1 = Titanocene-dichloride-3D-balls.png | ImageSize1 = 150px | ImageName1 = Ball-and-stick model of titanocene dichloride | ImageFile2 = Cp2TiCl2Sample.jpg | ImageSize2 = 150px | ImageName2 = Sample of titanocene dichloride | IUPACName = Dichloridobis(η<sup>5</sup>-cyclopentadienyl)titanium | OtherNames = titanocene dichloride, dichlorobis(cyclopentadienyl)titanium(IV) |Section1={{Chembox Identifiers | CASNo_Ref = {{cascite|correct|CAS}} | CASNo = 1271-19-8 | ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}} | ChemSpiderID = 34981141 | EC_number = 215-035-9 | PubChem = 5284468 | RTECS = XR2050000 | UNNumber = 3261 | UNII_Ref = {{fdacite|correct|FDA}} | UNII = MJE0547U1U | InChI = 1/2C5H5.2ClH.Ti/c2*1-2-4-5-3-1;;;/h2*1-5H;2*1H;/q2*-1;;;+4/p-2/r2C5H5.Cl2Ti/c2*1-2-4-5-3-1;1-3-2/h2*1-5H;/q2*-1;+2 | InChIKey = YMNCCEXICREQQV-JUFMQDBHAK | StdInChI_Ref = {{stdinchicite|changed|chemspider}} | StdInChI = 1S/2C5H5.2ClH.Ti/c2*1-2-4-5-3-1;;;/h2*1-5H;2*1H;/q2*-1;;;+4/p-2 | StdInChIKey_Ref = {{stdinchicite|changed|chemspider}} | StdInChIKey = YMNCCEXICREQQV-UHFFFAOYSA-L | SMILES = [cH-]1cccc1.[cH-]1cccc1.Cl[Ti+2]Cl
}} |Section2={{Chembox Properties | Formula = C<sub>10</sub>H<sub>10</sub>Cl<sub>2</sub>Ti | MolarMass = 248.96 g/mol | Appearance = bright red solid | Density = 1.60 g/cm<sup>3</sup>, solid | Solubility = sl. sol. with hydrolysis | MeltingPtC = 289 | MeltingPt_notes = }} |Section3={{Chembox Structure | Coordination = Dist. tetrahedral | CrystalStruct = Triclinic | Dipole = }} |Section7={{Chembox Hazards | ExternalSDS = | NFPA-H = 2 | NFPA-F = | NFPA-R = 1 | Hazards_ref=<ref>{{cite web |title=Summary of Classification and Labelling |url=https://echa.europa.eu/information-on-chemicals/cl-inventory-database/-/discli/details/41331 |access-date=5 December 2021}}</ref> | GHSPictograms = {{GHS07}} | GHSSignalWord = Warning | HPhrases = {{H-phrases|315|335}} | PPhrases = {{P-phrases|201|202|261|264|270|271|280|281|301+310|301+312|302+352|304+340|305+351+338|308+313|312|330|332+313|337+313|362|403+233|405|501}} }} |Section8={{Chembox Related | OtherCompounds = Ferrocene<br /> Zirconocene dichloride<br> Hafnocene dichloride<br>Vanadocene dichloride<br> Niobocene dichloride<br>Tantalocene dichloride<br>Molybdocene dichloride<br> Tungstenocene dichloride<br> TiCl<sub>4</sub>}} }} '''Titanocene dichloride''' is the organotitanium compound with the formula (''η''<sup>5</sup>-C<sub>5</sub>H<sub>5</sub>)<sub>2</sub>TiCl<sub>2</sub>, commonly abbreviated as Cp<sub>2</sub>TiCl<sub>2</sub>. This metallocene is a common reagent in organometallic and organic synthesis. It exists as a bright red solid that slowly hydrolyzes in air.<ref>{{cite book | editor-first=S. |editor-last=Budaver | title=The Merck Index |edition=11th |publisher=Merck & Co., Inc. | year=1989 }}</ref> It shows antitumour activity and was the first non-platinum complex to undergo clinical trials as a chemotherapy drug.<ref name = "anti-cancer" />
==Preparation and structure== The standard preparations of Cp<sub>2</sub>TiCl<sub>2</sub> start with titanium tetrachloride. The original synthesis by Wilkinson and Birmingham, using sodium cyclopentadienide,<ref>{{cite journal | author1-link=Geoffrey Wilkinson |first1= G.|last1= Wilkinson |first2=J.G. |last2=Birmingham | title = Bis-cyclopentadienyl Compounds of Ti, Zr, V, Nb and Ta | journal = J. Am. Chem. Soc. | volume = 76 | issue = 17 | year = 1954 | pages = 4281–4284 | doi = 10.1021/ja01646a008|bibcode= 1954JAChS..76.4281W}}</ref> is still commonly used:<ref>{{cite journal |title=Cp<sub>2</sub>TiCl<sub>2</sub>: Synthesis, Characterization, Modeling and Catalysis|author1=Sara E. Johnson |author2=Taylor A. Bell |author3=Joseph K. West|journal=Journal of Chemical Education|year=2022|volume=99|number=5|pages=2121–2128|doi=10.1021/acs.jchemed.1c01272|bibcode=2022JChEd..99.2121J |s2cid=248287682 }}</ref>
:2 NaC<sub>5</sub>H<sub>5</sub> + TiCl<sub>4</sub> → (C<sub>5</sub>H<sub>5</sub>)<sub>2</sub>TiCl<sub>2</sub> + 2 NaCl
It can also be prepared by using freshly distilled cyclopentadiene rather than its sodium derivative:<ref>{{cite book | first = J. M. | last = Birmingham | title = Synthesis of Cyclopentadienyl Metal Compounds | series = Advances in Organometallic Chemistry | volume = 2 | year = 1965 | pages = 365–413 | doi = 10.1016/S0065-3055(08)60082-9 | isbn = 9780120311026 }}</ref>
:2 C<sub>5</sub>H<sub>6</sub> + TiCl<sub>4</sub> → (C<sub>5</sub>H<sub>5</sub>)<sub>2</sub>TiCl<sub>2</sub> + 2 HCl
Focusing on the geometry of the Ti center, Cp<sub>2</sub>TiCl<sub>2</sub> adopts a distorted tetrahedral geometry (counting Cp as a monodentate ligand). The Ti-Cl distance is 2.37 Å and the Cl-Ti-Cl angle is 95°.<ref>{{cite journal | last1=Clearfield|first1=Abraham | title=Structural Studies of (π-C<sub>5</sub>H<sub>5</sub>)<sub>2</sub>MX<sub>2</sub> Complexes and their Derivatives. The Structure of Bis(π-cyclopentadienyl)titanium Dichloride | journal=Can. J. Chem. | volume=53 | year=1975 | issue=11 | pages=1621–1629 | doi=10.1139/v75-228 | last2=Warner | first2=David Keith | last3=Saldarriaga Molina | first3=Carlos Hermán | last4=Ropal | first4=Ramanathan | last5=Bernal | first5=Ivan|display-authors=etal}}</ref>
==Reactions== ===Halide replacement reactions=== Cp<sub>2</sub>TiCl<sub>2</sub> serves as a source of Cp<sub>2</sub>Ti<sup>2+</sup>. A large range of nucleophiles will displace chloride. With NaSH and with polysulfide salts, one obtains the sulfido derivatives Cp<sub>2</sub>Ti(SH)<sub>2</sub> and Cp<sub>2</sub>TiS<sub>5</sub>.<ref>{{cite book|first1=Alan |last1=Shaver |first2=James M. |last2=McCall |first3=Gabriela |last3=Marmolejo |title=Inorganic Syntheses |chapter=Cyclometallapolysulfanes (And Selanes) of Bis(η <sup>5</sup> -Cyclopentadienyl) Titanium(IV), Zirconium(IV), Molybdenum(IV), and Tungsten(IV) |date=1990 |volume=27 |pages=59–65 |doi=10.1002/9780470132586.ch11|isbn=9780470132586 }}</ref>
The Petasis reagent, Cp<sub>2</sub>Ti(CH<sub>3</sub>)<sub>2</sub>, is prepared from the action of methylmagnesium chloride<ref>{{OrgSynth | last1= Payack |first1=J. F. |last2=Hughes |first2=D. L.|last3=Cai |first3=D. |last4=Cottrell |first4=I. F. |last5=Verhoeven |first5=T. R. | prep = v79p0019 | volume = 79 | pages = 19 | year = 2002 | title = Dimethyltitanocene}}</ref> or methyllithium<ref>{{cite journal | last1= Claus |first1=K. |last2=Bestian |first2=H. | journal = Justus Liebigs Ann. Chem. | year = 1962 | volume = 654 | pages = 8–19 | doi = 10.1002/jlac.19626540103 | title = Über die Einwirkung von Wasserstoff auf einige metallorganische Verbindungen und Komplexe}}</ref> on Cp<sub>2</sub>TiCl<sub>2</sub>. This reagent is useful for the conversion of esters into vinyl ethers.
The Tebbe reagent Cp<sub>2</sub>TiCl(CH<sub>2</sub>)Al(CH<sub>3</sub>)<sub>2</sub>, arises by the action of 2 equivalents Al(CH<sub>3</sub>)<sub>3</sub> on Cp<sub>2</sub>TiCl<sub>2</sub>.<ref name="Herrmann">{{cite book | last1 = Herrmann | first1 = W.A. | title = The Methylene Bridge | series = Advances in Organometallic Chemistry | year = 1982 | volume = 20 | pages = 159–263 | doi=10.1016/s0065-3055(08)60522-5 | isbn = 9780120311200 }}</ref><ref name="Strauss">{{cite encyclopedia|last=Straus |first=D. A.|title=''μ''-Chlorobis(cyclopentadienyl)(dimethylaluminium)-''μ''-methylenetitanium |encyclopedia=Encyclopedia of Reagents for Organic Synthesis |publisher=John Wiley |location=London |date=2000}}</ref>
===Reactions affecting Cp ligands=== One Cp ligand can be removed from Cp<sub>2</sub>TiCl<sub>2</sub> to give tetrahedral CpTiCl<sub>3</sub>. This conversion can be effected with TiCl<sub>4</sub> or by reaction with SOCl<sub>2</sub>.<ref>{{cite journal|last1 = Chandra|first1 = K.|last2 = Sharma|first2 = R. K.|last3 = Kumar|first3 = N.|last4 = Garg|first4 = B. S.|title = Preparation of ''η''<sup>5</sup>-Cyclopentadienyltitanium Trichloride and ''η''<sup>5</sup>-Methylcyclopentadienyltitanium Trichloride|journal = Chem. Ind. - London|year = 1980|volume = 44|pages = 288–289}}</ref>
The sandwich complex (Cycloheptatrienyl)(cyclopentadienyl)titanium is prepared by treatment of titanocene dichloride with lithium cycloheptatrienyl.<ref>{{cite journal |doi=10.1002/anie.202009634|title=Exploring the Organometallic Route to Molecular Spin Qubits: The [Cp ''Ti''(cot)] Case|year=2021|last1=Camargo|first1=Luana C.|last2=Briganti|first2=Matteo|last3=Santana|first3=Francielli S.|last4=Stinghen|first4=Danilo|last5=Ribeiro|first5=Ronny R.|last6=Nunes|first6=Giovana G.|last7=Soares|first7=Jaísa F.|last8=Salvadori|first8=Enrico|last9=Chiesa|first9=Mario|last10=Benci|first10=Stefano|last11=Torre|first11=Renato|last12=Sorace|first12=Lorenzo|last13=Totti|first13=Federico|last14=Sessoli|first14=Roberta|journal=Angewandte Chemie International Edition|volume=60|issue=5|pages=2588–2593|pmid=33051985|bibcode=2021ACIE...60.2588D |hdl=2318/1765157|s2cid=222351619|url=https://zenodo.org/record/4926051 |hdl-access=free}}</ref>
Titanocene itself, TiCp<sub>2</sub>, is so highly reactive that it rearranges into a Ti<sup>III</sup> hydride dimer and has been the subject of much investigation.<ref name = TiCp2-A>{{cite book|title = Organometallic Chemistry of Titanium, Zirconium, and Hafnium|pages = 229–237|chapter = Titanocene|first1 = P. C.|last1 = Wailes|first2 = R. S. P.|last2 = Coutts|first3 = H.|last3 = Weigold|publisher = Academic Press|year = 1974|chapter-url = https://books.google.com/books?id=wIlsA73iqpEC&pg=PA229|isbn = 9780323156479}}</ref><ref name = TiCp2-B>{{cite book|title = Organometallic Chemistry: A Unified Approach|first1 = R. C.|last1 = Mehrotra|first2 = A.|last2 = Singh|edition = 2nd|publisher = New Age International Publishers|location = New Delhi|year = 2000|chapter = 4.3.6 η<sup>5</sup>-Cyclopentadienyl d-Block Metal Complexes|pages = 243–268|chapter-url = https://books.google.com/books?id=NSQy3mFKRM8C&pg=PA258|isbn = 9788122412581}}</ref> This dimer can be trapped by conducting the reduction of titanocene dichloride in the presence of ligands; in the presence of benzene, a fulvalene complex, {{nowrap|μ(η<sup>5</sup>:η<sup>5</sup>-fulvalene)-di-(μ-hydrido)-bis(η<sup>5</sup>-cyclopentadienyltitanium),}} can be prepared and the resulting solvate structurally characterised by X-ray crystallography.<ref name = TitanoceneXRay>{{cite journal|first1 = Sergei I.|last1 = Troyanov|first2 = Helena|last2 = Antropiusová|first3 = Karel|last3 = Mach|journal = J. Organomet. Chem.|title = Direct proof of the molecular structure of dimeric titanocene; The X-ray structure of μ(η<sup>5</sup>:η<sup>5</sup>-fulvalene)-di-(μ-hydrido)-bis(η<sup>5</sup>-cyclopentadienyltitanium)·1.5 benzene|volume = 427|issue = 1|year = 1992|pages = 49–55|doi = 10.1016/0022-328X(92)83204-U}}</ref> The same compound had been reported earlier by a lithium aluminium hydride reduction<ref>{{cite journal|title = Preparation of μ-(η<sup>5</sup>:η<sup>5</sup>-Fulvalene)-di-μ-hydrido-bis(η<sup>5</sup>-cyclopentadienyltitanium) by the reduction of Cp<sub>2</sub>TiCl<sub>2</sub> with LiAlH<sub>4</sub> in aromatic solvents|first1 = Helena|last1 = Antropiusová|first2 = Alena|last2 = Dosedlová|first3 = Vladimir|last3 = Hanuš|last4 = Karel|first4 = Mach|journal = Transition Met. Chem.|year = 1981|volume = 6|issue = 2|pages = 90–93|doi = 10.1007/BF00626113|s2cid = 101189483}}</ref> and sodium amalgam reduction<ref>{{cite journal|title = Chemistry of oxophilic transition metals. 2. Novel derivatives of titanocene and zirconocene|first1 = Tomas|last1 = Cuenca|first2 = Wolfgang A.|last2 = Herrmann|first3 = Terence V.|last3 = Ashworth|journal = Organometallics|year = 1986|volume = 5|issue = 12|pages = 2514–2517|doi = 10.1021/om00143a019}}</ref> of titanocene dichloride, and studied by <sup>1</sup>H NMR<ref>{{cite journal|journal = J. Organomet. Chem.|volume = 290|issue = 3|year = 1985|pages = 301–305|title = <sup>1</sup>H NMR Spectra and electronic structure of binuclear niobocene and titanocene containing fulvalene ligands|first1 = D. A.|last1 = Lemenovskii|first2 = I. F.|last2 = Urazowski|first3 = Yu K.|last3 = Grishin|first4 = V. A.|last4 = Roznyatovsky|doi = 10.1016/0022-328X(85)87293-4}}</ref> prior to its definitive characterisation.<ref name = TiCp2-A /><ref name = TiCp2-B /> 200px|thumb|left|"Titanocene" is not Ti(C<sub>5</sub>H<sub>5</sub>)<sub>2</sub>, but rather this isomer with a fulvalene dihydride structure.<ref name = TiCp2-B /><ref name = TitanoceneXRay />
===Redox=== Reduction with zinc gives the dimer of bis(cyclopentadienyl)titanium(III) chloride in a solvent-mediated chemical equilibrium:<ref>{{cite book |first1 = L. E.|last1 = Manzer|first2 = E. A.|last2 = Mintz|first3 = T. J.|last3 = Marks | title=Inorganic Syntheses | chapter=18. Cyclopentadienyl Complexes of Titanium(III) and Vanadium(III) |doi = 10.1002/9780470132524.ch18|volume = 21|year = 1982|pages = 84–86|isbn = 9780470132524}}</ref><ref>{{cite journal|last1 = Nugent|first1 = William A.|last2 = RajanBabu|first2 = T. V.|title = Transition-metal-centered radicals in organic synthesis. Titanium(III)-induced cyclization of epoxy olefins|journal = J. Am. Chem. Soc.|volume = 110|issue = 25|pages = 8561–8562|doi = 10.1021/ja00233a051|year = 1988 | bibcode=1988JAChS.110.8561N }}</ref>
600px|center
Cp<sub>2</sub>TiCl<sub>2</sub> is a precursor to Ti<sup>II</sup> derivatives. Reductions have been investigated using Grignard reagent and alkyl lithium compounds. More conveniently handled reductants include Mg, Al, or Zn. The following syntheses demonstrate some of the compounds that can be generated by reduction of titanocene dichloride in the presence of π acceptor ligands:<ref>{{cite encyclopedia|first=Erik |last=Kuester |title=Bis(5-2,4-cyclopentadienyl)bis(trimethylphosphine)titanium |encyclopedia=Encyclopedia of Reagents for Organic Synthesis |date=2002 |publisher=John Wiley|doi=10.1002/047084289X.rn00022|chapter=Bis(η5-2,4-cyclopentadienyl)bis(trimethylphosphine)titanium |isbn=0471936235 }}</ref> :Cp<sub>2</sub>TiCl<sub>2</sub> + 2 CO + Mg → Cp<sub>2</sub>Ti(CO)<sub>2</sub> + MgCl<sub>2</sub> :Cp<sub>2</sub>TiCl<sub>2</sub> + 2 PR<sub>3</sub> + Mg → Cp<sub>2</sub>Ti(PR<sub>3</sub>)<sub>2</sub> + MgCl<sub>2</sub>
Alkyne derivatives of titanocene have the formula (C<sub>5</sub>H<sub>5</sub>)<sub>2</sub>Ti(C<sub>2</sub>R<sub>2</sub>) and the corresponding benzyne complexes are known.<ref name="buchwald">{{cite journal | first1=S. L. |last1=Buchwald |first2=R. B. |last2=Nielsen | title=Group 4 Metal Complexes of Benzynes, Cycloalkynes, Acyclic Alkynes, and Alkenes | journal=Chem. Rev. | volume=88 | year=1988 | issue=7 | pages = 1047–1058 | doi = 10.1021/cr00089a004}}</ref> One family of derivatives are the titanocyclopentadienes.<ref name="rosenthal">{{cite journal | first1 = Uwe | last1 = Rosenthal | first2 = Paul-Michael |last2 = Pellny | first3 = Frank G. | last3 = Kirchbauer | first4 = Vladimir V. | last4 = Burlakov | title = What Do Titano- and Zirconocenes Do with Diynes and Polyynes? | journal = Chem. Rev. | volume = 33 | year = 2000 | issue = 2 | pages = 119–129 | doi = 10.1021/ar9900109 | pmid = 10673320}}</ref> Rosenthal's reagent, Cp<sub>2</sub>Ti(η<sup>2</sup>-Me<sub>3</sub>SiC≡CSiMe<sub>3</sub>), can be prepared by this method. Two structures are shown, '''A''' and '''B''', which are both resonance contributors to the actual structure of Rosenthal's reagent.<ref>{{Cite journal|last1 = Rosenthal|first1 = Uwe|last2 = Burlakov|first2 = Vladimir V.|last3 = Arndt|first3 = Perdita|last4 = Baumann|first4 = Wolfgang|last5 = Spannenberg|first5 = Anke|year = 2003|title = The Titanocene Complex of Bis(trimethylsilyl)acetylene: Synthesis, Structure, and Chemistry|journal = Organometallics|volume = 22|issue = 5|pages = 884–900|doi = 10.1021/om0208570}}</ref> center|frameless|686x686px
Titanocene equivalents react with alkenyl alkynes followed by carbonylation and hydrolysis to form bicyclic cyclopentadienones, related to the Pauson–Khand reaction.<ref>{{cite journal | first=F. A. |last=Hicks| title=Scope of the Intramolecular Titanocene-Catalyzed Pauson-Khand Type Reaction | journal=J. Am. Chem. Soc. | volume=121 | year=1999 | issue=25 | pages=5881–5898 | doi = 10.1021/ja990682u|display-authors=etal}}</ref> A similar reaction is the reductive cyclization of enones to form the corresponding alcohol in a stereoselective manner.<ref>{{cite journal | first1= N. M. |last1=Kablaoui |first2=S. L. |last2=Buchwald | title = Development of a Method for the Reductive Cyclization of Enones by a Titanium Catalyst | journal = J. Am. Chem. Soc. | volume = 118 | year = 1998 | issue = 13 | pages = 3182–3191 | doi = 10.1021/ja954192n}}</ref>
Reduction of titanocene dichloride in the presence of conjugated dienes such as 1,3-butadiene gives ''η''<sup>3</sup>-allyltitanium complexes.<ref>{{cite journal | first1= F. |last1=Sato | title = Synthesis of Organotitanium Complexes from Alkenes and Alkynes and Their Synthetic Applications | journal = Chem. Rev. | volume = 100 | issue = 8 | year = 2000 | pages = 2835–2886 | doi = 10.1021/cr990277l | last2 = Urabe | first2 = Hirokazu | last3 = Okamoto | first3 = Sentaro | pmid=11749307}}</ref> Related reactions occur with diynes. Furthermore, titanocene can catalyze C–C bond metathesis to form asymmetric diynes.<ref name="rosenthal" />
Titanocene dichloride as a photoredox catalyst to open epoxides in green light.<ref>{{Cite journal |last1=Zhang |first1=Zhenhua |last2=Hilche |first2=Tobias |last3=Slak |first3=Daniel |last4=Rietdijk |first4=Niels R. |last5=Oloyede |first5=Ugochinyere N. |last6=Flowers |first6=Robert A. |last7=Gansäuer |first7=Andreas |date=2020-06-08 |title=Titanocenes as Photoredox Catalysts Using Green-Light Irradiation |journal=Angewandte Chemie International Edition |language=en |volume=59 |issue=24 |pages=9355–9359 |doi=10.1002/anie.202001508 |issn=1433-7851 |pmc=7317808 |pmid=32216162 |bibcode=2020ACIE...59.9355Z }}</ref>
===Derivatives of (C<sub>5</sub>Me<sub>5</sub>)<sub>2</sub>TiCl<sub>2</sub>=== Many analogues of Cp<sub>2</sub>TiCl<sub>2</sub> are known. Prominent examples are the ring-methylated derivatives (C<sub>5</sub>H<sub>4</sub>Me)<sub>2</sub>TiCl<sub>2</sub> and (C<sub>5</sub>Me<sub>5</sub>)<sub>2</sub>TiCl<sub>2</sub>.
==Medicinal research== Titanocene dichloride was investigated as an anticancer drug. In fact, it was both the first non-platinum coordination complex and the first metallocene to undergo a clinical trial.<ref name = "anti-cancer">{{cite book|title = Bioinorganic Chemistry: A Short Course|first = R. M.|last = Roat-Malone|edition = 2nd|year = 2007|publisher = John Wiley & Sons|pages = 19–20|isbn = 978-0-471-76113-6|url = https://books.google.com/books?id=Ykx54y7LdK8C&q=molybdocene+dichloride&pg=PA20}}</ref><ref>{{cite journal|doi=10.1039/C6CS00860G|pmid=28124046|author1=Cini, M.|author2=Bradshaw, T. D.|author3=Woodward, S.|title=Using titanium complexes to defeat cancer: the view from the shoulders of Titans|journal=Chem. Soc. Rev.|year=2017|volume=46|issue=4|pages=1040–1051|url=http://eprints.nottingham.ac.uk/40186/1/ChemSocRev-ForNottsEPrints.pdf|access-date=2019-07-13|archive-date=2018-07-19|archive-url=https://web.archive.org/web/20180719211541/http://eprints.nottingham.ac.uk/40186/1/ChemSocRev-ForNottsEPrints.pdf|url-status=dead}}</ref>
==References== {{reflist|30em}}
==Further reading== * {{OrgSynth|prep=V79P0019|last1=Payack|first1= J. F.|last2= Hughes|first2= D. L.|last3= Cai|first3= D.|last4= Cottrell |first4=I. F.|last5= Verhoeven |first5=T. R. |title=Dimethyltitanocene Titanium, bis(''η''<sup>5</sup>-2,4-cyclopentadien-1-yl)dimethyl- |collvol=10 |collvolpage=355 |volume= 79 |page=19 |date=2002}}. * {{cite journal | first1= S.|last1= Gambarotta |first2=C. |last2=Floriani |first3=A. |last3=Chiesi-Villa |first4=C. |last4=Guastini | title = Cyclopentadienyldichlorotitanium(III): a free-radical-like reagent for reducing azo (N:N) multiple bonds in azo and diazo compounds | year = 1983 | journal = J. Am. Chem. Soc. | volume = 105 | issue = 25 | pages = 7295–7301 | doi = 10.1021/ja00363a015 |bibcode= 1983JAChS.105.7295G }} * {{cite journal | first= P. J.|last= Chirik | title = Group 4 Transition Metal Sandwich Complexes: Still Fresh after Almost 60 Years | year = 2010 | journal = Organometallics | volume = 29 | issue = 7 | pages = 1500–1517 | doi = 10.1021/om100016p}}
{{Titanium compounds}} {{Cyclopentadiene complexes}}
{{DEFAULTSORT:Titanocene Dichloride}} Category:Titanocenes Category:Chloro complexes Category:Titanium(IV) compounds